diff --git a/NzbDrone.Web/NzbDrone.Web.csproj b/NzbDrone.Web/NzbDrone.Web.csproj index 0af7be141..48a753080 100644 --- a/NzbDrone.Web/NzbDrone.Web.csproj +++ b/NzbDrone.Web/NzbDrone.Web.csproj @@ -7,7 +7,7 @@ </ProductVersion> <SchemaVersion>2.0</SchemaVersion> <ProjectGuid>{43BD3BBD-1531-4D8F-9C08-E1CD544AB2CD}</ProjectGuid> - <ProjectTypeGuids>{F85E285D-A4E0-4152-9332-AB1D724D3325};{349c5851-65df-11da-9384-00065b846f21};{fae04ec0-301f-11d3-bf4b-00c04f79efbc}</ProjectTypeGuids> + <ProjectTypeGuids>{E53F8FEA-EAE0-44A6-8774-FFD645390401};{349c5851-65df-11da-9384-00065b846f21};{fae04ec0-301f-11d3-bf4b-00c04f79efbc}</ProjectTypeGuids> <OutputType>Library</OutputType> <AppDesignerFolder>Properties</AppDesignerFolder> <RootNamespace>NzbDrone.Web</RootNamespace> @@ -69,11 +69,12 @@ <Reference Include="System.Web" /> <Reference Include="System.Web.Abstractions" /> <Reference Include="System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL"> - <Private>True</Private> </Reference> + <Reference Include="System.Web.Razor, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL" /> <Reference Include="System.Web.Routing"> <Private>False</Private> </Reference> + <Reference Include="System.Web.WebPages.Razor, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL" /> <Reference Include="System.Xml" /> <Reference Include="System.Configuration" /> <Reference Include="System.Web.Services" /> @@ -86,6 +87,8 @@ <SpecificVersion>False</SpecificVersion> <HintPath>..\NzbDrone.Core\Libraries\TvdbLib.dll</HintPath> </Reference> + <Reference Include="System.Web.WebPages" /> + <Reference Include="System.Web.Helpers" /> </ItemGroup> <ItemGroup> <Compile Include="App_GlobalResources\EditorLocalization.bg-BG.designer.cs"> @@ -606,11 +609,10 @@ <Content Include="Scripts\jquery-tgc-countdown-1.0.js" /> <Content Include="Scripts\jquery.simpledropdown.js" /> <Content Include="Scripts\Notification.js" /> - <Content Include="Views\AddSeries\AddSeriesItem.ascx" /> + <None Include="Views\AddSeries\AddSeriesItem.cshtml" /> <Content Include="Views\History\Index.aspx" /> <Content Include="Views\Log\Index.aspx" /> <Content Include="Views\AddSeries\AddExisting.aspx" /> - <Content Include="Views\AddSeries\AddExistingManual.aspx" /> <Content Include="Views\AddSeries\AddNew.aspx" /> <Content Include="Views\Series\Details.aspx" /> <Content Include="Views\Series\Edit.aspx" /> @@ -648,6 +650,14 @@ <Content Include="Scripts\MicrosoftMvcValidation.debug.js" /> <Content Include="Views\Shared\Error.aspx" /> <Content Include="Views\Shared\Site.Master" /> + <Content Include="Scripts\jquery-ui.js" /> + <Content Include="Scripts\jquery-ui.min.js" /> + <Content Include="Scripts\jquery.validate.min.js" /> + <Content Include="Scripts\jquery.unobtrusive-ajax.js" /> + <Content Include="Scripts\jquery.unobtrusive-ajax.min.js" /> + <Content Include="Scripts\jquery.validate.unobtrusive.js" /> + <Content Include="Scripts\jquery.validate.unobtrusive.min.js" /> + <Content Include="Views\Web.config" /> </ItemGroup> <ItemGroup> <Folder Include="App_Data\" /> diff --git a/NzbDrone.Web/Scripts/MicrosoftMvcValidation.debug.js b/NzbDrone.Web/Scripts/MicrosoftMvcValidation.debug.js index 9896f90ae..346ba4818 100644 --- a/NzbDrone.Web/Scripts/MicrosoftMvcValidation.debug.js +++ b/NzbDrone.Web/Scripts/MicrosoftMvcValidation.debug.js @@ -314,9 +314,11 @@ Sys.Mvc.FormContext.prototype = { var errors = []; for (var i = 0; i < fields.length; i++) { var field = fields[i]; - var thisErrors = field.validate(eventName); - if (thisErrors) { - Array.addRange(errors, thisErrors); + if (!field.elements[0].disabled) { + var thisErrors = field.validate(eventName); + if (thisErrors) { + Array.addRange(errors, thisErrors); + } } } if (this.replaceValidationSummary) { @@ -578,8 +580,8 @@ Sys.Mvc.RangeValidator.create = function Sys_Mvc_RangeValidator$create(rule) { /// <param name="rule" type="Sys.Mvc.JsonValidationRule"> /// </param> /// <returns type="Sys.Mvc.Validator"></returns> - var min = rule.ValidationParameters['minimum']; - var max = rule.ValidationParameters['maximum']; + var min = rule.ValidationParameters['min']; + var max = rule.ValidationParameters['max']; return Function.createDelegate(new Sys.Mvc.RangeValidator(min, max), new Sys.Mvc.RangeValidator(min, max).validate); } Sys.Mvc.RangeValidator.prototype = { @@ -765,8 +767,8 @@ Sys.Mvc.StringLengthValidator.create = function Sys_Mvc_StringLengthValidator$cr /// <param name="rule" type="Sys.Mvc.JsonValidationRule"> /// </param> /// <returns type="Sys.Mvc.Validator"></returns> - var minLength = rule.ValidationParameters['minimumLength']; - var maxLength = rule.ValidationParameters['maximumLength']; + var minLength = (rule.ValidationParameters['min'] || 0); + var maxLength = (rule.ValidationParameters['max'] || Number.MAX_VALUE); return Function.createDelegate(new Sys.Mvc.StringLengthValidator(minLength, maxLength), new Sys.Mvc.StringLengthValidator(minLength, maxLength).validate); } Sys.Mvc.StringLengthValidator.prototype = { @@ -846,7 +848,7 @@ Sys.Mvc.ValidatorRegistry.getValidator = function Sys_Mvc_ValidatorRegistry$getV } Sys.Mvc.ValidatorRegistry._getDefaultValidators = function Sys_Mvc_ValidatorRegistry$_getDefaultValidators() { /// <returns type="Object"></returns> - return { required: Function.createDelegate(null, Sys.Mvc.RequiredValidator.create), stringLength: Function.createDelegate(null, Sys.Mvc.StringLengthValidator.create), regularExpression: Function.createDelegate(null, Sys.Mvc.RegularExpressionValidator.create), range: Function.createDelegate(null, Sys.Mvc.RangeValidator.create), number: Function.createDelegate(null, Sys.Mvc.NumberValidator.create) }; + return { required: Function.createDelegate(null, Sys.Mvc.RequiredValidator.create), length: Function.createDelegate(null, Sys.Mvc.StringLengthValidator.create), regex: Function.createDelegate(null, Sys.Mvc.RegularExpressionValidator.create), range: Function.createDelegate(null, Sys.Mvc.RangeValidator.create), number: Function.createDelegate(null, Sys.Mvc.NumberValidator.create) }; } diff --git a/NzbDrone.Web/Scripts/MicrosoftMvcValidation.js b/NzbDrone.Web/Scripts/MicrosoftMvcValidation.js index 2d1789ddc..9483492f1 100644 --- a/NzbDrone.Web/Scripts/MicrosoftMvcValidation.js +++ b/NzbDrone.Web/Scripts/MicrosoftMvcValidation.js @@ -18,11 +18,11 @@ Sys.Mvc.FormContext.getValidationForForm=function(formElement){return formElemen Sys.Mvc.FormContext.$10=function($p0,$p1){while($p1){if($p0===$p1){return true;}$p1=$p1.parentNode;}return false;} Sys.Mvc.FormContext.$12=function($p0){var $0=$get($p0.FormId);var $1=(!Sys.Mvc._ValidationUtil.$1($p0.ValidationSummaryId))?$get($p0.ValidationSummaryId):null;var $2=new Sys.Mvc.FormContext($0,$1);$2.enableDynamicValidation();$2.replaceValidationSummary=$p0.ReplaceValidationSummary;for(var $4=0;$4<$p0.Fields.length;$4++){var $5=$p0.Fields[$4];var $6=Sys.Mvc.FormContext.$F($0,$5.FieldName);var $7=(!Sys.Mvc._ValidationUtil.$1($5.ValidationMessageId))?$get($5.ValidationMessageId):null;var $8=new Sys.Mvc.FieldContext($2);Array.addRange($8.elements,$6);$8.validationMessageElement=$7;$8.replaceValidationMessageContents=$5.ReplaceValidationMessageContents;for(var $9=0;$9<$5.ValidationRules.length;$9++){var $A=$5.ValidationRules[$9];var $B=Sys.Mvc.ValidatorRegistry.getValidator($A);if($B){var $C=Sys.Mvc.$create_Validation();$C.fieldErrorMessage=$A.ErrorMessage;$C.validator=$B;Array.add($8.validations,$C);}}$8.enableDynamicValidation();Array.add($2.fields,$8);}var $3=$0.validationCallbacks;if(!$3){$3=[];$0.validationCallbacks = $3;}$3.push(Function.createDelegate(null,function(){ return Sys.Mvc._ValidationUtil.$0($2.validate('submit'));}));return $2;} -Sys.Mvc.FormContext.prototype={$3:null,$4:null,$6:null,$7:null,$8:null,$9:null,replaceValidationSummary:false,addError:function(message){this.addErrors([message]);},addErrors:function(messages){if(!Sys.Mvc._ValidationUtil.$0(messages)){Array.addRange(this.$5,messages);this.$11();}},clearErrors:function(){Array.clear(this.$5);this.$11();},$A:function(){if(this.$7){if(this.$8){Sys.Mvc._ValidationUtil.$3(this.$8);for(var $0=0;$0<this.$5.length;$0++){var $1=document.createElement('li');Sys.Mvc._ValidationUtil.$4($1,this.$5[$0]);this.$8.appendChild($1);}}Sys.UI.DomElement.removeCssClass(this.$7,'validation-summary-valid');Sys.UI.DomElement.addCssClass(this.$7,'validation-summary-errors');}},$B:function(){var $0=this.$7;if($0){var $1=this.$8;if($1){$1.innerHTML='';}Sys.UI.DomElement.removeCssClass($0,'validation-summary-errors');Sys.UI.DomElement.addCssClass($0,'validation-summary-valid');}},enableDynamicValidation:function(){Sys.UI.DomEvent.addHandler(this.$9,'click',this.$3);Sys.UI.DomEvent.addHandler(this.$9,'submit',this.$4);},$C:function($p0){if($p0.disabled){return null;}var $0=$p0.tagName.toUpperCase();var $1=$p0;if($0==='INPUT'){var $2=$1.type;if($2==='submit'||$2==='image'){return $1;}}else if(($0==='BUTTON')&&($1.type==='submit')){return $1;}return null;},$D:function($p0){this.$6=this.$C($p0.target);},$E:function($p0){var $0=$p0.target;var $1=this.$6;if($1&&$1.disableValidation){return;}var $2=this.validate('submit');if(!Sys.Mvc._ValidationUtil.$0($2)){$p0.preventDefault();}},$11:function(){if(!this.$5.length){this.$B();}else{this.$A();}},validate:function(eventName){var $0=this.fields;var $1=[];for(var $2=0;$2<$0.length;$2++){var $3=$0[$2];var $4=$3.validate(eventName);if($4){Array.addRange($1,$4);}}if(this.replaceValidationSummary){this.clearErrors();this.addErrors($1);}return $1;}} +Sys.Mvc.FormContext.prototype={$3:null,$4:null,$6:null,$7:null,$8:null,$9:null,replaceValidationSummary:false,addError:function(message){this.addErrors([message]);},addErrors:function(messages){if(!Sys.Mvc._ValidationUtil.$0(messages)){Array.addRange(this.$5,messages);this.$11();}},clearErrors:function(){Array.clear(this.$5);this.$11();},$A:function(){if(this.$7){if(this.$8){Sys.Mvc._ValidationUtil.$3(this.$8);for(var $0=0;$0<this.$5.length;$0++){var $1=document.createElement('li');Sys.Mvc._ValidationUtil.$4($1,this.$5[$0]);this.$8.appendChild($1);}}Sys.UI.DomElement.removeCssClass(this.$7,'validation-summary-valid');Sys.UI.DomElement.addCssClass(this.$7,'validation-summary-errors');}},$B:function(){var $0=this.$7;if($0){var $1=this.$8;if($1){$1.innerHTML='';}Sys.UI.DomElement.removeCssClass($0,'validation-summary-errors');Sys.UI.DomElement.addCssClass($0,'validation-summary-valid');}},enableDynamicValidation:function(){Sys.UI.DomEvent.addHandler(this.$9,'click',this.$3);Sys.UI.DomEvent.addHandler(this.$9,'submit',this.$4);},$C:function($p0){if($p0.disabled){return null;}var $0=$p0.tagName.toUpperCase();var $1=$p0;if($0==='INPUT'){var $2=$1.type;if($2==='submit'||$2==='image'){return $1;}}else if(($0==='BUTTON')&&($1.type==='submit')){return $1;}return null;},$D:function($p0){this.$6=this.$C($p0.target);},$E:function($p0){var $0=$p0.target;var $1=this.$6;if($1&&$1.disableValidation){return;}var $2=this.validate('submit');if(!Sys.Mvc._ValidationUtil.$0($2)){$p0.preventDefault();}},$11:function(){if(!this.$5.length){this.$B();}else{this.$A();}},validate:function(eventName){var $0=this.fields;var $1=[];for(var $2=0;$2<$0.length;$2++){var $3=$0[$2];if(!$3.elements[0].disabled){var $4=$3.validate(eventName);if($4){Array.addRange($1,$4);}}}if(this.replaceValidationSummary){this.clearErrors();this.addErrors($1);}return $1;}} Sys.Mvc.FieldContext=function(formContext){this.$A=[];this.elements=new Array(0);this.validations=new Array(0);this.formContext=formContext;this.$6=Function.createDelegate(this,this.$D);this.$7=Function.createDelegate(this,this.$E);this.$8=Function.createDelegate(this,this.$F);this.$9=Function.createDelegate(this,this.$10);} Sys.Mvc.FieldContext.prototype={$6:null,$7:null,$8:null,$9:null,defaultErrorMessage:null,formContext:null,replaceValidationMessageContents:false,validationMessageElement:null,addError:function(message){this.addErrors([message]);},addErrors:function(messages){if(!Sys.Mvc._ValidationUtil.$0(messages)){Array.addRange(this.$A,messages);this.$14();}},clearErrors:function(){Array.clear(this.$A);this.$14();},$B:function(){var $0=this.validationMessageElement;if($0){if(this.replaceValidationMessageContents){Sys.Mvc._ValidationUtil.$4($0,this.$A[0]);}Sys.UI.DomElement.removeCssClass($0,'field-validation-valid');Sys.UI.DomElement.addCssClass($0,'field-validation-error');}var $1=this.elements;for(var $2=0;$2<$1.length;$2++){var $3=$1[$2];Sys.UI.DomElement.removeCssClass($3,'input-validation-valid');Sys.UI.DomElement.addCssClass($3,'input-validation-error');}},$C:function(){var $0=this.validationMessageElement;if($0){if(this.replaceValidationMessageContents){Sys.Mvc._ValidationUtil.$4($0,'');}Sys.UI.DomElement.removeCssClass($0,'field-validation-error');Sys.UI.DomElement.addCssClass($0,'field-validation-valid');}var $1=this.elements;for(var $2=0;$2<$1.length;$2++){var $3=$1[$2];Sys.UI.DomElement.removeCssClass($3,'input-validation-error');Sys.UI.DomElement.addCssClass($3,'input-validation-valid');}},$D:function($p0){if($p0.target['__MVC_HasTextChanged']||$p0.target['__MVC_HasValidationFired']){this.validate('blur');}},$E:function($p0){$p0.target['__MVC_HasTextChanged'] = true;},$F:function($p0){$p0.target['__MVC_HasTextChanged'] = true;if($p0.target['__MVC_HasValidationFired']){this.validate('input');}},$10:function($p0){if($p0.rawEvent.propertyName==='value'){$p0.target['__MVC_HasTextChanged'] = true;if($p0.target['__MVC_HasValidationFired']){this.validate('input');}}},enableDynamicValidation:function(){var $0=this.elements;for(var $1=0;$1<$0.length;$1++){var $2=$0[$1];if(Sys.Mvc._ValidationUtil.$2($2,'onpropertychange')){var $3=document.documentMode;if($3&&$3>=8){Sys.UI.DomEvent.addHandler($2,'propertychange',this.$9);}}else{Sys.UI.DomEvent.addHandler($2,'input',this.$8);}Sys.UI.DomEvent.addHandler($2,'change',this.$7);Sys.UI.DomEvent.addHandler($2,'blur',this.$6);}},$11:function($p0,$p1){var $0=$p1||this.defaultErrorMessage;if(Boolean.isInstanceOfType($p0)){return ($p0)?null:$0;}if(String.isInstanceOfType($p0)){return (($p0).length)?$p0:$0;}return null;},$12:function(){var $0=this.elements;return ($0.length>0)?$0[0].value:null;},$13:function(){var $0=this.elements;for(var $1=0;$1<$0.length;$1++){var $2=$0[$1];$2['__MVC_HasValidationFired'] = true;}},$14:function(){if(!this.$A.length){this.$C();}else{this.$B();}},validate:function(eventName){var $0=this.validations;var $1=[];var $2=this.$12();for(var $3=0;$3<$0.length;$3++){var $4=$0[$3];var $5=Sys.Mvc.$create_ValidationContext();$5.eventName=eventName;$5.fieldContext=this;$5.validation=$4;var $6=$4.validator($2,$5);var $7=this.$11($6,$4.fieldErrorMessage);if(!Sys.Mvc._ValidationUtil.$1($7)){Array.add($1,$7);}}this.$13();this.clearErrors();this.addErrors($1);return $1;}} Sys.Mvc.RangeValidator=function(minimum,maximum){this.$0=minimum;this.$1=maximum;} -Sys.Mvc.RangeValidator.create=function(rule){var $0=rule.ValidationParameters['minimum'];var $1=rule.ValidationParameters['maximum'];return Function.createDelegate(new Sys.Mvc.RangeValidator($0,$1),new Sys.Mvc.RangeValidator($0,$1).validate);} +Sys.Mvc.RangeValidator.create=function(rule){var $0=rule.ValidationParameters['min'];var $1=rule.ValidationParameters['max'];return Function.createDelegate(new Sys.Mvc.RangeValidator($0,$1),new Sys.Mvc.RangeValidator($0,$1).validate);} Sys.Mvc.RangeValidator.prototype={$0:null,$1:null,validate:function(value,context){if(Sys.Mvc._ValidationUtil.$1(value)){return true;}var $0=Number.parseLocale(value);return (!isNaN($0)&&this.$0<=$0&&$0<=this.$1);}} Sys.Mvc.RegularExpressionValidator=function(pattern){this.$0=pattern;} Sys.Mvc.RegularExpressionValidator.create=function(rule){var $0=rule.ValidationParameters['pattern'];return Function.createDelegate(new Sys.Mvc.RegularExpressionValidator($0),new Sys.Mvc.RegularExpressionValidator($0).validate);} @@ -37,7 +37,7 @@ Sys.Mvc.RequiredValidator.$4=function($p0){for(var $0=0;$0<$p0.length;$0++){var Sys.Mvc.RequiredValidator.$5=function($p0){return (!Sys.Mvc._ValidationUtil.$1($p0.value));} Sys.Mvc.RequiredValidator.prototype={validate:function(value,context){var $0=context.fieldContext.elements;if(!$0.length){return true;}var $1=$0[0];if(Sys.Mvc.RequiredValidator.$2($1)){return Sys.Mvc.RequiredValidator.$5($1);}if(Sys.Mvc.RequiredValidator.$0($1)){return Sys.Mvc.RequiredValidator.$3($0);}if(Sys.Mvc.RequiredValidator.$1($1)){return Sys.Mvc.RequiredValidator.$4(($1).options);}return true;}} Sys.Mvc.StringLengthValidator=function(minLength,maxLength){this.$1=minLength;this.$0=maxLength;} -Sys.Mvc.StringLengthValidator.create=function(rule){var $0=rule.ValidationParameters['minimumLength'];var $1=rule.ValidationParameters['maximumLength'];return Function.createDelegate(new Sys.Mvc.StringLengthValidator($0,$1),new Sys.Mvc.StringLengthValidator($0,$1).validate);} +Sys.Mvc.StringLengthValidator.create=function(rule){var $0=(rule.ValidationParameters['min']||0);var $1=(rule.ValidationParameters['max']||Number.MAX_VALUE);return Function.createDelegate(new Sys.Mvc.StringLengthValidator($0,$1),new Sys.Mvc.StringLengthValidator($0,$1).validate);} Sys.Mvc.StringLengthValidator.prototype={$0:0,$1:0,validate:function(value,context){if(Sys.Mvc._ValidationUtil.$1(value)){return true;}return (this.$1<=value.length&&value.length<=this.$0);}} Sys.Mvc._ValidationUtil=function(){} Sys.Mvc._ValidationUtil.$0=function($p0){return (!$p0||!$p0.length);} @@ -47,7 +47,7 @@ Sys.Mvc._ValidationUtil.$3=function($p0){while($p0.firstChild){$p0.removeChild($ Sys.Mvc._ValidationUtil.$4=function($p0,$p1){var $0=document.createTextNode($p1);Sys.Mvc._ValidationUtil.$3($p0);$p0.appendChild($0);} Sys.Mvc.ValidatorRegistry=function(){} Sys.Mvc.ValidatorRegistry.getValidator=function(rule){var $0=Sys.Mvc.ValidatorRegistry.validators[rule.ValidationType];return ($0)?$0(rule):null;} -Sys.Mvc.ValidatorRegistry.$0=function(){return {required:Function.createDelegate(null,Sys.Mvc.RequiredValidator.create),stringLength:Function.createDelegate(null,Sys.Mvc.StringLengthValidator.create),regularExpression:Function.createDelegate(null,Sys.Mvc.RegularExpressionValidator.create),range:Function.createDelegate(null,Sys.Mvc.RangeValidator.create),number:Function.createDelegate(null,Sys.Mvc.NumberValidator.create)};} +Sys.Mvc.ValidatorRegistry.$0=function(){return {required:Function.createDelegate(null,Sys.Mvc.RequiredValidator.create),length:Function.createDelegate(null,Sys.Mvc.StringLengthValidator.create),regex:Function.createDelegate(null,Sys.Mvc.RegularExpressionValidator.create),range:Function.createDelegate(null,Sys.Mvc.RangeValidator.create),number:Function.createDelegate(null,Sys.Mvc.NumberValidator.create)};} Sys.Mvc.NumberValidator.registerClass('Sys.Mvc.NumberValidator');Sys.Mvc.FormContext.registerClass('Sys.Mvc.FormContext');Sys.Mvc.FieldContext.registerClass('Sys.Mvc.FieldContext');Sys.Mvc.RangeValidator.registerClass('Sys.Mvc.RangeValidator');Sys.Mvc.RegularExpressionValidator.registerClass('Sys.Mvc.RegularExpressionValidator');Sys.Mvc.RequiredValidator.registerClass('Sys.Mvc.RequiredValidator');Sys.Mvc.StringLengthValidator.registerClass('Sys.Mvc.StringLengthValidator');Sys.Mvc._ValidationUtil.registerClass('Sys.Mvc._ValidationUtil');Sys.Mvc.ValidatorRegistry.registerClass('Sys.Mvc.ValidatorRegistry');Sys.Mvc.ValidatorRegistry.validators=Sys.Mvc.ValidatorRegistry.$0(); // ---- Do not remove this footer ---- // Generated using Script# v0.5.0.0 (http://projects.nikhilk.net) diff --git a/NzbDrone.Web/Scripts/jquery-ui.js b/NzbDrone.Web/Scripts/jquery-ui.js new file mode 100644 index 000000000..01f5d7310 --- /dev/null +++ b/NzbDrone.Web/Scripts/jquery-ui.js @@ -0,0 +1,11630 @@ +/*! + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI + */ +(function( $, undefined ) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.8.7", + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +// plugins +$.fn.extend({ + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + // <div style="z-index: -10;"><div style="z-index: 0;"></div></div> + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +$.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; + if ( border ) { + size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; +}); + +// selectors +function visible( element ) { + return !$( element ).parents().andSelf().filter(function() { + return $.curCSS( this, "visibility" ) === "hidden" || + $.expr.filters.hidden( this ); + }).length; +} + +$.extend( $.expr[ ":" ], { + data: function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + var nodeName = element.nodeName.toLowerCase(), + tabIndex = $.attr( element, "tabindex" ); + if ( "area" === nodeName ) { + var map = element.parentNode, + mapName = map.name, + img; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) + ? !element.disabled + : "a" == nodeName + ? element.href || !isNaN( tabIndex ) + : !isNaN( tabIndex )) + // the element and all of its ancestors must be visible + && visible( element ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ); + return ( isNaN( tabIndex ) || tabIndex >= 0 ) && $( element ).is( ":focusable" ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + + + + + +// deprecated +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var proto = $.ui[ module ].prototype; + for ( var i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode ) { + return; + } + + for ( var i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() + contains: function( a, b ) { + return document.compareDocumentPosition ? + a.compareDocumentPosition( b ) & 16 : + a !== b && a.contains( b ); + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery ); +/*! + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Widget 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Widget + */ +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + $( elem ).triggerHandler( "remove" ); + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + $( this ).triggerHandler( "remove" ); + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var callback = this.options[ type ]; + + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + data = data || {}; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( event.originalEvent ) { + for ( var i = $.event.props.length, prop; i; ) { + prop = $.event.props[ --i ]; + event[ prop ] = event.originalEvent[ prop ]; + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); +/*! + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Mouse 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + // TODO: figure out why we have to use originalEvent + event.originalEvent = event.originalEvent || {}; + if (event.originalEvent.mouseHandled) { return; } + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + event.originalEvent.mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Draggable 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.draggable", $.ui.mouse, { + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + }, + _create: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger('drag', event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is removed, don't bother to continue + if(!this.element[0] || !this.element[0].parentNode) + return false; + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(self._trigger("stop", event) !== false) { + self._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + (o.containment == 'document' ? 0 : $(window).scrollLeft()) - this.offset.relative.left - this.offset.parent.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) - this.offset.relative.top - this.offset.parent.top, + (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var ce = $(o.containment)[0]; if(!ce) return; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.extend($.ui.draggable, { + version: "1.8.7" +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "iframeFix", { + start: function(event, ui) { + var o = $(this).data('draggable').options; + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + }, + stop: function(event, ui) { + $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + if (!group.length) { return; } + + var min = parseInt(group[0].style.zIndex) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); + + this[0].style.zIndex = min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Droppable 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.mouse.js + * jquery.ui.draggable.js + */ +(function( $, undefined ) { + +$.widget("ui.droppable", { + widgetEventPrefix: "drop", + options: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + }, + _create: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); + + (o.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + + return this; + }, + + _setOption: function(key, value) { + + if(key == 'accept') { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } + $.Widget.prototype._setOption.apply(this, arguments); + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if( + inst.options.greedy + && !inst.options.disabled + && inst.options.scope == draggable.options.scope + && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) + && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) return false; + + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.8.7" +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l <= x1 && x2 <= r + && t <= y1 && y2 <= b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope] || []; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = dropped || this._drop.call(this, event); + + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + var parent = this.element.parents(':data(droppable):eq(0)'); + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + } +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Resizable 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.resizable", $.ui.mouse, { + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + }, + _create: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Opera fix for relative positioning + if (/relative/.test(this.element.css('position')) && $.browser.opera) + this.element.css({ position: 'relative', top: 'auto', left: 'auto' }); + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>'); + + // increase zIndex of sw, se, ne, nw axis + //TODO : this modifies original option + if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.after( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var handle = false; + for (var i in this.handles) { + if ($(this.handles[i])[0] == event.target) { + handle = true; + } + } + + return !this.options.disabled && handle; + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + //Opera fixing relative position + if ($.browser.opera && (/relative/).test(el.css('position'))) + el.css({ position: 'relative', top: 'auto', left: 'auto' }); + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (data.height) data.width = (csize.height * this.aspectRatio); + else if (data.width) data.height = (csize.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('<div style="overflow:hidden;"></div>'); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +$.extend($.ui.resizable, { + version: "1.8.7" +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10), + position: el.css('position') // to reset Opera on stop() + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + // Opera fixing relative position + if ($.browser.opera && /relative/.test(el.css('position'))) { + self._revertToRelativePosition = true; + el.css({ position: 'absolute', top: 'auto', left: 'auto' }); + } + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _reset = function (exp) { + $(exp).each(function() { + var el = $(this); + // reset position for Opera - no need to verify it was changed + el.css({ position: el.data("resizable-alsoresize").position }); + }); + }; + + if (self._revertToRelativePosition) { + self._revertToRelativePosition = false; + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp) { _reset(exp); }); + }else{ + _reset(o.alsoResize); + } + } + + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / o.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * o.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Selectable 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.selectable", $.ui.mouse, { + options: { + appendTo: 'body', + autoRefresh: true, + distance: 0, + filter: '*', + tolerance: 'touch' + }, + _create: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("<div class='ui-selectable-helper'></div>"); + }, + + destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + + return this; + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + var doSelect = !event.metaKey || !selectee.$element.hasClass('ui-selected'); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + self._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if (event.metaKey && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +$.extend($.ui.selectable, { + version: "1.8.7" +}); + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Sortable 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.sortable", $.ui.mouse, { + widgetEventPrefix: "sort", + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are floating + this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + }, + + destroy: function() { + this.element + .removeClass("ui-sortable ui-sortable-disabled") + .removeData("sortable") + .unbind(".sortable"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData("sortable-item"); + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget() + [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, 'sortable-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + if(itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp(); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + if(!str.length && o.key) { + str.push(o.key + '='); + } + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(sortable-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data('sortable-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + return this; + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + + // get innermost container that intersects with item + var innermostContainer = null, innermostIndex = null; + + + for (var i = this.containers.length - 1; i >= 0; i--){ + + // never consider a container that's located within the item itself + if($.ui.contains(this.currentItem[0], this.containers[i].element[0])) + continue; + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0])) + continue; + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) return; + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else if(this.currentContainer != this.containers[innermostIndex]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; + var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top']; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + return; + + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element + if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + for (var i = this.containers.length - 1; i >= 0; i--){ + if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + } + }; + }; + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + originalPosition: self.originalPosition, + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +}); + +$.extend($.ui.sortable, { + version: "1.8.7" +}); + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/ + */ +;jQuery.effects || (function($, undefined) { + +$.effects = {}; + + + +/******************************************************************************/ +/****************************** COLOR ANIMATIONS ******************************/ +/******************************************************************************/ + +// override the animation for color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', + 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'], +function(i, attr) { + $.fx.step[attr] = function(fx) { + if (!fx.colorInit) { + fx.start = getColor(fx.elem, attr); + fx.end = getRGB(fx.end); + fx.colorInit = true; + } + + fx.elem.style[attr] = 'rgb(' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + color = $.curCSS(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + + + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ + +var classAnimationActions = ['add', 'remove', 'toggle'], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +function getElementStyles() { + var style = document.defaultView + ? document.defaultView.getComputedStyle(this, null) + : this.currentStyle, + newStyle = {}, + key, + camelCase; + + // webkit enumerates style porperties + if (style && style.length && style[0] && style[style[0]]) { + var len = style.length; + while (len--) { + key = style[len]; + if (typeof style[key] == 'string') { + camelCase = key.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + newStyle[camelCase] = style[key]; + } + } + } else { + for (key in style) { + if (typeof style[key] === 'string') { + newStyle[key] = style[key]; + } + } + } + + return newStyle; +} + +function filterStyles(styles) { + var name, value; + for (name in styles) { + value = styles[name]; + if ( + // ignore null and undefined values + value == null || + // ignore functions (when does this occur?) + $.isFunction(value) || + // shorthand styles that need to be expanded + name in shorthandStyles || + // ignore scrollbars (break in IE) + (/scrollbar/).test(name) || + + // only colors or values that can be converted to numbers + (!(/color/i).test(name) && isNaN(parseFloat(value))) + ) { + delete styles[name]; + } + } + + return styles; +} + +function styleDifference(oldStyle, newStyle) { + var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 + name; + + for (name in newStyle) { + if (oldStyle[name] != newStyle[name]) { + diff[name] = newStyle[name]; + } + } + + return diff; +} + +$.effects.animateClass = function(value, duration, easing, callback) { + if ($.isFunction(easing)) { + callback = easing; + easing = null; + } + + return this.each(function() { + $.queue(this, 'fx', function() { + var that = $(this), + originalStyleAttr = that.attr('style') || ' ', + originalStyle = filterStyles(getElementStyles.call(this)), + newStyle, + className = that.attr('className'); + + $.each(classAnimationActions, function(i, action) { + if (value[action]) { + that[action + 'Class'](value[action]); + } + }); + newStyle = filterStyles(getElementStyles.call(this)); + that.attr('className', className); + + that.animate(styleDifference(originalStyle, newStyle), duration, easing, function() { + $.each(classAnimationActions, function(i, action) { + if (value[action]) { that[action + 'Class'](value[action]); } + }); + // work around bug in IE by clearing the cssText before setting it + if (typeof that.attr('style') == 'object') { + that.attr('style').cssText = ''; + that.attr('style').cssText = originalStyleAttr; + } else { + that.attr('style', originalStyleAttr); + } + if (callback) { callback.apply(this, arguments); } + }); + + // $.animate adds a function to the end of the queue + // but we want it at the front + var queue = $.queue(this), + anim = queue.splice(queue.length - 1, 1)[0]; + queue.splice(1, 0, anim); + $.dequeue(this); + }); + }); +}; + +$.fn.extend({ + _addClass: $.fn.addClass, + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + + _removeClass: $.fn.removeClass, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + + _toggleClass: $.fn.toggleClass, + toggleClass: function(classNames, force, speed, easing, callback) { + if ( typeof force == "boolean" || force === undefined ) { + if ( !speed ) { + // without speed parameter; + return this._toggleClass(classNames, force); + } else { + return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); + } + } else { + // without switch parameter; + return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); + } + }, + + switchClass: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + } +}); + + + +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +$.extend($.effects, { + version: "1.8.7", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + // if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) { + return element.parent(); + } + + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + 'float': element.css('float') + }, + wrapper = $('<div></div>') + .addClass('ui-effects-wrapper') + .css({ + fontSize: '100%', + background: 'transparent', + border: 'none', + margin: 0, + padding: 0 + }); + + element.wrap(wrapper); + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element + + // transfer positioning properties to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative' }); + } else { + $.extend(props, { + position: element.css('position'), + zIndex: element.css('z-index') + }); + $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { + props[pos] = element.css(pos); + if (isNaN(parseInt(props[pos], 10))) { + props[pos] = 'auto'; + } + }); + element.css({position: 'relative', top: 0, left: 0 }); + } + + return wrapper.css(props).show(); + }, + + removeWrapper: function(element) { + if (element.parent().is('.ui-effects-wrapper')) + return element.parent().replaceWith(element); + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + } +}); + + +function _normalizeArguments(effect, options, speed, callback) { + // shift params for method overloading + if (typeof effect == 'object') { + callback = options; + speed = null; + options = effect; + effect = options.effect; + } + if ($.isFunction(options)) { + callback = options; + speed = null; + options = {}; + } + if (typeof options == 'number' || $.fx.speeds[options]) { + callback = speed; + speed = options; + options = {}; + } + if ($.isFunction(speed)) { + callback = speed; + speed = null; + } + + options = options || {}; + + speed = speed || options.duration; + speed = $.fx.off ? 0 : typeof speed == 'number' + ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; + + callback = callback || options.complete; + + return [effect, options, speed, callback]; +} + +function standardSpeed( speed ) { + // valid standard speeds + if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { + return true; + } + + // invalid strings - treat as "normal" speed + if ( typeof speed === "string" && !$.effects[ speed ] ) { + return true; + } + + return false; +} + +$.fn.extend({ + effect: function(effect, options, speed, callback) { + var args = _normalizeArguments.apply(this, arguments), + // TODO: make effects take actual parameters instead of a hash + args2 = { + options: args[1], + duration: args[2], + callback: args[3] + }, + mode = args2.options.mode, + effectMethod = $.effects[effect]; + + if ( $.fx.off || !effectMethod ) { + // delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args2.duration, args2.callback ); + } else { + return this.each(function() { + if ( args2.callback ) { + args2.callback.call( this ); + } + }); + } + } + + return effectMethod.call(this, args2); + }, + + _show: $.fn.show, + show: function(speed) { + if ( standardSpeed( speed ) ) { + return this._show.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'show'; + return this.effect.apply(this, args); + } + }, + + _hide: $.fn.hide, + hide: function(speed) { + if ( standardSpeed( speed ) ) { + return this._hide.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'hide'; + return this.effect.apply(this, args); + } + }, + + // jQuery core overloads toggle and creates _toggle + __toggle: $.fn.toggle, + toggle: function(speed) { + if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { + return this.__toggle.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'toggle'; + return this.effect.apply(this, args); + } + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + + + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * Copyright 2008 George McGinley Smith + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +$.easing.jswing = $.easing.swing; + +$.extend($.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert($.easing.default); + return $.easing[$.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * Copyright 2001 Robert Penner + * + */ + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Blind 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Bounce 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Clip 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Drop 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Explode 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i<rows;i++) { // = + for(var j=0;j<cells;j++) { // || + el + .clone() + .appendTo('body') + .wrap('<div></div>') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Fade 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fade = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'); + + elem.animate({ opacity: mode }, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Fold 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Highlight 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.highlight = function(o) { + return this.queue(function() { + var elem = $(this), + props = ['backgroundImage', 'backgroundColor', 'opacity'], + mode = $.effects.setMode(elem, o.options.mode || 'show'), + animation = { + backgroundColor: elem.css('backgroundColor') + }; + + if (mode == 'hide') { + animation.opacity = 0; + } + + $.effects.save(elem, props); + elem + .show() + .css({ + backgroundImage: 'none', + backgroundColor: o.options.color || '#ffff99' + }) + .animate(animation, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (mode == 'hide' && elem.hide()); + $.effects.restore(elem, props); + (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Pulsate 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.pulsate = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'show'); + times = ((o.options.times || 5) * 2) - 1; + duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, + isVisible = elem.is(':visible'), + animateTo = 0; + + if (!isVisible) { + elem.css('opacity', 0).show(); + animateTo = 1; + } + + if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { + times--; + } + + for (var i = 0; i < times; i++) { + elem.animate({ opacity: animateTo }, duration, o.options.easing); + animateTo = (animateTo + 1) % 2; + } + + elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { + if (animateTo == 0) { + elem.hide(); + } + (o.callback && o.callback.apply(this, arguments)); + }); + + elem + .queue('fx', function() { elem.dequeue(); }) + .dequeue(); + }); +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Scale 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.puff = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'), + percent = parseInt(o.options.percent, 10) || 150, + factor = percent / 100, + original = { height: elem.height(), width: elem.width() }; + + $.extend(o.options, { + fade: true, + mode: mode, + percent: mode == 'hide' ? percent : 100, + from: mode == 'hide' + ? original + : { + height: original.height * factor, + width: original.width * factor + } + }); + + elem.effect('scale', o.options, o.duration, o.callback); + elem.dequeue(); + }); +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','width','height','overflow','opacity']; + var props1 = ['position','top','left','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if (el.to.opacity === 0) { + el.css('opacity', el.from.opacity); + } + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Shake 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Slide 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); + if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Transfer 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('<div class="ui-effects-transfer"></div>') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Accordion 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.accordion", { + options: { + active: 0, + animated: "slide", + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() === location.href.toLowerCase(); + } + }, + + _create: function() { + var self = this, + options = self.options; + + self.running = 0; + + self.element + .addClass( "ui-accordion ui-widget ui-helper-reset" ) + // in lack of child-selectors in CSS + // we need to mark top-LIs in a UL-accordion for some IE-fix + .children( "li" ) + .addClass( "ui-accordion-li-fix" ); + + self.headers = self.element.find( options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ) + .bind( "mouseenter.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + }) + .bind( "mouseleave.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-hover" ); + }) + .bind( "focus.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-focus" ); + }) + .bind( "blur.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-focus" ); + }); + + self.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ); + + if ( options.navigation ) { + var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 ); + if ( current.length ) { + var header = current.closest( ".ui-accordion-header" ); + if ( header.length ) { + // anchor within header + self.active = header; + } else { + // anchor within content + self.active = current.closest( ".ui-accordion-content" ).prev(); + } + } + } + + self.active = self._findActive( self.active || options.active ) + .addClass( "ui-state-default ui-state-active" ) + .toggleClass( "ui-corner-all" ) + .toggleClass( "ui-corner-top" ); + self.active.next().addClass( "ui-accordion-content-active" ); + + self._createIcons(); + self.resize(); + + // ARIA + self.element.attr( "role", "tablist" ); + + self.headers + .attr( "role", "tab" ) + .bind( "keydown.accordion", function( event ) { + return self._keydown( event ); + }) + .next() + .attr( "role", "tabpanel" ); + + self.headers + .not( self.active || "" ) + .attr({ + "aria-expanded": "false", + tabIndex: -1 + }) + .next() + .hide(); + + // make sure at least one header is in the tab order + if ( !self.active.length ) { + self.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + self.active + .attr({ + "aria-expanded": "true", + tabIndex: 0 + }); + } + + // only need links in tab order for Safari + if ( !$.browser.safari ) { + self.headers.find( "a" ).attr( "tabIndex", -1 ); + } + + if ( options.event ) { + self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) { + self._clickHandler.call( self, event, this ); + event.preventDefault(); + }); + } + }, + + _createIcons: function() { + var options = this.options; + if ( options.icons ) { + $( "<span></span>" ) + .addClass( "ui-icon " + options.icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-icon" ) + .toggleClass(options.icons.header) + .toggleClass(options.icons.headerSelected); + this.element.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers.children( ".ui-icon" ).remove(); + this.element.removeClass( "ui-accordion-icons" ); + }, + + destroy: function() { + var options = this.options; + + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + this.headers + .unbind( ".accordion" ) + .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "tabIndex" ); + + this.headers.find( "a" ).removeAttr( "tabIndex" ); + this._destroyIcons(); + var contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" ); + if ( options.autoHeight || options.fillHeight ) { + contents.css( "height", "" ); + } + + return $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + + if ( key == "active" ) { + this.activate( value ); + } + if ( key == "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key == "disabled" ) { + this.headers.add(this.headers.next()) + [ value ? "addClass" : "removeClass" ]( + "ui-accordion-disabled ui-state-disabled" ); + } + }, + + _keydown: function( event ) { + if ( this.options.disabled || event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._clickHandler( { target: event.target }, event.target ); + event.preventDefault(); + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + return false; + } + + return true; + }, + + resize: function() { + var options = this.options, + maxHeight; + + if ( options.fillSpace ) { + if ( $.browser.msie ) { + var defOverflow = this.element.parent().css( "overflow" ); + this.element.parent().css( "overflow", "hidden"); + } + maxHeight = this.element.parent().height(); + if ($.browser.msie) { + this.element.parent().css( "overflow", defOverflow ); + } + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( options.autoHeight ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }) + .height( maxHeight ); + } + + return this; + }, + + activate: function( index ) { + // TODO this gets called on init, changing the option without an explicit call for that + this.options.active = index; + // call clickHandler with custom event + var active = this._findActive( index )[ 0 ]; + this._clickHandler( { target: active }, active ); + + return this; + }, + + _findActive: function( selector ) { + return selector + ? typeof selector === "number" + ? this.headers.filter( ":eq(" + selector + ")" ) + : this.headers.not( this.headers.not( selector ) ) + : selector === false + ? $( [] ) + : this.headers.filter( ":eq(0)" ); + }, + + // TODO isn't event.target enough? why the separate target argument? + _clickHandler: function( event, target ) { + var options = this.options; + if ( options.disabled ) { + return; + } + + // called only when using activate(false) to close all parts programmatically + if ( !event.target ) { + if ( !options.collapsible ) { + return; + } + this.active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + this.active.next().addClass( "ui-accordion-content-active" ); + var toHide = this.active.next(), + data = { + options: options, + newHeader: $( [] ), + oldHeader: options.active, + newContent: $( [] ), + oldContent: toHide + }, + toShow = ( this.active = $( [] ) ); + this._toggle( toShow, toHide, data ); + return; + } + + // get the click target + var clicked = $( event.currentTarget || target ), + clickedIsActive = clicked[0] === this.active[0]; + + // TODO the option is changed, is that correct? + // TODO if it is correct, shouldn't that happen after determining that the click is valid? + options.active = options.collapsible && clickedIsActive ? + false : + this.headers.index( clicked ); + + // if animations are still active, or the active header is the target, ignore click + if ( this.running || ( !options.collapsible && clickedIsActive ) ) { + return; + } + + // switch classes + this.active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-state-default ui-corner-all" ) + .addClass( "ui-state-active ui-corner-top" ) + .children( ".ui-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.headerSelected ); + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + + // find elements to show and hide + var toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: options, + newHeader: clickedIsActive && options.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && options.collapsible ? $([]) : toShow, + oldContent: toHide + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + + this.active = clickedIsActive ? $([]) : clicked; + this._toggle( toShow, toHide, data, clickedIsActive, down ); + + return; + }, + + _toggle: function( toShow, toHide, data, clickedIsActive, down ) { + var self = this, + options = self.options; + + self.toShow = toShow; + self.toHide = toHide; + self.data = data; + + var complete = function() { + if ( !self ) { + return; + } + return self._completed.apply( self, arguments ); + }; + + // trigger changestart event + self._trigger( "changestart", null, self.data ); + + // count elements to animate + self.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + + if ( options.animated ) { + var animOptions = {}; + + if ( options.collapsible && clickedIsActive ) { + animOptions = { + toShow: $( [] ), + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } + + if ( !options.proxied ) { + options.proxied = options.animated; + } + + if ( !options.proxiedDuration ) { + options.proxiedDuration = options.duration; + } + + options.animated = $.isFunction( options.proxied ) ? + options.proxied( animOptions ) : + options.proxied; + + options.duration = $.isFunction( options.proxiedDuration ) ? + options.proxiedDuration( animOptions ) : + options.proxiedDuration; + + var animations = $.ui.accordion.animations, + duration = options.duration, + easing = options.animated; + + if ( easing && !animations[ easing ] && !$.easing[ easing ] ) { + easing = "slide"; + } + if ( !animations[ easing ] ) { + animations[ easing ] = function( options ) { + this.slide( options, { + easing: easing, + duration: duration || 700 + }); + }; + } + + animations[ easing ]( animOptions ); + } else { + if ( options.collapsible && clickedIsActive ) { + toShow.toggle(); + } else { + toHide.hide(); + toShow.show(); + } + + complete( true ); + } + + // TODO assert that the blur and focus triggers are really necessary, remove otherwise + toHide.prev() + .attr({ + "aria-expanded": "false", + tabIndex: -1 + }) + .blur(); + toShow.prev() + .attr({ + "aria-expanded": "true", + tabIndex: 0 + }) + .focus(); + }, + + _completed: function( cancel ) { + this.running = cancel ? 0 : --this.running; + if ( this.running ) { + return; + } + + if ( this.options.clearStyle ) { + this.toShow.add( this.toHide ).css({ + height: "", + overflow: "" + }); + } + + // other classes are removed before the animation; this one needs to stay until completed + this.toHide.removeClass( "ui-accordion-content-active" ); + + this._trigger( "change", null, this.data ); + } +}); + +$.extend( $.ui.accordion, { + version: "1.8.7", + animations: { + slide: function( options, additions ) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions ); + if ( !options.toHide.size() ) { + options.toShow.animate({ + height: "show", + paddingTop: "show", + paddingBottom: "show" + }, options ); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({ + height: "hide", + paddingTop: "hide", + paddingBottom: "hide" + }, options ); + return; + } + var overflow = options.toShow.css( "overflow" ), + percentDone = 0, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( parseInt( s.parent().width(), 10 ) + - parseInt( s.css( "paddingLeft" ), 10 ) + - parseInt( s.css( "paddingRight" ), 10 ) + - ( parseInt( s.css( "borderLeftWidth" ), 10 ) || 0 ) + - ( parseInt( s.css( "borderRightWidth" ), 10) || 0 ) ); + + $.each( fxAttrs, function( i, prop ) { + hideProps[ prop ] = "hide"; + + var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ ); + showProps[ prop ] = { + value: parts[ 1 ], + unit: parts[ 2 ] || "px" + }; + }); + options.toShow.css({ height: 0, overflow: "hidden" }).show(); + options.toHide + .filter( ":hidden" ) + .each( options.complete ) + .end() + .filter( ":visible" ) + .animate( hideProps, { + step: function( now, settings ) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if ( settings.prop == "height" ) { + percentDone = ( settings.end - settings.start === 0 ) ? 0 : + ( settings.now - settings.start ) / ( settings.end - settings.start ); + } + + options.toShow[ 0 ].style[ settings.prop ] = + ( percentDone * showProps[ settings.prop ].value ) + + showProps[ settings.prop ].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css( "height", "" ); + } + options.toShow.css({ + width: originalWidth, + overflow: overflow + }); + options.complete(); + } + }); + }, + bounceslide: function( options ) { + this.slide( options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + } + } +}); + +})( jQuery ); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Autocomplete 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function( $, undefined ) { + +$.widget( "ui.autocomplete", { + options: { + appendTo: "body", + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null + }, + _create: function() { + var self = this, + doc = this.element[ 0 ].ownerDocument, + suppressKeyPress; + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ) + // TODO verify these actually work as intended + .attr({ + role: "textbox", + "aria-autocomplete": "list", + "aria-haspopup": "true" + }) + .bind( "keydown.autocomplete", function( event ) { + if ( self.options.disabled || self.element.attr( "readonly" ) ) { + return; + } + + suppressKeyPress = false; + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + self._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + self._move( "nextPage", event ); + break; + case keyCode.UP: + self._move( "previous", event ); + // prevent moving cursor to beginning of text field in some browsers + event.preventDefault(); + break; + case keyCode.DOWN: + self._move( "next", event ); + // prevent moving cursor to end of text field in some browsers + event.preventDefault(); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open and has focus + if ( self.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + } + //passthrough - ENTER and TAB both select the current element + case keyCode.TAB: + if ( !self.menu.active ) { + return; + } + self.menu.select( event ); + break; + case keyCode.ESCAPE: + self.element.val( self.term ); + self.close( event ); + break; + default: + // keypress is triggered before the input value is changed + clearTimeout( self.searching ); + self.searching = setTimeout(function() { + // only search if the value has changed + if ( self.term != self.element.val() ) { + self.selectedItem = null; + self.search( null, event ); + } + }, self.options.delay ); + break; + } + }) + .bind( "keypress.autocomplete", function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + event.preventDefault(); + } + }) + .bind( "focus.autocomplete", function() { + if ( self.options.disabled ) { + return; + } + + self.selectedItem = null; + self.previous = self.element.val(); + }) + .bind( "blur.autocomplete", function( event ) { + if ( self.options.disabled ) { + return; + } + + clearTimeout( self.searching ); + // clicks on the menu (or a button to trigger a search) will cause a blur event + self.closing = setTimeout(function() { + self.close( event ); + self._change( event ); + }, 150 ); + }); + this._initSource(); + this.response = function() { + return self._response.apply( self, arguments ); + }; + this.menu = $( "<ul></ul>" ) + .addClass( "ui-autocomplete" ) + .appendTo( $( this.options.appendTo || "body", doc )[0] ) + // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown) + .mousedown(function( event ) { + // clicking on the scrollbar causes focus to shift to the body + // but we can't detect a mouseup or a click immediately afterward + // so we have to track the next mousedown and close the menu if + // the user clicks somewhere outside of the autocomplete + var menuElement = self.menu.element[ 0 ]; + if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { + setTimeout(function() { + $( document ).one( 'mousedown', function( event ) { + if ( event.target !== self.element[ 0 ] && + event.target !== menuElement && + !$.ui.contains( menuElement, event.target ) ) { + self.close(); + } + }); + }, 1 ); + } + + // use another timeout to make sure the blur-event-handler on the input was already triggered + setTimeout(function() { + clearTimeout( self.closing ); + }, 13); + }) + .menu({ + focus: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ); + if ( false !== self._trigger( "focus", event, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( /^key/.test(event.originalEvent.type) ) { + self.element.val( item.value ); + } + } + }, + selected: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ), + previous = self.previous; + + // only trigger when focus was lost (click on menu) + if ( self.element[0] !== doc.activeElement ) { + self.element.focus(); + self.previous = previous; + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + setTimeout(function() { + self.previous = previous; + self.selectedItem = item; + }, 1); + } + + if ( false !== self._trigger( "select", event, { item: item } ) ) { + self.element.val( item.value ); + } + // reset the term after the select event + // this allows custom select handling to work properly + self.term = self.element.val(); + + self.close( event ); + self.selectedItem = item; + }, + blur: function( event, ui ) { + // don't set the value of the text field if it's already correct + // this prevents moving the cursor unnecessarily + if ( self.menu.element.is(":visible") && + ( self.element.val() !== self.term ) ) { + self.element.val( self.term ); + } + } + }) + .zIndex( this.element.zIndex() + 1 ) + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .hide() + .data( "menu" ); + if ( $.fn.bgiframe ) { + this.menu.element.bgiframe(); + } + }, + + destroy: function() { + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-autocomplete" ) + .removeAttr( "aria-haspopup" ); + this.menu.element.remove(); + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] ) + } + }, + + _initSource: function() { + var self = this, + array, + url; + if ( $.isArray(this.options.source) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter(array, request.term) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if (self.xhr) { + self.xhr.abort(); + } + self.xhr = $.ajax({ + url: url, + data: request, + dataType: "json", + success: function( data, status, xhr ) { + if ( xhr === self.xhr ) { + response( data ); + } + self.xhr = null; + }, + error: function( xhr ) { + if ( xhr === self.xhr ) { + response( [] ); + } + self.xhr = null; + } + }); + }; + } else { + this.source = this.options.source; + } + }, + + search: function( value, event ) { + value = value != null ? value : this.element.val(); + + // always save the actual value, not the one passed as an argument + this.term = this.element.val(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + clearTimeout( this.closing ); + if ( this._trigger( "search", event ) === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.element.addClass( "ui-autocomplete-loading" ); + + this.source( { term: value }, this.response ); + }, + + _response: function( content ) { + if ( content && content.length ) { + content = this._normalize( content ); + this._suggest( content ); + this._trigger( "open" ); + } else { + this.close(); + } + this.element.removeClass( "ui-autocomplete-loading" ); + }, + + close: function( event ) { + clearTimeout( this.closing ); + if ( this.menu.element.is(":visible") ) { + this.menu.element.hide(); + this.menu.deactivate(); + this._trigger( "close", event ); + } + }, + + _change: function( event ) { + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[0].label && items[0].value ) { + return items; + } + return $.map( items, function(item) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend({ + label: item.label || item.value, + value: item.value || item.label + }, item ); + }); + }, + + _suggest: function( items ) { + var ul = this.menu.element + .empty() + .zIndex( this.element.zIndex() + 1 ); + this._renderMenu( ul, items ); + // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate + this.menu.deactivate(); + this.menu.refresh(); + + // size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend({ + of: this.element + }, this.options.position )); + }, + + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + ul.width( "" ).outerWidth(), + this.element.outerWidth() + ) ); + }, + + _renderMenu: function( ul, items ) { + var self = this; + $.each( items, function( index, item ) { + self._renderItem( ul, item ); + }); + }, + + _renderItem: function( ul, item) { + return $( "<li></li>" ) + .data( "item.autocomplete", item ) + .append( $( "<a></a>" ).text( item.label ) ) + .appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is(":visible") ) { + this.search( null, event ); + return; + } + if ( this.menu.first() && /^previous/.test(direction) || + this.menu.last() && /^next/.test(direction) ) { + this.element.val( this.term ); + this.menu.deactivate(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); + }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + +}( jQuery )); + +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Menu (not officially released) + * + * This widget isn't yet finished and the API is subject to change. We plan to finish + * it for the next release. You're welcome to give it a try anyway and give us feedback, + * as long as you're okay with migrating your code later on. We can help with that, too. + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Menu + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.menu", { + _create: function() { + var self = this; + this.element + .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") + .attr({ + role: "listbox", + "aria-activedescendant": "ui-active-menuitem" + }) + .click(function( event ) { + if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { + return; + } + // temporary + event.preventDefault(); + self.select( event ); + }); + this.refresh(); + }, + + refresh: function() { + var self = this; + + // don't refresh list items that are already adapted + var items = this.element.children("li:not(.ui-menu-item):has(a)") + .addClass("ui-menu-item") + .attr("role", "menuitem"); + + items.children("a") + .addClass("ui-corner-all") + .attr("tabindex", -1) + // mouseenter doesn't work with event delegation + .mouseenter(function( event ) { + self.activate( event, $(this).parent() ); + }) + .mouseleave(function() { + self.deactivate(); + }); + }, + + activate: function( event, item ) { + this.deactivate(); + if (this.hasScroll()) { + var offset = item.offset().top - this.element.offset().top, + scroll = this.element.attr("scrollTop"), + elementHeight = this.element.height(); + if (offset < 0) { + this.element.attr("scrollTop", scroll + offset); + } else if (offset >= elementHeight) { + this.element.attr("scrollTop", scroll + offset - elementHeight + item.height()); + } + } + this.active = item.eq(0) + .children("a") + .addClass("ui-state-hover") + .attr("id", "ui-active-menuitem") + .end(); + this._trigger("focus", event, { item: item }); + }, + + deactivate: function() { + if (!this.active) { return; } + + this.active.children("a") + .removeClass("ui-state-hover") + .removeAttr("id"); + this._trigger("blur"); + this.active = null; + }, + + next: function(event) { + this.move("next", ".ui-menu-item:first", event); + }, + + previous: function(event) { + this.move("prev", ".ui-menu-item:last", event); + }, + + first: function() { + return this.active && !this.active.prevAll(".ui-menu-item").length; + }, + + last: function() { + return this.active && !this.active.nextAll(".ui-menu-item").length; + }, + + move: function(direction, edge, event) { + if (!this.active) { + this.activate(event, this.element.children(edge)); + return; + } + var next = this.active[direction + "All"](".ui-menu-item").eq(0); + if (next.length) { + this.activate(event, next); + } else { + this.activate(event, this.element.children(edge)); + } + }, + + // TODO merge with previousPage + nextPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.last()) { + this.activate(event, this.element.children(".ui-menu-item:first")); + return; + } + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base - height + $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:last"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.last() ? ":first" : ":last")); + } + }, + + // TODO merge with nextPage + previousPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.first()) { + this.activate(event, this.element.children(".ui-menu-item:last")); + return; + } + + var base = this.active.offset().top, + height = this.element.height(); + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base + height - $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:first"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.first() ? ":last" : ":first")); + } + }, + + hasScroll: function() { + return this.element.height() < this.element.attr("scrollHeight"); + }, + + select: function( event ) { + this._trigger("selected", event, { item: this.active }); + } +}); + +}(jQuery)); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Button 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Button + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var lastActive, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function( event ) { + $( ":ui-button", event.target.form ).each(function() { + var inst = $( this ).data( "button" ); + setTimeout(function() { + inst.refresh(); + }, 1 ); + }); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + options: { + disabled: null, + text: true, + label: null, + icons: { + primary: null, + secondary: null + } + }, + _create: function() { + this.element.closest( "form" ) + .unbind( "reset.button" ) + .bind( "reset.button", formResetHandler ); + + if ( typeof this.options.disabled !== "boolean" ) { + this.options.disabled = this.element.attr( "disabled" ); + } + + this._determineButtonType(); + this.hasTitle = !!this.buttonElement.attr( "title" ); + + var self = this, + options = this.options, + toggleButton = this.type === "checkbox" || this.type === "radio", + hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), + focusClass = "ui-state-focus"; + + if ( options.label === null ) { + options.label = this.buttonElement.html(); + } + + if ( this.element.is( ":disabled" ) ) { + options.disabled = true; + } + + this.buttonElement + .addClass( baseClasses ) + .attr( "role", "button" ) + .bind( "mouseenter.button", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + if ( this === lastActive ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "mouseleave.button", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( hoverClass ); + }) + .bind( "focus.button", function() { + // no need to check disabled, focus won't be triggered anyway + $( this ).addClass( focusClass ); + }) + .bind( "blur.button", function() { + $( this ).removeClass( focusClass ); + }); + + if ( toggleButton ) { + this.element.bind( "change.button", function() { + self.refresh(); + }); + } + + if ( this.type === "checkbox" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).toggleClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", self.element[0].checked ); + }); + } else if ( this.type === "radio" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", true ); + + var radio = self.element[ 0 ]; + radioGroup( radio ) + .not( radio ) + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + }); + } else { + this.buttonElement + .bind( "mousedown.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + lastActive = this; + $( document ).one( "mouseup", function() { + lastActive = null; + }); + }) + .bind( "mouseup.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).removeClass( "ui-state-active" ); + }) + .bind( "keydown.button", function(event) { + if ( options.disabled ) { + return false; + } + if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "keyup.button", function() { + $( this ).removeClass( "ui-state-active" ); + }); + + if ( this.buttonElement.is("a") ) { + this.buttonElement.keyup(function(event) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + // TODO pass through original event correctly (just as 2nd argument doesn't work) + $( this ).click(); + } + }); + } + } + + // TODO: pull out $.Widget's handling for the disabled option into + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can + // be overridden by individual plugins + this._setOption( "disabled", options.disabled ); + }, + + _determineButtonType: function() { + + if ( this.element.is(":checkbox") ) { + this.type = "checkbox"; + } else { + if ( this.element.is(":radio") ) { + this.type = "radio"; + } else { + if ( this.element.is("input") ) { + this.type = "input"; + } else { + this.type = "button"; + } + } + } + + if ( this.type === "checkbox" || this.type === "radio" ) { + // we don't search against the document in case the element + // is disconnected from the DOM + this.buttonElement = this.element.parents().last() + .find( "label[for=" + this.element.attr("id") + "]" ); + this.element.addClass( "ui-helper-hidden-accessible" ); + + var checked = this.element.is( ":checked" ); + if ( checked ) { + this.buttonElement.addClass( "ui-state-active" ); + } + this.buttonElement.attr( "aria-pressed", checked ); + } else { + this.buttonElement = this.element; + } + }, + + widget: function() { + return this.buttonElement; + }, + + destroy: function() { + this.element + .removeClass( "ui-helper-hidden-accessible" ); + this.buttonElement + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) + .removeAttr( "role" ) + .removeAttr( "aria-pressed" ) + .html( this.buttonElement.find(".ui-button-text").html() ); + + if ( !this.hasTitle ) { + this.buttonElement.removeAttr( "title" ); + } + + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "disabled" ) { + if ( value ) { + this.element.attr( "disabled", true ); + } else { + this.element.removeAttr( "disabled" ); + } + } + this._resetButton(); + }, + + refresh: function() { + var isDisabled = this.element.is( ":disabled" ); + if ( isDisabled !== this.options.disabled ) { + this._setOption( "disabled", isDisabled ); + } + if ( this.type === "radio" ) { + radioGroup( this.element[0] ).each(function() { + if ( $( this ).is( ":checked" ) ) { + $( this ).button( "widget" ) + .addClass( "ui-state-active" ) + .attr( "aria-pressed", true ); + } else { + $( this ).button( "widget" ) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + } + }); + } else if ( this.type === "checkbox" ) { + if ( this.element.is( ":checked" ) ) { + this.buttonElement + .addClass( "ui-state-active" ) + .attr( "aria-pressed", true ); + } else { + this.buttonElement + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + } + } + }, + + _resetButton: function() { + if ( this.type === "input" ) { + if ( this.options.label ) { + this.element.val( this.options.label ); + } + return; + } + var buttonElement = this.buttonElement.removeClass( typeClasses ), + buttonText = $( "<span></span>" ) + .addClass( "ui-button-text" ) + .html( this.options.label ) + .appendTo( buttonElement.empty() ) + .text(), + icons = this.options.icons, + multipleIcons = icons.primary && icons.secondary; + if ( icons.primary || icons.secondary ) { + buttonElement.addClass( "ui-button-text-icon" + + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); + if ( icons.primary ) { + buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" ); + } + if ( icons.secondary ) { + buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" ); + } + if ( !this.options.text ) { + buttonElement + .addClass( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ) + .removeClass( "ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary" ); + if ( !this.hasTitle ) { + buttonElement.attr( "title", buttonText ); + } + } + } else { + buttonElement.addClass( "ui-button-text-only" ); + } + } +}); + +$.widget( "ui.buttonset", { + options: { + items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" + }, + + _create: function() { + this.element.addClass( "ui-buttonset" ); + }, + + _init: function() { + this.refresh(); + }, + + _setOption: function( key, value ) { + if ( key === "disabled" ) { + this.buttons.button( "option", key, value ); + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + refresh: function() { + this.buttons = this.element.find( this.options.items ) + .filter( ":ui-button" ) + .button( "refresh" ) + .end() + .not( ":ui-button" ) + .button() + .end() + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) + .filter( ":first" ) + .addClass( "ui-corner-left" ) + .end() + .filter( ":last" ) + .addClass( "ui-corner-right" ) + .end() + .end(); + }, + + destroy: function() { + this.element.removeClass( "ui-buttonset" ); + this.buttons + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-left ui-corner-right" ) + .end() + .button( "destroy" ); + + $.Widget.prototype.destroy.call( this ); + } +}); + +}( jQuery ) ); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Datepicker 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * jquery.ui.core.js + */ +(function( $, undefined ) { + +$.extend($.ui, { datepicker: { version: "1.8.7" } }); + +var PROP_NAME = 'datepicker'; +var dpuuid = new Date().getTime(); + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + weekHeader: 'Wk', // Column header for week of the year + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false, // True if right-to-left language, false if left-to-right + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearSuffix: '' // Additional text to append to the year in the month headers + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'fadeIn', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + yearRange: 'c-10:c+10', // Range of years to display in drop-down, + // either relative to today's year (-nn:+nn), relative to currently displayed year + // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) + showOtherMonths: false, // True to show dates in other months, false to leave blank + selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable + showWeek: false, // True to show week of the year, false to not show it + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'fast', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false, // True to show button panel, false to not show it + autoSize: false // True to size the input for the date format, false to leave as is + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = $('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', + + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + // TODO rename to "widget" when switching to widget factory + _widgetDatepicker: function() { + return this.dpDiv; + }, + + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) { + this.uuid += 1; + target.id = 'dp' + this.uuid; + } + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + $('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.append = $([]); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + this._attachments(input, inst); + input.addClass(this.markerClassName).keydown(this._doKeyDown). + keypress(this._doKeyPress).keyup(this._doKeyUp). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + this._autoSize(inst); + $.data(target, PROP_NAME, inst); + }, + + /* Make attachments based on settings. */ + _attachments: function(input, inst) { + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (inst.append) + inst.append.remove(); + if (appendText) { + inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>'); + input[isRTL ? 'before' : 'after'](inst.append); + } + input.unbind('focus', this._showDatepicker); + if (inst.trigger) + inst.trigger.remove(); + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('<img/>').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('<button type="button"></button>').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('<img/>').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) + $.datepicker._hideDatepicker(); + else + $.datepicker._showDatepicker(input[0]); + return false; + }); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, 'autoSize') && !inst.inline) { + var date = new Date(2009, 12 - 1, 20); // Ensure double digits + var dateFormat = this._get(inst, 'dateFormat'); + if (dateFormat.match(/[DM]/)) { + var findMax = function(names) { + var max = 0; + var maxI = 0; + for (var i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + 'monthNames' : 'monthNamesShort')))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + } + inst.input.attr('size', this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + inst.dpDiv.show(); + }, + + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param date string or Date - the initial date to display + @param onSelect function - the function to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + this.uuid += 1; + var id = 'dp' + this.uuid; + this._dialogInput = $('<input type="text" id="' + id + + '" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>'); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); + } + var date = this._getDateDatepicker(target, true); + extendRemove(inst.settings, settings); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDateDatepicker(target, date); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + + $.datepicker._currentClass + ')', inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (event) { + $.datepicker.log(event); + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + $.datepicker._curInst.dpDiv.stop(true, true); + } + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {})); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._datepickerShowing = true; + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !! cover.length ){ + var borders = $.datepicker._getBorders(inst.dpDiv); + cover.css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + } + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var self = this; + var borders = $.datepicker._getBorders(inst.dpDiv); + inst.dpDiv.empty().append(this._generateHTML(inst)); + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 + cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + } + inst.dpDiv.find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a') + .bind('mouseout', function(){ + $(this).removeClass('ui-state-hover'); + if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover'); + if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover'); + }) + .bind('mouseover', function(){ + if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) { + $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + $(this).addClass('ui-state-hover'); + if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover'); + if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover'); + } + }) + .end() + .find('.' + this._dayOverClass + ' a') + .trigger('mouseover') + .end(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + else + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + var origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml ){ + inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft(); + var viewHeight = document.documentElement.clientHeight + $(document).scrollTop(); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + this._curInst = null; + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback + this._datepickerShowing = false; + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + var $target = $(event.target); + if ($target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.hasClass($.datepicker._triggerClass) && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI)) + $.datepicker._hideDatepicker(); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst._selectingMonthYear = false; + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Restore input focus after not changing month/year. */ + _clickMonthYear: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (inst.input && inst._selectingMonthYear) { + setTimeout(function() { + inst.input.focus(); + }, 0); + } + inst._selectingMonthYear = !inst._selectingMonthYear; + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + var isDoubled = lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = (lookAhead(match) ? longNames : shortNames); + for (var i = 0; i < names.length; i++) { + if (value.substr(iValue, names[i].length).toLowerCase() == names[i].toLowerCase()) { + iValue += names[i].length; + return i + 1; + } + } + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/* + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + (date.getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000, 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; + } + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date; + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' + + ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' : + (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' + + ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' : + (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : ''); + var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._gotoToday(\'#' + inst.id + '\');"' + + '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '<div class="ui-datepicker-group'; + if (numMonths[1] > 1) + switch (col) { + case 0: calender += ' ui-datepicker-group-first'; + cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break; + case numMonths[1]-1: calender += ' ui-datepicker-group-last'; + cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break; + default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break; + } + calender += '">'; + } + calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '</div><table class="ui-datepicker-calendar"><thead>' + + '<tr>'; + var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>'; + } + calender += thead + '</tr></thead><tbody>'; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += '<tr>'; + var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' + + this._get(inst, 'calculateWeek')(printDate) + '</td>'); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += '<td class="' + + ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends + (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months + ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key + (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ? + // or defaultDate is current printedDate and defaultDate is selectedDate + ' ' + this._dayOverClass : '') + // highlight selected day + (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days + (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates + (printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day + (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different) + ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title + (unselectable ? '' : ' onclick="DP_jQuery_' + dpuuid + '.datepicker._selectDay(\'#' + + inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' + + (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') + + (printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day + (otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months + '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + '</tr>'; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '</tbody></table>' + (isMultiMonth ? '</div>' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '<div class="ui-datepicker-title">'; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>'; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += '<select class="ui-datepicker-month" ' + + 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' + + 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' + + '>'; + for (var month = 0; month < 12; month++) { + if ((!inMinYear || month >= minDate.getMonth()) && + (!inMaxYear || month <= maxDate.getMonth())) + monthHtml += '<option value="' + month + '"' + + (month == drawMonth ? ' selected="selected"' : '') + + '>' + monthNamesShort[month] + '</option>'; + } + monthHtml += '</select>'; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '<span class="ui-datepicker-year">' + drawYear + '</span>'; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += '<select class="ui-datepicker-year" ' + + 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' + + 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' + + '>'; + for (; year <= endYear; year++) { + inst.yearshtml += '<option value="' + year + '"' + + (year == drawYear ? ' selected="selected"' : '') + + '>' + year + '</option>'; + } + inst.yearshtml += '</select>'; + //when showing there is no need for later update + if( ! $.browser.mozilla ){ + html += inst.yearshtml; + inst.yearshtml = null; + } else { + // will be replaced later with inst.yearshtml + html += '<select class="ui-datepicker-year"><option value="' + drawYear + '" selected="selected">' + drawYear + '</option></select>'; + } + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '</div>'; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - new Date(year, month, 32).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.7"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Dialog 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('<div></div>')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('<a href="#"></a>') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('<span></span>') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if (options.modal) { + uiDialog.bind('keypress.ui-dialog', function(event) { + if (event.keyCode !== $.ui.keyCode.TAB) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('<div></div>') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "<div></div>" ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('<button type="button"></button>') + .attr( props, true ) + .unbind('click') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.7", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Position 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Position + */ +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if (options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + parseInt( $.curCSS( this, "marginRight", true ) ) || 0, + collisionHeight = elemHeight + marginTop + + parseInt( $.curCSS( this, "marginBottom", true ) ) || 0, + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions (see #5280) + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +}( jQuery )); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Progressbar 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + options: { + value: 0, + max: 100 + }, + + min: 0, + + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); + + this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" ) + .appendTo( this.element ); + + this.oldValue = this._value(); + this._refreshValue(); + }, + + destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + + $.Widget.prototype.destroy.apply( this, arguments ); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); + } + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + return Math.min( this.options.max, Math.max( this.min, val ) ); + }, + + _percentage: function() { + return 100 * this._value() / this.options.max; + }, + + _refreshValue: function() { + var value = this.value(); + var percentage = this._percentage(); + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + + this.valueDiv + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); + +$.extend( $.ui.progressbar, { + version: "1.8.7" +}); + +})( jQuery ); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Slider 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ); + + if ( o.disabled ) { + this.element.addClass( "ui-slider-disabled ui-disabled" ); + } + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + this.range = $( "<div></div>" ); + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } else { + this.range = $( "<div></div>" ); + } + + this.range + .appendTo( this.element ) + .addClass( "ui-slider-range" ); + + if ( o.range === "min" || o.range === "max" ) { + this.range.addClass( "ui-slider-range-" + o.range ); + } + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + this.range.addClass( "ui-widget-header" ); + } + + if ( $( ".ui-slider-handle", this.element ).length === 0 ) { + $( "<a href='#'></a>" ) + .appendTo( this.element ) + .addClass( "ui-slider-handle" ); + } + + if ( o.values && o.values.length ) { + while ( $(".ui-slider-handle", this.element).length < o.values.length ) { + $( "<a href='#'></a>" ) + .appendTo( this.element ) + .addClass( "ui-slider-handle" ); + } + } + + this.handles = $( ".ui-slider-handle", this.element ) + .addClass( "ui-state-default" + + " ui-corner-all" ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var ret = true, + index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + ret = false; + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + + return ret; + + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.attr( "disabled", "disabled" ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.removeAttr( "disabled" ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step; + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.7" +}); + +}(jQuery)); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Tabs 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget( "ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: "click", + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: "ui-tabs-", + load: null, + panelTemplate: "<div></div>", + remove: null, + select: null, + show: null, + spinner: "<em>Loading…</em>", + tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>" + }, + + _create: function() { + this._tabify( true ); + }, + + _setOption: function( key, value ) { + if ( key == "selected" ) { + if (this.options.collapsible && value == this.options.selected ) { + return; + } + this.select( value ); + } else { + this.options[ key ] = value; + this._tabify(); + } + }, + + _tabId: function( a ) { + return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || + this.options.idPrefix + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + // we need this because an id may contain a ":" + return hash.replace( /:/g, "\\:" ); + }, + + _cookie: function() { + var cookie = this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); + return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + }, + + _ui: function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter( ".ui-state-processing" ) + .removeClass( "ui-state-processing" ) + .find( "span:data(label.tabs)" ) + .each(function() { + var el = $( this ); + el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + }); + }, + + _tabify: function( init ) { + var self = this, + o = this.options, + fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + + this.list = this.element.find( "ol,ul" ).eq( 0 ); + this.lis = $( " > li:has(a[href])", this.list ); + this.anchors = this.lis.map(function() { + return $( "a", this )[ 0 ]; + }); + this.panels = $( [] ); + + this.anchors.each(function( i, a ) { + var href = $( a ).attr( "href" ); + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split( "#" )[ 0 ], + baseEl; + if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || + ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { + href = a.hash; + a.href = href; + } + + // inline tab + if ( fragmentId.test( href ) ) { + self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); + // remote tab + // prevent loading the page itself if href is just "#" + } else if ( href && href !== "#" ) { + // required for restore on destroy + $.data( a, "href.tabs", href ); + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); + + var id = self._tabId( a ); + a.href = "#" + id; + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .insertAfter( self.panels[ i - 1 ] || self.list ); + $panel.data( "destroy.tabs", true ); + } + self.panels = self.panels.add( $panel ); + // invalid tab href + } else { + o.disabled.push( i ); + } + }); + + // initialization from scratch + if ( init ) { + // attach necessary classes for styling + this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); + this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + this.lis.addClass( "ui-state-default ui-corner-top" ); + this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on <li> + if ( o.selected === undefined ) { + if ( location.hash ) { + this.anchors.each(function( i, a ) { + if ( a.hash == location.hash ) { + o.selected = i; + return false; + } + }); + } + if ( typeof o.selected !== "number" && o.cookie ) { + o.selected = parseInt( self._cookie(), 10 ); + } + if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + o.selected = o.selected || ( this.lis.length ? 0 : -1 ); + } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) + ? o.selected + : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique( o.disabled.concat( + $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { + return self.lis.index( n ); + }) + ) ).sort(); + + if ( $.inArray( o.selected, o.disabled ) != -1 ) { + o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + } + + // highlight selected tab + this.panels.addClass( "ui-tabs-hide" ); + this.lis.removeClass( "ui-tabs-selected ui-state-active" ); + // check for length avoids error when initializing empty list + if ( o.selected >= 0 && this.anchors.length ) { + self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); + this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + + // seems to be expected behavior that the show callback is fired + self.element.queue( "tabs", function() { + self._trigger( "show", null, + self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ) ) ); + }); + + this.load( o.selected ); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + // TODO: namespace this event + $( window ).bind( "unload", function() { + self.lis.add( self.anchors ).unbind( ".tabs" ); + self.lis = self.anchors = self.panels = null; + }); + // update selected after add/remove + } else { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + + // update collapsible + // TODO: use .toggleClass() + this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + + // set or update cookie after init and add/remove respectively + if ( o.cookie ) { + this._cookie( o.selected, o.cookie ); + } + + // disable tabs + for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { + $( li )[ $.inArray( i, o.disabled ) != -1 && + // TODO: use .toggleClass() + !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + } + + // reset cache if switching from cached to not cached + if ( o.cache === false ) { + this.anchors.removeData( "cache.tabs" ); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add( this.anchors ).unbind( ".tabs" ); + + if ( o.event !== "mouseover" ) { + var addState = function( state, el ) { + if ( el.is( ":not(.ui-state-disabled)" ) ) { + el.addClass( "ui-state-" + state ); + } + }; + var removeState = function( state, el ) { + el.removeClass( "ui-state-" + state ); + }; + this.lis.bind( "mouseover.tabs" , function() { + addState( "hover", $( this ) ); + }); + this.lis.bind( "mouseout.tabs", function() { + removeState( "hover", $( this ) ); + }); + this.anchors.bind( "focus.tabs", function() { + addState( "focus", $( this ).closest( "li" ) ); + }); + this.anchors.bind( "blur.tabs", function() { + removeState( "focus", $( this ).closest( "li" ) ); + }); + } + + // set up animations + var hideFx, showFx; + if ( o.fx ) { + if ( $.isArray( o.fx ) ) { + hideFx = o.fx[ 0 ]; + showFx = o.fx[ 1 ]; + } else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle( $el, fx ) { + $el.css( "display", "" ); + if ( !$.support.opacity && fx.opacity ) { + $el[ 0 ].style.removeAttribute( "filter" ); + } + } + + // Show a tab... + var showTab = showFx + ? function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way + .animate( showFx, showFx.duration || "normal", function() { + resetStyle( $show, showFx ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }); + } + : function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.removeClass( "ui-tabs-hide" ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx + ? function( clicked, $hide ) { + $hide.animate( hideFx, hideFx.duration || "normal", function() { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + resetStyle( $hide, hideFx ); + self.element.dequeue( "tabs" ); + }); + } + : function( clicked, $hide, $show ) { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + self.element.dequeue( "tabs" ); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind( o.event + ".tabs", function() { + var el = this, + $li = $(el).closest( "li" ), + $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), + $show = self.element.find( self._sanitizeSelector( el.hash ) ); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || + $li.hasClass( "ui-state-disabled" ) || + $li.hasClass( "ui-state-processing" ) || + self.panels.filter( ":animated" ).length || + self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { + this.blur(); + return false; + } + + o.selected = self.anchors.index( this ); + + self.abort(); + + // if tab may be closed + if ( o.collapsible ) { + if ( $li.hasClass( "ui-tabs-selected" ) ) { + o.selected = -1; + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }).dequeue( "tabs" ); + + this.blur(); + return false; + } else if ( !$hide.length ) { + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + self.load( self.anchors.index( this ) ); + + this.blur(); + return false; + } + } + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + // show new tab + if ( $show.length ) { + if ( $hide.length ) { + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }); + } + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + self.load( self.anchors.index( this ) ); + } else { + throw "jQuery UI Tabs: Mismatching fragment identifier."; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ( $.browser.msie ) { + this.blur(); + } + }); + + // disable click in any case + this.anchors.bind( "click.tabs", function(){ + return false; + }); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + // also sanitizes numerical indexes to valid values. + if ( typeof index == "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$=" + index + "]" ) ); + } + + return index; + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element + .unbind( ".tabs" ) + .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) + .removeData( "tabs" ); + + this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + + this.anchors.each(function() { + var href = $.data( this, "href.tabs" ); + if ( href ) { + this.href = href; + } + var $this = $( this ).unbind( ".tabs" ); + $.each( [ "href", "load", "cache" ], function( i, prefix ) { + $this.removeData( prefix + ".tabs" ); + }); + }); + + this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { + if ( $.data( this, "destroy.tabs" ) ) { + $( this ).remove(); + } else { + $( this ).removeClass([ + "ui-state-default", + "ui-corner-top", + "ui-tabs-selected", + "ui-state-active", + "ui-state-hover", + "ui-state-focus", + "ui-state-disabled", + "ui-tabs-panel", + "ui-widget-content", + "ui-corner-bottom", + "ui-tabs-hide" + ].join( " " ) ); + } + }); + + if ( o.cookie ) { + this._cookie( null, o.cookie ); + } + + return this; + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var self = this, + o = this.options, + $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + + $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + + // try to find an existing element before creating a new one + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .data( "destroy.tabs", true ); + } + $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + + if ( index >= this.lis.length ) { + $li.appendTo( this.list ); + $panel.appendTo( this.list[ 0 ].parentNode ); + } else { + $li.insertBefore( this.lis[ index ] ); + $panel.insertBefore( this.panels[ index ] ); + } + + o.disabled = $.map( o.disabled, function( n, i ) { + return n >= index ? ++n : n; + }); + + this._tabify(); + + if ( this.anchors.length == 1 ) { + o.selected = 0; + $li.addClass( "ui-tabs-selected ui-state-active" ); + $panel.removeClass( "ui-tabs-hide" ); + this.element.queue( "tabs", function() { + self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + }); + + this.load( 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + remove: function( index ) { + index = this._getIndex( index ); + var o = this.options, + $li = this.lis.eq( index ).remove(), + $panel = this.panels.eq( index ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { + this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + o.disabled = $.map( + $.grep( o.disabled, function(n, i) { + return n != index; + }), + function( n, i ) { + return n >= index ? --n : n; + }); + + this._tabify(); + + this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); + return this; + }, + + enable: function( index ) { + index = this._getIndex( index ); + var o = this.options; + if ( $.inArray( index, o.disabled ) == -1 ) { + return; + } + + this.lis.eq( index ).removeClass( "ui-state-disabled" ); + o.disabled = $.grep( o.disabled, function( n, i ) { + return n != index; + }); + + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + disable: function( index ) { + index = this._getIndex( index ); + var self = this, o = this.options; + // cannot disable already selected tab + if ( index != o.selected ) { + this.lis.eq( index ).addClass( "ui-state-disabled" ); + + o.disabled.push( index ); + o.disabled.sort(); + + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + + return this; + }, + + select: function( index ) { + index = this._getIndex( index ); + if ( index == -1 ) { + if ( this.options.collapsible && this.options.selected != -1 ) { + index = this.options.selected; + } else { + return this; + } + } + this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); + return this; + }, + + load: function( index ) { + index = this._getIndex( index ); + var self = this, + o = this.options, + a = this.anchors.eq( index )[ 0 ], + url = $.data( a, "load.tabs" ); + + this.abort(); + + // not remote or from cache + if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { + this.element.dequeue( "tabs" ); + return; + } + + // load remote from here on + this.lis.eq( index ).addClass( "ui-state-processing" ); + + if ( o.spinner ) { + var span = $( "span", a ); + span.data( "label.tabs", span.html() ).html( o.spinner ); + } + + this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { + url: url, + success: function( r, s ) { + self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + + // take care of tab labels + self._cleanup(); + + if ( o.cache ) { + $.data( a, "cache.tabs", true ); + } + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + o.ajaxOptions.success( r, s ); + } + catch ( e ) {} + }, + error: function( xhr, s, e ) { + // take care of tab labels + self._cleanup(); + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error( xhr, s, index, a ); + } + catch ( e ) {} + } + } ) ); + + // last, so that load event is fired before show... + self.element.dequeue( "tabs" ); + + return this; + }, + + abort: function() { + // stop possibly running animations + this.element.queue( [] ); + this.panels.stop( false, true ); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + + // terminate pending requests from other tabs + if ( this.xhr ) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; + }, + + url: function( index, url ) { + this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); + return this; + }, + + length: function() { + return this.anchors.length; + } +}); + +$.extend( $.ui.tabs, { + version: "1.8.7" +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend( $.ui.tabs.prototype, { + rotation: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + t = o.selected; + rotate(); + }); + + // start rotation + if ( ms ) { + this.element.bind( "tabsshow", rotate ); + this.anchors.bind( o.event + ".tabs", stop ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsshow", rotate ); + this.anchors.unbind( o.event + ".tabs", stop ); + delete this._rotate; + delete this._unrotate; + } + + return this; + } +}); + +})( jQuery ); diff --git a/NzbDrone.Web/Scripts/jquery-ui.min.js b/NzbDrone.Web/Scripts/jquery-ui.min.js new file mode 100644 index 000000000..7a83f1887 --- /dev/null +++ b/NzbDrone.Web/Scripts/jquery-ui.min.js @@ -0,0 +1,409 @@ +/*! + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI + */ +(function(b,c){function f(g){return!b(g).parents().andSelf().filter(function(){return b.curCSS(this,"visibility")==="hidden"||b.expr.filters.hidden(this)}).length}b.ui=b.ui||{};if(!b.ui.version){b.extend(b.ui,{version:"1.8.7",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106, +NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});b.fn.extend({_focus:b.fn.focus,focus:function(g,e){return typeof g==="number"?this.each(function(){var a=this;setTimeout(function(){b(a).focus();e&&e.call(a)},g)}):this._focus.apply(this,arguments)},scrollParent:function(){var g;g=b.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(b.curCSS(this, +"position",1))&&/(auto|scroll)/.test(b.curCSS(this,"overflow",1)+b.curCSS(this,"overflow-y",1)+b.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(b.curCSS(this,"overflow",1)+b.curCSS(this,"overflow-y",1)+b.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!g.length?b(document):g},zIndex:function(g){if(g!==c)return this.css("zIndex",g);if(this.length){g=b(this[0]);for(var e;g.length&&g[0]!==document;){e=g.css("position"); +if(e==="absolute"||e==="relative"||e==="fixed"){e=parseInt(g.css("zIndex"),10);if(!isNaN(e)&&e!==0)return e}g=g.parent()}}return 0},disableSelection:function(){return this.bind((b.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(g){g.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});b.each(["Width","Height"],function(g,e){function a(j,n,q,l){b.each(d,function(){n-=parseFloat(b.curCSS(j,"padding"+this,true))||0;if(q)n-=parseFloat(b.curCSS(j, +"border"+this+"Width",true))||0;if(l)n-=parseFloat(b.curCSS(j,"margin"+this,true))||0});return n}var d=e==="Width"?["Left","Right"]:["Top","Bottom"],h=e.toLowerCase(),i={innerWidth:b.fn.innerWidth,innerHeight:b.fn.innerHeight,outerWidth:b.fn.outerWidth,outerHeight:b.fn.outerHeight};b.fn["inner"+e]=function(j){if(j===c)return i["inner"+e].call(this);return this.each(function(){b(this).css(h,a(this,j)+"px")})};b.fn["outer"+e]=function(j,n){if(typeof j!=="number")return i["outer"+e].call(this,j);return this.each(function(){b(this).css(h, +a(this,j,true,n)+"px")})}});b.extend(b.expr[":"],{data:function(g,e,a){return!!b.data(g,a[3])},focusable:function(g){var e=g.nodeName.toLowerCase(),a=b.attr(g,"tabindex");if("area"===e){e=g.parentNode;a=e.name;if(!g.href||!a||e.nodeName.toLowerCase()!=="map")return false;g=b("img[usemap=#"+a+"]")[0];return!!g&&f(g)}return(/input|select|textarea|button|object/.test(e)?!g.disabled:"a"==e?g.href||!isNaN(a):!isNaN(a))&&f(g)},tabbable:function(g){var e=b.attr(g,"tabindex");return(isNaN(e)||e>=0)&&b(g).is(":focusable")}}); +b(function(){var g=document.body,e=g.appendChild(e=document.createElement("div"));b.extend(e.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});b.support.minHeight=e.offsetHeight===100;b.support.selectstart="onselectstart"in e;g.removeChild(e).style.display="none"});b.extend(b.ui,{plugin:{add:function(g,e,a){g=b.ui[g].prototype;for(var d in a){g.plugins[d]=g.plugins[d]||[];g.plugins[d].push([e,a[d]])}},call:function(g,e,a){if((e=g.plugins[e])&&g.element[0].parentNode)for(var d=0;d<e.length;d++)g.options[e[d][0]]&& +e[d][1].apply(g.element,a)}},contains:function(g,e){return document.compareDocumentPosition?g.compareDocumentPosition(e)&16:g!==e&&g.contains(e)},hasScroll:function(g,e){if(b(g).css("overflow")==="hidden")return false;e=e&&e==="left"?"scrollLeft":"scrollTop";var a=false;if(g[e]>0)return true;g[e]=1;a=g[e]>0;g[e]=0;return a},isOverAxis:function(g,e,a){return g>e&&g<e+a},isOver:function(g,e,a,d,h,i){return b.ui.isOverAxis(g,a,h)&&b.ui.isOverAxis(e,d,i)}})}})(jQuery); +(function(b,c){if(b.cleanData){var f=b.cleanData;b.cleanData=function(e){for(var a=0,d;(d=e[a])!=null;a++)b(d).triggerHandler("remove");f(e)}}else{var g=b.fn.remove;b.fn.remove=function(e,a){return this.each(function(){if(!a)if(!e||b.filter(e,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return g.call(b(this),e,a)})}}b.widget=function(e,a,d){var h=e.split(".")[0],i;e=e.split(".")[1];i=h+"-"+e;if(!d){d=a;a=b.Widget}b.expr[":"][i]=function(j){return!!b.data(j, +e)};b[h]=b[h]||{};b[h][e]=function(j,n){arguments.length&&this._createWidget(j,n)};a=new a;a.options=b.extend(true,{},a.options);b[h][e].prototype=b.extend(true,a,{namespace:h,widgetName:e,widgetEventPrefix:b[h][e].prototype.widgetEventPrefix||e,widgetBaseClass:i},d);b.widget.bridge(e,b[h][e])};b.widget.bridge=function(e,a){b.fn[e]=function(d){var h=typeof d==="string",i=Array.prototype.slice.call(arguments,1),j=this;d=!h&&i.length?b.extend.apply(null,[true,d].concat(i)):d;if(h&&d.charAt(0)==="_")return j; +h?this.each(function(){var n=b.data(this,e),q=n&&b.isFunction(n[d])?n[d].apply(n,i):n;if(q!==n&&q!==c){j=q;return false}}):this.each(function(){var n=b.data(this,e);n?n.option(d||{})._init():b.data(this,e,new a(d,this))});return j}};b.Widget=function(e,a){arguments.length&&this._createWidget(e,a)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(e,a){b.data(a,this.widgetName,this);this.element=b(a);this.options=b.extend(true,{},this.options, +this._getCreateOptions(),e);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")}, +widget:function(){return this.element},option:function(e,a){var d=e;if(arguments.length===0)return b.extend({},this.options);if(typeof e==="string"){if(a===c)return this.options[e];d={};d[e]=a}this._setOptions(d);return this},_setOptions:function(e){var a=this;b.each(e,function(d,h){a._setOption(d,h)});return this},_setOption:function(e,a){this.options[e]=a;if(e==="disabled")this.widget()[a?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",a);return this}, +enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(e,a,d){var h=this.options[e];a=b.Event(a);a.type=(e===this.widgetEventPrefix?e:this.widgetEventPrefix+e).toLowerCase();d=d||{};if(a.originalEvent){e=b.event.props.length;for(var i;e;){i=b.event.props[--e];a[i]=a.originalEvent[i]}}this.element.trigger(a,d);return!(b.isFunction(h)&&h.call(this.element[0],a,d)===false||a.isDefaultPrevented())}}})(jQuery); +(function(b){b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var c=this;this.element.bind("mousedown."+this.widgetName,function(f){return c._mouseDown(f)}).bind("click."+this.widgetName,function(f){if(true===b.data(f.target,c.widgetName+".preventClickEvent")){b.removeData(f.target,c.widgetName+".preventClickEvent");f.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(c){c.originalEvent= +c.originalEvent||{};if(!c.originalEvent.mouseHandled){this._mouseStarted&&this._mouseUp(c);this._mouseDownEvent=c;var f=this,g=c.which==1,e=typeof this.options.cancel=="string"?b(c.target).parents().add(c.target).filter(this.options.cancel).length:false;if(!g||e||!this._mouseCapture(c))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){f.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(c)&&this._mouseDelayMet(c)){this._mouseStarted= +this._mouseStart(c)!==false;if(!this._mouseStarted){c.preventDefault();return true}}this._mouseMoveDelegate=function(a){return f._mouseMove(a)};this._mouseUpDelegate=function(a){return f._mouseUp(a)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);c.preventDefault();return c.originalEvent.mouseHandled=true}},_mouseMove:function(c){if(b.browser.msie&&!(document.documentMode>=9)&&!c.button)return this._mouseUp(c);if(this._mouseStarted){this._mouseDrag(c); +return c.preventDefault()}if(this._mouseDistanceMet(c)&&this._mouseDelayMet(c))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,c)!==false)?this._mouseDrag(c):this._mouseUp(c);return!this._mouseStarted},_mouseUp:function(c){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;c.target==this._mouseDownEvent.target&&b.data(c.target,this.widgetName+".preventClickEvent", +true);this._mouseStop(c)}return false},_mouseDistanceMet:function(c){return Math.max(Math.abs(this._mouseDownEvent.pageX-c.pageX),Math.abs(this._mouseDownEvent.pageY-c.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); +(function(b){b.widget("ui.draggable",b.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== +"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(c){var f= +this.options;if(this.helper||f.disabled||b(c.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(c);if(!this.handle)return false;return true},_mouseStart:function(c){var f=this.options;this.helper=this._createHelper(c);this._cacheHelperProportions();if(b.ui.ddmanager)b.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top- +this.margins.top,left:this.offset.left-this.margins.left};b.extend(this.offset,{click:{left:c.pageX-this.offset.left,top:c.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(c);this.originalPageX=c.pageX;this.originalPageY=c.pageY;f.cursorAt&&this._adjustOffsetFromHelper(f.cursorAt);f.containment&&this._setContainment();if(this._trigger("start",c)===false){this._clear();return false}this._cacheHelperProportions(); +b.ui.ddmanager&&!f.dropBehaviour&&b.ui.ddmanager.prepareOffsets(this,c);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(c,true);return true},_mouseDrag:function(c,f){this.position=this._generatePosition(c);this.positionAbs=this._convertPositionTo("absolute");if(!f){f=this._uiHash();if(this._trigger("drag",c,f)===false){this._mouseUp({});return false}this.position=f.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis|| +this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";b.ui.ddmanager&&b.ui.ddmanager.drag(this,c);return false},_mouseStop:function(c){var f=false;if(b.ui.ddmanager&&!this.options.dropBehaviour)f=b.ui.ddmanager.drop(this,c);if(this.dropped){f=this.dropped;this.dropped=false}if(!this.element[0]||!this.element[0].parentNode)return false;if(this.options.revert=="invalid"&&!f||this.options.revert=="valid"&&f||this.options.revert===true||b.isFunction(this.options.revert)&&this.options.revert.call(this.element, +f)){var g=this;b(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){g._trigger("stop",c)!==false&&g._clear()})}else this._trigger("stop",c)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(c){var f=!this.options.handle||!b(this.options.handle,this.element).length?true:false;b(this.options.handle,this.element).find("*").andSelf().each(function(){if(this== +c.target)f=true});return f},_createHelper:function(c){var f=this.options;c=b.isFunction(f.helper)?b(f.helper.apply(this.element[0],[c])):f.helper=="clone"?this.element.clone():this.element;c.parents("body").length||c.appendTo(f.appendTo=="parent"?this.element[0].parentNode:f.appendTo);c[0]!=this.element[0]&&!/(fixed|absolute)/.test(c.css("position"))&&c.css("position","absolute");return c},_adjustOffsetFromHelper:function(c){if(typeof c=="string")c=c.split(" ");if(b.isArray(c))c={left:+c[0],top:+c[1]|| +0};if("left"in c)this.offset.click.left=c.left+this.margins.left;if("right"in c)this.offset.click.left=this.helperProportions.width-c.right+this.margins.left;if("top"in c)this.offset.click.top=c.top+this.margins.top;if("bottom"in c)this.offset.click.top=this.helperProportions.height-c.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var c=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0], +this.offsetParent[0])){c.left+=this.scrollParent.scrollLeft();c.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&b.browser.msie)c={top:0,left:0};return{top:c.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:c.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var c=this.element.position();return{top:c.top- +(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:c.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var c=this.options;if(c.containment== +"parent")c.containment=this.helper[0].parentNode;if(c.containment=="document"||c.containment=="window")this.containment=[(c.containment=="document"?0:b(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(c.containment=="document"?0:b(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(c.containment=="document"?0:b(window).scrollLeft())+b(c.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(c.containment=="document"? +0:b(window).scrollTop())+(b(c.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(c.containment)&&c.containment.constructor!=Array){var f=b(c.containment)[0];if(f){c=b(c.containment).offset();var g=b(f).css("overflow")!="hidden";this.containment=[c.left+(parseInt(b(f).css("borderLeftWidth"),10)||0)+(parseInt(b(f).css("paddingLeft"),10)||0)-this.margins.left,c.top+(parseInt(b(f).css("borderTopWidth"), +10)||0)+(parseInt(b(f).css("paddingTop"),10)||0)-this.margins.top,c.left+(g?Math.max(f.scrollWidth,f.offsetWidth):f.offsetWidth)-(parseInt(b(f).css("borderLeftWidth"),10)||0)-(parseInt(b(f).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,c.top+(g?Math.max(f.scrollHeight,f.offsetHeight):f.offsetHeight)-(parseInt(b(f).css("borderTopWidth"),10)||0)-(parseInt(b(f).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}}else if(c.containment.constructor== +Array)this.containment=c.containment},_convertPositionTo:function(c,f){if(!f)f=this.position;c=c=="absolute"?1:-1;var g=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(g[0].tagName);return{top:f.top+this.offset.relative.top*c+this.offset.parent.top*c-(b.browser.safari&&b.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop(): +e?0:g.scrollTop())*c),left:f.left+this.offset.relative.left*c+this.offset.parent.left*c-(b.browser.safari&&b.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:g.scrollLeft())*c)}},_generatePosition:function(c){var f=this.options,g=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(g[0].tagName),a=c.pageX,d=c.pageY; +if(this.originalPosition){if(this.containment){if(c.pageX-this.offset.click.left<this.containment[0])a=this.containment[0]+this.offset.click.left;if(c.pageY-this.offset.click.top<this.containment[1])d=this.containment[1]+this.offset.click.top;if(c.pageX-this.offset.click.left>this.containment[2])a=this.containment[2]+this.offset.click.left;if(c.pageY-this.offset.click.top>this.containment[3])d=this.containment[3]+this.offset.click.top}if(f.grid){d=this.originalPageY+Math.round((d-this.originalPageY)/ +f.grid[1])*f.grid[1];d=this.containment?!(d-this.offset.click.top<this.containment[1]||d-this.offset.click.top>this.containment[3])?d:!(d-this.offset.click.top<this.containment[1])?d-f.grid[1]:d+f.grid[1]:d;a=this.originalPageX+Math.round((a-this.originalPageX)/f.grid[0])*f.grid[0];a=this.containment?!(a-this.offset.click.left<this.containment[0]||a-this.offset.click.left>this.containment[2])?a:!(a-this.offset.click.left<this.containment[0])?a-f.grid[0]:a+f.grid[0]:a}}return{top:d-this.offset.click.top- +this.offset.relative.top-this.offset.parent.top+(b.browser.safari&&b.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:g.scrollTop()),left:a-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(b.browser.safari&&b.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:g.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!= +this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(c,f,g){g=g||this._uiHash();b.ui.plugin.call(this,c,[f,g]);if(c=="drag")this.positionAbs=this._convertPositionTo("absolute");return b.Widget.prototype._trigger.call(this,c,f,g)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});b.extend(b.ui.draggable,{version:"1.8.7"}); +b.ui.plugin.add("draggable","connectToSortable",{start:function(c,f){var g=b(this).data("draggable"),e=g.options,a=b.extend({},f,{item:g.element});g.sortables=[];b(e.connectToSortable).each(function(){var d=b.data(this,"sortable");if(d&&!d.options.disabled){g.sortables.push({instance:d,shouldRevert:d.options.revert});d._refreshItems();d._trigger("activate",c,a)}})},stop:function(c,f){var g=b(this).data("draggable"),e=b.extend({},f,{item:g.element});b.each(g.sortables,function(){if(this.instance.isOver){this.instance.isOver= +0;g.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(c);this.instance.options.helper=this.instance.options._helper;g.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",c,e)}})},drag:function(c,f){var g=b(this).data("draggable"),e=this;b.each(g.sortables,function(){this.instance.positionAbs= +g.positionAbs;this.instance.helperProportions=g.helperProportions;this.instance.offset.click=g.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=b(e).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return f.helper[0]};c.target=this.instance.currentItem[0];this.instance._mouseCapture(c, +true);this.instance._mouseStart(c,true,true);this.instance.offset.click.top=g.offset.click.top;this.instance.offset.click.left=g.offset.click.left;this.instance.offset.parent.left-=g.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=g.offset.parent.top-this.instance.offset.parent.top;g._trigger("toSortable",c);g.dropped=this.instance.element;g.currentItem=g.element;this.instance.fromOutside=g}this.instance.currentItem&&this.instance._mouseDrag(c)}else if(this.instance.isOver){this.instance.isOver= +0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",c,this.instance._uiHash(this.instance));this.instance._mouseStop(c,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();g._trigger("fromSortable",c);g.dropped=false}})}});b.ui.plugin.add("draggable","cursor",{start:function(){var c=b("body"),f=b(this).data("draggable").options;if(c.css("cursor"))f._cursor= +c.css("cursor");c.css("cursor",f.cursor)},stop:function(){var c=b(this).data("draggable").options;c._cursor&&b("body").css("cursor",c._cursor)}});b.ui.plugin.add("draggable","iframeFix",{start:function(){var c=b(this).data("draggable").options;b(c.iframeFix===true?"iframe":c.iframeFix).each(function(){b('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(b(this).offset()).appendTo("body")})}, +stop:function(){b("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});b.ui.plugin.add("draggable","opacity",{start:function(c,f){c=b(f.helper);f=b(this).data("draggable").options;if(c.css("opacity"))f._opacity=c.css("opacity");c.css("opacity",f.opacity)},stop:function(c,f){c=b(this).data("draggable").options;c._opacity&&b(f.helper).css("opacity",c._opacity)}});b.ui.plugin.add("draggable","scroll",{start:function(){var c=b(this).data("draggable");if(c.scrollParent[0]!= +document&&c.scrollParent[0].tagName!="HTML")c.overflowOffset=c.scrollParent.offset()},drag:function(c){var f=b(this).data("draggable"),g=f.options,e=false;if(f.scrollParent[0]!=document&&f.scrollParent[0].tagName!="HTML"){if(!g.axis||g.axis!="x")if(f.overflowOffset.top+f.scrollParent[0].offsetHeight-c.pageY<g.scrollSensitivity)f.scrollParent[0].scrollTop=e=f.scrollParent[0].scrollTop+g.scrollSpeed;else if(c.pageY-f.overflowOffset.top<g.scrollSensitivity)f.scrollParent[0].scrollTop=e=f.scrollParent[0].scrollTop- +g.scrollSpeed;if(!g.axis||g.axis!="y")if(f.overflowOffset.left+f.scrollParent[0].offsetWidth-c.pageX<g.scrollSensitivity)f.scrollParent[0].scrollLeft=e=f.scrollParent[0].scrollLeft+g.scrollSpeed;else if(c.pageX-f.overflowOffset.left<g.scrollSensitivity)f.scrollParent[0].scrollLeft=e=f.scrollParent[0].scrollLeft-g.scrollSpeed}else{if(!g.axis||g.axis!="x")if(c.pageY-b(document).scrollTop()<g.scrollSensitivity)e=b(document).scrollTop(b(document).scrollTop()-g.scrollSpeed);else if(b(window).height()- +(c.pageY-b(document).scrollTop())<g.scrollSensitivity)e=b(document).scrollTop(b(document).scrollTop()+g.scrollSpeed);if(!g.axis||g.axis!="y")if(c.pageX-b(document).scrollLeft()<g.scrollSensitivity)e=b(document).scrollLeft(b(document).scrollLeft()-g.scrollSpeed);else if(b(window).width()-(c.pageX-b(document).scrollLeft())<g.scrollSensitivity)e=b(document).scrollLeft(b(document).scrollLeft()+g.scrollSpeed)}e!==false&&b.ui.ddmanager&&!g.dropBehaviour&&b.ui.ddmanager.prepareOffsets(f,c)}});b.ui.plugin.add("draggable", +"snap",{start:function(){var c=b(this).data("draggable"),f=c.options;c.snapElements=[];b(f.snap.constructor!=String?f.snap.items||":data(draggable)":f.snap).each(function(){var g=b(this),e=g.offset();this!=c.element[0]&&c.snapElements.push({item:this,width:g.outerWidth(),height:g.outerHeight(),top:e.top,left:e.left})})},drag:function(c,f){for(var g=b(this).data("draggable"),e=g.options,a=e.snapTolerance,d=f.offset.left,h=d+g.helperProportions.width,i=f.offset.top,j=i+g.helperProportions.height,n= +g.snapElements.length-1;n>=0;n--){var q=g.snapElements[n].left,l=q+g.snapElements[n].width,k=g.snapElements[n].top,m=k+g.snapElements[n].height;if(q-a<d&&d<l+a&&k-a<i&&i<m+a||q-a<d&&d<l+a&&k-a<j&&j<m+a||q-a<h&&h<l+a&&k-a<i&&i<m+a||q-a<h&&h<l+a&&k-a<j&&j<m+a){if(e.snapMode!="inner"){var o=Math.abs(k-j)<=a,p=Math.abs(m-i)<=a,s=Math.abs(q-h)<=a,r=Math.abs(l-d)<=a;if(o)f.position.top=g._convertPositionTo("relative",{top:k-g.helperProportions.height,left:0}).top-g.margins.top;if(p)f.position.top=g._convertPositionTo("relative", +{top:m,left:0}).top-g.margins.top;if(s)f.position.left=g._convertPositionTo("relative",{top:0,left:q-g.helperProportions.width}).left-g.margins.left;if(r)f.position.left=g._convertPositionTo("relative",{top:0,left:l}).left-g.margins.left}var u=o||p||s||r;if(e.snapMode!="outer"){o=Math.abs(k-i)<=a;p=Math.abs(m-j)<=a;s=Math.abs(q-d)<=a;r=Math.abs(l-h)<=a;if(o)f.position.top=g._convertPositionTo("relative",{top:k,left:0}).top-g.margins.top;if(p)f.position.top=g._convertPositionTo("relative",{top:m-g.helperProportions.height, +left:0}).top-g.margins.top;if(s)f.position.left=g._convertPositionTo("relative",{top:0,left:q}).left-g.margins.left;if(r)f.position.left=g._convertPositionTo("relative",{top:0,left:l-g.helperProportions.width}).left-g.margins.left}if(!g.snapElements[n].snapping&&(o||p||s||r||u))g.options.snap.snap&&g.options.snap.snap.call(g.element,c,b.extend(g._uiHash(),{snapItem:g.snapElements[n].item}));g.snapElements[n].snapping=o||p||s||r||u}else{g.snapElements[n].snapping&&g.options.snap.release&&g.options.snap.release.call(g.element, +c,b.extend(g._uiHash(),{snapItem:g.snapElements[n].item}));g.snapElements[n].snapping=false}}}});b.ui.plugin.add("draggable","stack",{start:function(){var c=b(this).data("draggable").options;c=b.makeArray(b(c.stack)).sort(function(g,e){return(parseInt(b(g).css("zIndex"),10)||0)-(parseInt(b(e).css("zIndex"),10)||0)});if(c.length){var f=parseInt(c[0].style.zIndex)||0;b(c).each(function(g){this.style.zIndex=f+g});this[0].style.zIndex=f+c.length}}});b.ui.plugin.add("draggable","zIndex",{start:function(c, +f){c=b(f.helper);f=b(this).data("draggable").options;if(c.css("zIndex"))f._zIndex=c.css("zIndex");c.css("zIndex",f.zIndex)},stop:function(c,f){c=b(this).data("draggable").options;c._zIndex&&b(f.helper).css("zIndex",c._zIndex)}})})(jQuery); +(function(b){b.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var c=this.options,f=c.accept;this.isover=0;this.isout=1;this.accept=b.isFunction(f)?f:function(g){return g.is(f)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};b.ui.ddmanager.droppables[c.scope]=b.ui.ddmanager.droppables[c.scope]||[];b.ui.ddmanager.droppables[c.scope].push(this); +c.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var c=b.ui.ddmanager.droppables[this.options.scope],f=0;f<c.length;f++)c[f]==this&&c.splice(f,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(c,f){if(c=="accept")this.accept=b.isFunction(f)?f:function(g){return g.is(f)};b.Widget.prototype._setOption.apply(this,arguments)},_activate:function(c){var f=b.ui.ddmanager.current;this.options.activeClass&& +this.element.addClass(this.options.activeClass);f&&this._trigger("activate",c,this.ui(f))},_deactivate:function(c){var f=b.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);f&&this._trigger("deactivate",c,this.ui(f))},_over:function(c){var f=b.ui.ddmanager.current;if(!(!f||(f.currentItem||f.element)[0]==this.element[0]))if(this.accept.call(this.element[0],f.currentItem||f.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass); +this._trigger("over",c,this.ui(f))}},_out:function(c){var f=b.ui.ddmanager.current;if(!(!f||(f.currentItem||f.element)[0]==this.element[0]))if(this.accept.call(this.element[0],f.currentItem||f.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",c,this.ui(f))}},_drop:function(c,f){var g=f||b.ui.ddmanager.current;if(!g||(g.currentItem||g.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var a= +b.data(this,"droppable");if(a.options.greedy&&!a.options.disabled&&a.options.scope==g.options.scope&&a.accept.call(a.element[0],g.currentItem||g.element)&&b.ui.intersect(g,b.extend(a,{offset:a.element.offset()}),a.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],g.currentItem||g.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop", +c,this.ui(g));return this.element}return false},ui:function(c){return{draggable:c.currentItem||c.element,helper:c.helper,position:c.position,offset:c.positionAbs}}});b.extend(b.ui.droppable,{version:"1.8.7"});b.ui.intersect=function(c,f,g){if(!f.offset)return false;var e=(c.positionAbs||c.position.absolute).left,a=e+c.helperProportions.width,d=(c.positionAbs||c.position.absolute).top,h=d+c.helperProportions.height,i=f.offset.left,j=i+f.proportions.width,n=f.offset.top,q=n+f.proportions.height; +switch(g){case "fit":return i<=e&&a<=j&&n<=d&&h<=q;case "intersect":return i<e+c.helperProportions.width/2&&a-c.helperProportions.width/2<j&&n<d+c.helperProportions.height/2&&h-c.helperProportions.height/2<q;case "pointer":return b.ui.isOver((c.positionAbs||c.position.absolute).top+(c.clickOffset||c.offset.click).top,(c.positionAbs||c.position.absolute).left+(c.clickOffset||c.offset.click).left,n,i,f.proportions.height,f.proportions.width);case "touch":return(d>=n&&d<=q||h>=n&&h<=q||d<n&&h>q)&&(e>= +i&&e<=j||a>=i&&a<=j||e<i&&a>j);default:return false}};b.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(c,f){var g=b.ui.ddmanager.droppables[c.options.scope]||[],e=f?f.type:null,a=(c.currentItem||c.element).find(":data(droppable)").andSelf(),d=0;a:for(;d<g.length;d++)if(!(g[d].options.disabled||c&&!g[d].accept.call(g[d].element[0],c.currentItem||c.element))){for(var h=0;h<a.length;h++)if(a[h]==g[d].element[0]){g[d].proportions.height=0;continue a}g[d].visible=g[d].element.css("display")!= +"none";if(g[d].visible){g[d].offset=g[d].element.offset();g[d].proportions={width:g[d].element[0].offsetWidth,height:g[d].element[0].offsetHeight};e=="mousedown"&&g[d]._activate.call(g[d],f)}}},drop:function(c,f){var g=false;b.each(b.ui.ddmanager.droppables[c.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&b.ui.intersect(c,this,this.options.tolerance))g=g||this._drop.call(this,f);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],c.currentItem|| +c.element)){this.isout=1;this.isover=0;this._deactivate.call(this,f)}}});return g},drag:function(c,f){c.options.refreshPositions&&b.ui.ddmanager.prepareOffsets(c,f);b.each(b.ui.ddmanager.droppables[c.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var g=b.ui.intersect(c,this,this.options.tolerance);if(g=!g&&this.isover==1?"isout":g&&this.isover==0?"isover":null){var e;if(this.options.greedy){var a=this.element.parents(":data(droppable):eq(0)");if(a.length){e= +b.data(a[0],"droppable");e.greedyChild=g=="isover"?1:0}}if(e&&g=="isover"){e.isover=0;e.isout=1;e._out.call(e,f)}this[g]=1;this[g=="isout"?"isover":"isout"]=0;this[g=="isover"?"_over":"_out"].call(this,f);if(e&&g=="isout"){e.isout=0;e.isover=1;e._over.call(e,f)}}}})}}})(jQuery); +(function(b){b.widget("ui.resizable",b.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var g=this,e=this.options;this.element.addClass("ui-resizable");b.extend(this,{_aspectRatio:!!e.aspectRatio,aspectRatio:e.aspectRatio,originalElement:this.element, +_proportionallyResizeElements:[],_helper:e.helper||e.ghost||e.animate?e.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&b.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(b('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), +top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= +this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=e.handles||(!b(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", +nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var a=this.handles.split(",");this.handles={};for(var d=0;d<a.length;d++){var h=b.trim(a[d]),i=b('<div class="ui-resizable-handle '+("ui-resizable-"+h)+'"></div>');/sw|se|ne|nw/.test(h)&&i.css({zIndex:++e.zIndex});"se"==h&&i.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[h]=".ui-resizable-"+h;this.element.append(i)}}this._renderAxis=function(j){j=j||this.element;for(var n in this.handles){if(this.handles[n].constructor== +String)this.handles[n]=b(this.handles[n],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var q=b(this.handles[n],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(n)?q.outerHeight():q.outerWidth();q=["padding",/ne|nw|n/.test(n)?"Top":/se|sw|s/.test(n)?"Bottom":/^e$/.test(n)?"Right":"Left"].join("");j.css(q,l);this._proportionallyResize()}b(this.handles[n])}};this._renderAxis(this.element);this._handles=b(".ui-resizable-handle",this.element).disableSelection(); +this._handles.mouseover(function(){if(!g.resizing){if(this.className)var j=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);g.axis=j&&j[1]?j[1]:"se"}});if(e.autoHide){this._handles.hide();b(this.element).addClass("ui-resizable-autohide").hover(function(){b(this).removeClass("ui-resizable-autohide");g._handles.show()},function(){if(!g.resizing){b(this).addClass("ui-resizable-autohide");g._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var g=function(a){b(a).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()}; +if(this.elementIsWrapper){g(this.element);var e=this.element;e.after(this.originalElement.css({position:e.css("position"),width:e.outerWidth(),height:e.outerHeight(),top:e.css("top"),left:e.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);g(this.originalElement);return this},_mouseCapture:function(g){var e=false;for(var a in this.handles)if(b(this.handles[a])[0]==g.target)e=true;return!this.options.disabled&&e},_mouseStart:function(g){var e=this.options,a=this.element.position(), +d=this.element;this.resizing=true;this.documentScroll={top:b(document).scrollTop(),left:b(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:a.top,left:a.left});b.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();a=c(this.helper.css("left"));var h=c(this.helper.css("top"));if(e.containment){a+=b(e.containment).scrollLeft()||0;h+=b(e.containment).scrollTop()||0}this.offset= +this.helper.offset();this.position={left:a,top:h};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:a,top:h};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:g.pageX,top:g.pageY};this.aspectRatio=typeof e.aspectRatio=="number"?e.aspectRatio: +this.originalSize.width/this.originalSize.height||1;e=b(".ui-resizable-"+this.axis).css("cursor");b("body").css("cursor",e=="auto"?this.axis+"-resize":e);d.addClass("ui-resizable-resizing");this._propagate("start",g);return true},_mouseDrag:function(g){var e=this.helper,a=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;a=d.apply(this,[g,g.pageX-a.left||0,g.pageY-a.top||0]);if(this._aspectRatio||g.shiftKey)a=this._updateRatio(a,g);a=this._respectSize(a,g);this._propagate("resize", +g);e.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(a);this._trigger("resize",g,this.ui());return false},_mouseStop:function(g){this.resizing=false;var e=this.options,a=this;if(this._helper){var d=this._proportionallyResizeElements,h=d.length&&/textarea/i.test(d[0].nodeName);d=h&&b.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height; +h={width:a.size.width-(h?0:a.sizeDiff.width),height:a.size.height-d};d=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var i=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;e.animate||this.element.css(b.extend(h,{top:i,left:d}));a.helper.height(a.size.height);a.helper.width(a.size.width);this._helper&&!e.animate&&this._proportionallyResize()}b("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop", +g);this._helper&&this.helper.remove();return false},_updateCache:function(g){this.offset=this.helper.offset();if(f(g.left))this.position.left=g.left;if(f(g.top))this.position.top=g.top;if(f(g.height))this.size.height=g.height;if(f(g.width))this.size.width=g.width},_updateRatio:function(g){var e=this.position,a=this.size,d=this.axis;if(g.height)g.width=a.height*this.aspectRatio;else if(g.width)g.height=a.width/this.aspectRatio;if(d=="sw"){g.left=e.left+(a.width-g.width);g.top=null}if(d=="nw"){g.top= +e.top+(a.height-g.height);g.left=e.left+(a.width-g.width)}return g},_respectSize:function(g){var e=this.options,a=this.axis,d=f(g.width)&&e.maxWidth&&e.maxWidth<g.width,h=f(g.height)&&e.maxHeight&&e.maxHeight<g.height,i=f(g.width)&&e.minWidth&&e.minWidth>g.width,j=f(g.height)&&e.minHeight&&e.minHeight>g.height;if(i)g.width=e.minWidth;if(j)g.height=e.minHeight;if(d)g.width=e.maxWidth;if(h)g.height=e.maxHeight;var n=this.originalPosition.left+this.originalSize.width,q=this.position.top+this.size.height, +l=/sw|nw|w/.test(a);a=/nw|ne|n/.test(a);if(i&&l)g.left=n-e.minWidth;if(d&&l)g.left=n-e.maxWidth;if(j&&a)g.top=q-e.minHeight;if(h&&a)g.top=q-e.maxHeight;if((e=!g.width&&!g.height)&&!g.left&&g.top)g.top=null;else if(e&&!g.top&&g.left)g.left=null;return g},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var g=this.helper||this.element,e=0;e<this._proportionallyResizeElements.length;e++){var a=this._proportionallyResizeElements[e];if(!this.borderDif){var d=[a.css("borderTopWidth"), +a.css("borderRightWidth"),a.css("borderBottomWidth"),a.css("borderLeftWidth")],h=[a.css("paddingTop"),a.css("paddingRight"),a.css("paddingBottom"),a.css("paddingLeft")];this.borderDif=b.map(d,function(i,j){i=parseInt(i,10)||0;j=parseInt(h[j],10)||0;return i+j})}b.browser.msie&&(b(g).is(":hidden")||b(g).parents(":hidden").length)||a.css({height:g.height()-this.borderDif[0]-this.borderDif[2]||0,width:g.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var g=this.options;this.elementOffset= +this.element.offset();if(this._helper){this.helper=this.helper||b('<div style="overflow:hidden;"></div>');var e=b.browser.msie&&b.browser.version<7,a=e?1:0;e=e?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+e,height:this.element.outerHeight()+e,position:"absolute",left:this.elementOffset.left-a+"px",top:this.elementOffset.top-a+"px",zIndex:++g.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(g,e){return{width:this.originalSize.width+ +e}},w:function(g,e){return{left:this.originalPosition.left+e,width:this.originalSize.width-e}},n:function(g,e,a){return{top:this.originalPosition.top+a,height:this.originalSize.height-a}},s:function(g,e,a){return{height:this.originalSize.height+a}},se:function(g,e,a){return b.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[g,e,a]))},sw:function(g,e,a){return b.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[g,e,a]))},ne:function(g,e,a){return b.extend(this._change.n.apply(this, +arguments),this._change.e.apply(this,[g,e,a]))},nw:function(g,e,a){return b.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[g,e,a]))}},_propagate:function(g,e){b.ui.plugin.call(this,g,[e,this.ui()]);g!="resize"&&this._trigger(g,e,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});b.extend(b.ui.resizable, +{version:"1.8.7"});b.ui.plugin.add("resizable","alsoResize",{start:function(){var g=b(this).data("resizable").options,e=function(a){b(a).each(function(){var d=b(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof g.alsoResize=="object"&&!g.alsoResize.parentNode)if(g.alsoResize.length){g.alsoResize=g.alsoResize[0];e(g.alsoResize)}else b.each(g.alsoResize, +function(a){e(a)});else e(g.alsoResize)},resize:function(g,e){var a=b(this).data("resizable");g=a.options;var d=a.originalSize,h=a.originalPosition,i={height:a.size.height-d.height||0,width:a.size.width-d.width||0,top:a.position.top-h.top||0,left:a.position.left-h.left||0},j=function(n,q){b(n).each(function(){var l=b(this),k=b(this).data("resizable-alsoresize"),m={},o=q&&q.length?q:l.parents(e.originalElement[0]).length?["width","height"]:["width","height","top","left"];b.each(o,function(p,s){if((p= +(k[s]||0)+(i[s]||0))&&p>=0)m[s]=p||null});if(b.browser.opera&&/relative/.test(l.css("position"))){a._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(m)})};typeof g.alsoResize=="object"&&!g.alsoResize.nodeType?b.each(g.alsoResize,function(n,q){j(n,q)}):j(g.alsoResize)},stop:function(){var g=b(this).data("resizable"),e=g.options,a=function(d){b(d).each(function(){var h=b(this);h.css({position:h.data("resizable-alsoresize").position})})};if(g._revertToRelativePosition){g._revertToRelativePosition= +false;typeof e.alsoResize=="object"&&!e.alsoResize.nodeType?b.each(e.alsoResize,function(d){a(d)}):a(e.alsoResize)}b(this).removeData("resizable-alsoresize")}});b.ui.plugin.add("resizable","animate",{stop:function(g){var e=b(this).data("resizable"),a=e.options,d=e._proportionallyResizeElements,h=d.length&&/textarea/i.test(d[0].nodeName),i=h&&b.ui.hasScroll(d[0],"left")?0:e.sizeDiff.height;h={width:e.size.width-(h?0:e.sizeDiff.width),height:e.size.height-i};i=parseInt(e.element.css("left"),10)+(e.position.left- +e.originalPosition.left)||null;var j=parseInt(e.element.css("top"),10)+(e.position.top-e.originalPosition.top)||null;e.element.animate(b.extend(h,j&&i?{top:j,left:i}:{}),{duration:a.animateDuration,easing:a.animateEasing,step:function(){var n={width:parseInt(e.element.css("width"),10),height:parseInt(e.element.css("height"),10),top:parseInt(e.element.css("top"),10),left:parseInt(e.element.css("left"),10)};d&&d.length&&b(d[0]).css({width:n.width,height:n.height});e._updateCache(n);e._propagate("resize", +g)}})}});b.ui.plugin.add("resizable","containment",{start:function(){var g=b(this).data("resizable"),e=g.element,a=g.options.containment;if(e=a instanceof b?a.get(0):/parent/.test(a)?e.parent().get(0):a){g.containerElement=b(e);if(/document/.test(a)||a==document){g.containerOffset={left:0,top:0};g.containerPosition={left:0,top:0};g.parentData={element:b(document),left:0,top:0,width:b(document).width(),height:b(document).height()||document.body.parentNode.scrollHeight}}else{var d=b(e),h=[];b(["Top", +"Right","Left","Bottom"]).each(function(n,q){h[n]=c(d.css("padding"+q))});g.containerOffset=d.offset();g.containerPosition=d.position();g.containerSize={height:d.innerHeight()-h[3],width:d.innerWidth()-h[1]};a=g.containerOffset;var i=g.containerSize.height,j=g.containerSize.width;j=b.ui.hasScroll(e,"left")?e.scrollWidth:j;i=b.ui.hasScroll(e)?e.scrollHeight:i;g.parentData={element:e,left:a.left,top:a.top,width:j,height:i}}}},resize:function(g){var e=b(this).data("resizable"),a=e.options,d=e.containerOffset, +h=e.position;g=e._aspectRatio||g.shiftKey;var i={top:0,left:0},j=e.containerElement;if(j[0]!=document&&/static/.test(j.css("position")))i=d;if(h.left<(e._helper?d.left:0)){e.size.width+=e._helper?e.position.left-d.left:e.position.left-i.left;if(g)e.size.height=e.size.width/a.aspectRatio;e.position.left=a.helper?d.left:0}if(h.top<(e._helper?d.top:0)){e.size.height+=e._helper?e.position.top-d.top:e.position.top;if(g)e.size.width=e.size.height*a.aspectRatio;e.position.top=e._helper?d.top:0}e.offset.left= +e.parentData.left+e.position.left;e.offset.top=e.parentData.top+e.position.top;a=Math.abs((e._helper?e.offset.left-i.left:e.offset.left-i.left)+e.sizeDiff.width);d=Math.abs((e._helper?e.offset.top-i.top:e.offset.top-d.top)+e.sizeDiff.height);h=e.containerElement.get(0)==e.element.parent().get(0);i=/relative|absolute/.test(e.containerElement.css("position"));if(h&&i)a-=e.parentData.left;if(a+e.size.width>=e.parentData.width){e.size.width=e.parentData.width-a;if(g)e.size.height=e.size.width/e.aspectRatio}if(d+ +e.size.height>=e.parentData.height){e.size.height=e.parentData.height-d;if(g)e.size.width=e.size.height*e.aspectRatio}},stop:function(){var g=b(this).data("resizable"),e=g.options,a=g.containerOffset,d=g.containerPosition,h=g.containerElement,i=b(g.helper),j=i.offset(),n=i.outerWidth()-g.sizeDiff.width;i=i.outerHeight()-g.sizeDiff.height;g._helper&&!e.animate&&/relative/.test(h.css("position"))&&b(this).css({left:j.left-d.left-a.left,width:n,height:i});g._helper&&!e.animate&&/static/.test(h.css("position"))&& +b(this).css({left:j.left-d.left-a.left,width:n,height:i})}});b.ui.plugin.add("resizable","ghost",{start:function(){var g=b(this).data("resizable"),e=g.options,a=g.size;g.ghost=g.originalElement.clone();g.ghost.css({opacity:0.25,display:"block",position:"relative",height:a.height,width:a.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof e.ghost=="string"?e.ghost:"");g.ghost.appendTo(g.helper)},resize:function(){var g=b(this).data("resizable");g.ghost&&g.ghost.css({position:"relative", +height:g.size.height,width:g.size.width})},stop:function(){var g=b(this).data("resizable");g.ghost&&g.helper&&g.helper.get(0).removeChild(g.ghost.get(0))}});b.ui.plugin.add("resizable","grid",{resize:function(){var g=b(this).data("resizable"),e=g.options,a=g.size,d=g.originalSize,h=g.originalPosition,i=g.axis;e.grid=typeof e.grid=="number"?[e.grid,e.grid]:e.grid;var j=Math.round((a.width-d.width)/(e.grid[0]||1))*(e.grid[0]||1);e=Math.round((a.height-d.height)/(e.grid[1]||1))*(e.grid[1]||1);if(/^(se|s|e)$/.test(i)){g.size.width= +d.width+j;g.size.height=d.height+e}else if(/^(ne)$/.test(i)){g.size.width=d.width+j;g.size.height=d.height+e;g.position.top=h.top-e}else{if(/^(sw)$/.test(i)){g.size.width=d.width+j;g.size.height=d.height+e}else{g.size.width=d.width+j;g.size.height=d.height+e;g.position.top=h.top-e}g.position.left=h.left-j}}});var c=function(g){return parseInt(g,10)||0},f=function(g){return!isNaN(parseInt(g,10))}})(jQuery); +(function(b){b.widget("ui.selectable",b.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=b(c.options.filter,c.element[0]);f.each(function(){var g=b(this),e=g.offset();b.data(this,"selectable-item",{element:this,$element:g,left:e.left,top:e.top,right:e.left+g.outerWidth(),bottom:e.top+g.outerHeight(),startselected:false,selected:g.hasClass("ui-selected"), +selecting:g.hasClass("ui-selecting"),unselecting:g.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=b("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, +c.pageY];if(!this.options.disabled){var g=this.options;this.selectees=b(g.filter,this.element[0]);this._trigger("start",c);b(g.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});g.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var e=b.data(this,"selectable-item");e.startselected=true;if(!c.metaKey){e.$element.removeClass("ui-selected");e.selected=false;e.$element.addClass("ui-unselecting");e.unselecting=true;f._trigger("unselecting", +c,{unselecting:e.element})}});b(c.target).parents().andSelf().each(function(){var e=b.data(this,"selectable-item");if(e){var a=!c.metaKey||!e.$element.hasClass("ui-selected");e.$element.removeClass(a?"ui-unselecting":"ui-selected").addClass(a?"ui-selecting":"ui-unselecting");e.unselecting=!a;e.selecting=a;(e.selected=a)?f._trigger("selecting",c,{selecting:e.element}):f._trigger("unselecting",c,{unselecting:e.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var g= +this.options,e=this.opos[0],a=this.opos[1],d=c.pageX,h=c.pageY;if(e>d){var i=d;d=e;e=i}if(a>h){i=h;h=a;a=i}this.helper.css({left:e,top:a,width:d-e,height:h-a});this.selectees.each(function(){var j=b.data(this,"selectable-item");if(!(!j||j.element==f.element[0])){var n=false;if(g.tolerance=="touch")n=!(j.left>d||j.right<e||j.top>h||j.bottom<a);else if(g.tolerance=="fit")n=j.left>e&&j.right<d&&j.top>a&&j.bottom<h;if(n){if(j.selected){j.$element.removeClass("ui-selected");j.selected=false}if(j.unselecting){j.$element.removeClass("ui-unselecting"); +j.unselecting=false}if(!j.selecting){j.$element.addClass("ui-selecting");j.selecting=true;f._trigger("selecting",c,{selecting:j.element})}}else{if(j.selecting)if(c.metaKey&&j.startselected){j.$element.removeClass("ui-selecting");j.selecting=false;j.$element.addClass("ui-selected");j.selected=true}else{j.$element.removeClass("ui-selecting");j.selecting=false;if(j.startselected){j.$element.addClass("ui-unselecting");j.unselecting=true}f._trigger("unselecting",c,{unselecting:j.element})}if(j.selected)if(!c.metaKey&& +!j.startselected){j.$element.removeClass("ui-selected");j.selected=false;j.$element.addClass("ui-unselecting");j.unselecting=true;f._trigger("unselecting",c,{unselecting:j.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;b(".ui-unselecting",this.element[0]).each(function(){var g=b.data(this,"selectable-item");g.$element.removeClass("ui-unselecting");g.unselecting=false;g.startselected=false;f._trigger("unselected",c,{unselected:g.element})});b(".ui-selecting",this.element[0]).each(function(){var g= +b.data(this,"selectable-item");g.$element.removeClass("ui-selecting").addClass("ui-selected");g.selecting=false;g.selected=true;g.startselected=true;f._trigger("selected",c,{selected:g.element})});this._trigger("stop",c);this.helper.remove();return false}});b.extend(b.ui.selectable,{version:"1.8.7"})})(jQuery); +(function(b){b.widget("ui.sortable",b.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable"); +this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var c=this.items.length-1;c>=0;c--)this.items[c].item.removeData("sortable-item");return this},_setOption:function(c,f){if(c==="disabled"){this.options[c]=f;this.widget()[f?"addClass":"removeClass"]("ui-sortable-disabled")}else b.Widget.prototype._setOption.apply(this, +arguments)},_mouseCapture:function(c,f){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(c);var g=null,e=this;b(c.target).parents().each(function(){if(b.data(this,"sortable-item")==e){g=b(this);return false}});if(b.data(c.target,"sortable-item")==e)g=b(c.target);if(!g)return false;if(this.options.handle&&!f){var a=false;b(this.options.handle,g).find("*").andSelf().each(function(){if(this==c.target)a=true});if(!a)return false}this.currentItem= +g;this._removeCurrentsFromItems();return true},_mouseStart:function(c,f,g){f=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(c);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");b.extend(this.offset, +{click:{left:c.pageX-this.offset.left,top:c.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(c);this.originalPageX=c.pageX;this.originalPageY=c.pageY;f.cursorAt&&this._adjustOffsetFromHelper(f.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();f.containment&&this._setContainment(); +if(f.cursor){if(b("body").css("cursor"))this._storedCursor=b("body").css("cursor");b("body").css("cursor",f.cursor)}if(f.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",f.opacity)}if(f.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",f.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start", +c,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!g)for(g=this.containers.length-1;g>=0;g--)this.containers[g]._trigger("activate",c,e._uiHash(this));if(b.ui.ddmanager)b.ui.ddmanager.current=this;b.ui.ddmanager&&!f.dropBehaviour&&b.ui.ddmanager.prepareOffsets(this,c);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(c);return true},_mouseDrag:function(c){this.position=this._generatePosition(c);this.positionAbs=this._convertPositionTo("absolute"); +if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var f=this.options,g=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-c.pageY<f.scrollSensitivity)this.scrollParent[0].scrollTop=g=this.scrollParent[0].scrollTop+f.scrollSpeed;else if(c.pageY-this.overflowOffset.top<f.scrollSensitivity)this.scrollParent[0].scrollTop=g=this.scrollParent[0].scrollTop-f.scrollSpeed;if(this.overflowOffset.left+ +this.scrollParent[0].offsetWidth-c.pageX<f.scrollSensitivity)this.scrollParent[0].scrollLeft=g=this.scrollParent[0].scrollLeft+f.scrollSpeed;else if(c.pageX-this.overflowOffset.left<f.scrollSensitivity)this.scrollParent[0].scrollLeft=g=this.scrollParent[0].scrollLeft-f.scrollSpeed}else{if(c.pageY-b(document).scrollTop()<f.scrollSensitivity)g=b(document).scrollTop(b(document).scrollTop()-f.scrollSpeed);else if(b(window).height()-(c.pageY-b(document).scrollTop())<f.scrollSensitivity)g=b(document).scrollTop(b(document).scrollTop()+ +f.scrollSpeed);if(c.pageX-b(document).scrollLeft()<f.scrollSensitivity)g=b(document).scrollLeft(b(document).scrollLeft()-f.scrollSpeed);else if(b(window).width()-(c.pageX-b(document).scrollLeft())<f.scrollSensitivity)g=b(document).scrollLeft(b(document).scrollLeft()+f.scrollSpeed)}g!==false&&b.ui.ddmanager&&!f.dropBehaviour&&b.ui.ddmanager.prepareOffsets(this,c)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+ +"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(f=this.items.length-1;f>=0;f--){g=this.items[f];var e=g.item[0],a=this._intersectsWithPointer(g);if(a)if(e!=this.currentItem[0]&&this.placeholder[a==1?"next":"prev"]()[0]!=e&&!b.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!b.ui.contains(this.element[0],e):true)){this.direction=a==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(g))this._rearrange(c, +g);else break;this._trigger("change",c,this._uiHash());break}}this._contactContainers(c);b.ui.ddmanager&&b.ui.ddmanager.drag(this,c);this._trigger("sort",c,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(c,f){if(c){b.ui.ddmanager&&!this.options.dropBehaviour&&b.ui.ddmanager.drop(this,c);if(this.options.revert){var g=this;f=g.placeholder.offset();g.reverting=true;b(this.helper).animate({left:f.left-this.offset.parent.left-g.margins.left+(this.offsetParent[0]== +document.body?0:this.offsetParent[0].scrollLeft),top:f.top-this.offset.parent.top-g.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){g._clear(c)})}else this._clear(c,f);return false}},cancel:function(){var c=this;if(this.dragging){this._mouseUp();this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var f=this.containers.length-1;f>=0;f--){this.containers[f]._trigger("deactivate", +null,c._uiHash(this));if(this.containers[f].containerCache.over){this.containers[f]._trigger("out",null,c._uiHash(this));this.containers[f].containerCache.over=0}}}this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();b.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?b(this.domPosition.prev).after(this.currentItem): +b(this.domPosition.parent).prepend(this.currentItem);return this},serialize:function(c){var f=this._getItemsAsjQuery(c&&c.connected),g=[];c=c||{};b(f).each(function(){var e=(b(c.item||this).attr(c.attribute||"id")||"").match(c.expression||/(.+)[-=_](.+)/);if(e)g.push((c.key||e[1]+"[]")+"="+(c.key&&c.expression?e[1]:e[2]))});!g.length&&c.key&&g.push(c.key+"=");return g.join("&")},toArray:function(c){var f=this._getItemsAsjQuery(c&&c.connected),g=[];c=c||{};f.each(function(){g.push(b(c.item||this).attr(c.attribute|| +"id")||"")});return g},_intersectsWith:function(c){var f=this.positionAbs.left,g=f+this.helperProportions.width,e=this.positionAbs.top,a=e+this.helperProportions.height,d=c.left,h=d+c.width,i=c.top,j=i+c.height,n=this.offset.click.top,q=this.offset.click.left;n=e+n>i&&e+n<j&&f+q>d&&f+q<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>c[this.floating?"width":"height"]?n:d<f+ +this.helperProportions.width/2&&g-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&a-this.helperProportions.height/2<j},_intersectsWithPointer:function(c){var f=b.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,c.top,c.height);c=b.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,c.left,c.width);f=f&&c;c=this._getDragVerticalDirection();var g=this._getDragHorizontalDirection();if(!f)return false;return this.floating?g&&g=="right"||c=="down"?2:1:c&&(c=="down"? +2:1)},_intersectsWithSides:function(c){var f=b.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,c.top+c.height/2,c.height);c=b.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,c.left+c.width/2,c.width);var g=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&c||e=="left"&&!c:g&&(g=="down"&&f||g=="up"&&!f)},_getDragVerticalDirection:function(){var c=this.positionAbs.top-this.lastPositionAbs.top;return c!=0&&(c>0?"down":"up")}, +_getDragHorizontalDirection:function(){var c=this.positionAbs.left-this.lastPositionAbs.left;return c!=0&&(c>0?"right":"left")},refresh:function(c){this._refreshItems(c);this.refreshPositions();return this},_connectWith:function(){var c=this.options;return c.connectWith.constructor==String?[c.connectWith]:c.connectWith},_getItemsAsjQuery:function(c){var f=[],g=[],e=this._connectWith();if(e&&c)for(c=e.length-1;c>=0;c--)for(var a=b(e[c]),d=a.length-1;d>=0;d--){var h=b.data(a[d],"sortable");if(h&&h!= +this&&!h.options.disabled)g.push([b.isFunction(h.options.items)?h.options.items.call(h.element):b(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}g.push([b.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):b(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(c=g.length-1;c>=0;c--)g[c][0].each(function(){f.push(this)});return b(f)},_removeCurrentsFromItems:function(){for(var c= +this.currentItem.find(":data(sortable-item)"),f=0;f<this.items.length;f++)for(var g=0;g<c.length;g++)c[g]==this.items[f].item[0]&&this.items.splice(f,1)},_refreshItems:function(c){this.items=[];this.containers=[this];var f=this.items,g=[[b.isFunction(this.options.items)?this.options.items.call(this.element[0],c,{item:this.currentItem}):b(this.options.items,this.element),this]],e=this._connectWith();if(e)for(var a=e.length-1;a>=0;a--)for(var d=b(e[a]),h=d.length-1;h>=0;h--){var i=b.data(d[h],"sortable"); +if(i&&i!=this&&!i.options.disabled){g.push([b.isFunction(i.options.items)?i.options.items.call(i.element[0],c,{item:this.currentItem}):b(i.options.items,i.element),i]);this.containers.push(i)}}for(a=g.length-1;a>=0;a--){c=g[a][1];e=g[a][0];h=0;for(d=e.length;h<d;h++){i=b(e[h]);i.data("sortable-item",c);f.push({item:i,instance:c,width:0,height:0,left:0,top:0})}}},refreshPositions:function(c){if(this.offsetParent&&this.helper)this.offset.parent=this._getParentOffset();for(var f=this.items.length-1;f>= +0;f--){var g=this.items[f],e=this.options.toleranceElement?b(this.options.toleranceElement,g.item):g.item;if(!c){g.width=e.outerWidth();g.height=e.outerHeight()}e=e.offset();g.left=e.left;g.top=e.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(f=this.containers.length-1;f>=0;f--){e=this.containers[f].element.offset();this.containers[f].containerCache.left=e.left;this.containers[f].containerCache.top=e.top;this.containers[f].containerCache.width= +this.containers[f].element.outerWidth();this.containers[f].containerCache.height=this.containers[f].element.outerHeight()}return this},_createPlaceholder:function(c){var f=c||this,g=f.options;if(!g.placeholder||g.placeholder.constructor==String){var e=g.placeholder;g.placeholder={element:function(){var a=b(document.createElement(f.currentItem[0].nodeName)).addClass(e||f.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)a.style.visibility="hidden";return a}, +update:function(a,d){if(!(e&&!g.forcePlaceholderSize)){d.height()||d.height(f.currentItem.innerHeight()-parseInt(f.currentItem.css("paddingTop")||0,10)-parseInt(f.currentItem.css("paddingBottom")||0,10));d.width()||d.width(f.currentItem.innerWidth()-parseInt(f.currentItem.css("paddingLeft")||0,10)-parseInt(f.currentItem.css("paddingRight")||0,10))}}}}f.placeholder=b(g.placeholder.element.call(f.element,f.currentItem));f.currentItem.after(f.placeholder);g.placeholder.update(f,f.placeholder)},_contactContainers:function(c){for(var f= +null,g=null,e=this.containers.length-1;e>=0;e--)if(!b.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(f&&b.ui.contains(this.containers[e].element[0],f.element[0]))){f=this.containers[e];g=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",c,this._uiHash(this));this.containers[e].containerCache.over=0}if(f)if(this.containers.length===1){this.containers[g]._trigger("over",c,this._uiHash(this)); +this.containers[g].containerCache.over=1}else if(this.currentContainer!=this.containers[g]){f=1E4;e=null;for(var a=this.positionAbs[this.containers[g].floating?"left":"top"],d=this.items.length-1;d>=0;d--)if(b.ui.contains(this.containers[g].element[0],this.items[d].item[0])){var h=this.items[d][this.containers[g].floating?"left":"top"];if(Math.abs(h-a)<f){f=Math.abs(h-a);e=this.items[d]}}if(e||this.options.dropOnEmpty){this.currentContainer=this.containers[g];e?this._rearrange(c,e,null,true):this._rearrange(c, +null,this.containers[g].element,true);this._trigger("change",c,this._uiHash());this.containers[g]._trigger("change",c,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[g]._trigger("over",c,this._uiHash(this));this.containers[g].containerCache.over=1}}},_createHelper:function(c){var f=this.options;c=b.isFunction(f.helper)?b(f.helper.apply(this.element[0],[c,this.currentItem])):f.helper=="clone"?this.currentItem.clone():this.currentItem;c.parents("body").length|| +b(f.appendTo!="parent"?f.appendTo:this.currentItem[0].parentNode)[0].appendChild(c[0]);if(c[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(c[0].style.width==""||f.forceHelperSize)c.width(this.currentItem.width());if(c[0].style.height==""||f.forceHelperSize)c.height(this.currentItem.height());return c},_adjustOffsetFromHelper:function(c){if(typeof c== +"string")c=c.split(" ");if(b.isArray(c))c={left:+c[0],top:+c[1]||0};if("left"in c)this.offset.click.left=c.left+this.margins.left;if("right"in c)this.offset.click.left=this.helperProportions.width-c.right+this.margins.left;if("top"in c)this.offset.click.top=c.top+this.margins.top;if("bottom"in c)this.offset.click.top=this.helperProportions.height-c.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var c=this.offsetParent.offset();if(this.cssPosition== +"absolute"&&this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0])){c.left+=this.scrollParent.scrollLeft();c.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&b.browser.msie)c={top:0,left:0};return{top:c.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:c.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition== +"relative"){var c=this.currentItem.position();return{top:c.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:c.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}}, +_setContainment:function(){var c=this.options;if(c.containment=="parent")c.containment=this.helper[0].parentNode;if(c.containment=="document"||c.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,b(c.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(b(c.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height- +this.margins.top];if(!/^(document|window|parent)$/.test(c.containment)){var f=b(c.containment)[0];c=b(c.containment).offset();var g=b(f).css("overflow")!="hidden";this.containment=[c.left+(parseInt(b(f).css("borderLeftWidth"),10)||0)+(parseInt(b(f).css("paddingLeft"),10)||0)-this.margins.left,c.top+(parseInt(b(f).css("borderTopWidth"),10)||0)+(parseInt(b(f).css("paddingTop"),10)||0)-this.margins.top,c.left+(g?Math.max(f.scrollWidth,f.offsetWidth):f.offsetWidth)-(parseInt(b(f).css("borderLeftWidth"), +10)||0)-(parseInt(b(f).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,c.top+(g?Math.max(f.scrollHeight,f.offsetHeight):f.offsetHeight)-(parseInt(b(f).css("borderTopWidth"),10)||0)-(parseInt(b(f).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(c,f){if(!f)f=this.position;c=c=="absolute"?1:-1;var g=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0]))? +this.offsetParent:this.scrollParent,e=/(html|body)/i.test(g[0].tagName);return{top:f.top+this.offset.relative.top*c+this.offset.parent.top*c-(b.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:g.scrollTop())*c),left:f.left+this.offset.relative.left*c+this.offset.parent.left*c-(b.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:g.scrollLeft())*c)}},_generatePosition:function(c){var f= +this.options,g=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(g[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();var a=c.pageX,d=c.pageY;if(this.originalPosition){if(this.containment){if(c.pageX-this.offset.click.left<this.containment[0])a=this.containment[0]+ +this.offset.click.left;if(c.pageY-this.offset.click.top<this.containment[1])d=this.containment[1]+this.offset.click.top;if(c.pageX-this.offset.click.left>this.containment[2])a=this.containment[2]+this.offset.click.left;if(c.pageY-this.offset.click.top>this.containment[3])d=this.containment[3]+this.offset.click.top}if(f.grid){d=this.originalPageY+Math.round((d-this.originalPageY)/f.grid[1])*f.grid[1];d=this.containment?!(d-this.offset.click.top<this.containment[1]||d-this.offset.click.top>this.containment[3])? +d:!(d-this.offset.click.top<this.containment[1])?d-f.grid[1]:d+f.grid[1]:d;a=this.originalPageX+Math.round((a-this.originalPageX)/f.grid[0])*f.grid[0];a=this.containment?!(a-this.offset.click.left<this.containment[0]||a-this.offset.click.left>this.containment[2])?a:!(a-this.offset.click.left<this.containment[0])?a-f.grid[0]:a+f.grid[0]:a}}return{top:d-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(b.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop(): +e?0:g.scrollTop()),left:a-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(b.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:g.scrollLeft())}},_rearrange:function(c,f,g,e){g?g[0].appendChild(this.placeholder[0]):f.item[0].parentNode.insertBefore(this.placeholder[0],this.direction=="down"?f.item[0]:f.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var a=this,d=this.counter;window.setTimeout(function(){d== +a.counter&&a.refreshPositions(!e)},0)},_clear:function(c,f){this.reverting=false;var g=[];!this._noFinalSort&&this.currentItem[0].parentNode&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]="";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!f&&g.push(function(a){this._trigger("receive", +a,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!f)g.push(function(a){this._trigger("update",a,this._uiHash())});if(!b.ui.contains(this.element[0],this.currentItem[0])){f||g.push(function(a){this._trigger("remove",a,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(b.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!f){g.push(function(a){return function(d){a._trigger("receive", +d,this._uiHash(this))}}.call(this,this.containers[e]));g.push(function(a){return function(d){a._trigger("update",d,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){f||g.push(function(a){return function(d){a._trigger("deactivate",d,this._uiHash(this))}}.call(this,this.containers[e]));if(this.containers[e].containerCache.over){g.push(function(a){return function(d){a._trigger("out",d,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over= +0}}this._storedCursor&&b("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!f){this._trigger("beforeStop",c,this._uiHash());for(e=0;e<g.length;e++)g[e].call(this,c);this._trigger("stop",c,this._uiHash())}return false}f||this._trigger("beforeStop",c,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]); +this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!f){for(e=0;e<g.length;e++)g[e].call(this,c);this._trigger("stop",c,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){b.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},_uiHash:function(c){var f=c||this;return{helper:f.helper,placeholder:f.placeholder||b([]),position:f.position,originalPosition:f.originalPosition,offset:f.positionAbs,item:f.currentItem,sender:c?c.element:null}}}); +b.extend(b.ui.sortable,{version:"1.8.7"})})(jQuery); +jQuery.effects||function(b,c){function f(l){var k;if(l&&l.constructor==Array&&l.length==3)return l;if(k=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(l))return[parseInt(k[1],10),parseInt(k[2],10),parseInt(k[3],10)];if(k=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(l))return[parseFloat(k[1])*2.55,parseFloat(k[2])*2.55,parseFloat(k[3])*2.55];if(k=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(l))return[parseInt(k[1],16), +parseInt(k[2],16),parseInt(k[3],16)];if(k=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(l))return[parseInt(k[1]+k[1],16),parseInt(k[2]+k[2],16),parseInt(k[3]+k[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(l))return j.transparent;return j[b.trim(l).toLowerCase()]}function g(l,k){var m;do{m=b.curCSS(l,k);if(m!=""&&m!="transparent"||b.nodeName(l,"body"))break;k="backgroundColor"}while(l=l.parentNode);return f(m)}function e(){var l=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, +k={},m,o;if(l&&l.length&&l[0]&&l[l[0]])for(var p=l.length;p--;){m=l[p];if(typeof l[m]=="string"){o=m.replace(/\-(\w)/g,function(s,r){return r.toUpperCase()});k[o]=l[m]}}else for(m in l)if(typeof l[m]==="string")k[m]=l[m];return k}function a(l){var k,m;for(k in l){m=l[k];if(m==null||b.isFunction(m)||k in q||/scrollbar/.test(k)||!/color/i.test(k)&&isNaN(parseFloat(m)))delete l[k]}return l}function d(l,k){var m={_:0},o;for(o in k)if(l[o]!=k[o])m[o]=k[o];return m}function h(l,k,m,o){if(typeof l=="object"){o= +k;m=null;k=l;l=k.effect}if(b.isFunction(k)){o=k;m=null;k={}}if(typeof k=="number"||b.fx.speeds[k]){o=m;m=k;k={}}if(b.isFunction(m)){o=m;m=null}k=k||{};m=m||k.duration;m=b.fx.off?0:typeof m=="number"?m:m in b.fx.speeds?b.fx.speeds[m]:b.fx.speeds._default;o=o||k.complete;return[l,k,m,o]}function i(l){if(!l||typeof l==="number"||b.fx.speeds[l])return true;if(typeof l==="string"&&!b.effects[l])return true;return false}b.effects={};b.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", +"borderTopColor","borderColor","color","outlineColor"],function(l,k){b.fx.step[k]=function(m){if(!m.colorInit){m.start=g(m.elem,k);m.end=f(m.end);m.colorInit=true}m.elem.style[k]="rgb("+Math.max(Math.min(parseInt(m.pos*(m.end[0]-m.start[0])+m.start[0],10),255),0)+","+Math.max(Math.min(parseInt(m.pos*(m.end[1]-m.start[1])+m.start[1],10),255),0)+","+Math.max(Math.min(parseInt(m.pos*(m.end[2]-m.start[2])+m.start[2],10),255),0)+")"}});var j={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, +0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, +211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},n=["add","remove","toggle"],q={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};b.effects.animateClass=function(l,k,m, +o){if(b.isFunction(m)){o=m;m=null}return this.each(function(){b.queue(this,"fx",function(){var p=b(this),s=p.attr("style")||" ",r=a(e.call(this)),u,v=p.attr("className");b.each(n,function(w,y){l[y]&&p[y+"Class"](l[y])});u=a(e.call(this));p.attr("className",v);p.animate(d(r,u),k,m,function(){b.each(n,function(w,y){l[y]&&p[y+"Class"](l[y])});if(typeof p.attr("style")=="object"){p.attr("style").cssText="";p.attr("style").cssText=s}else p.attr("style",s);o&&o.apply(this,arguments)});r=b.queue(this);u= +r.splice(r.length-1,1)[0];r.splice(1,0,u);b.dequeue(this)})})};b.fn.extend({_addClass:b.fn.addClass,addClass:function(l,k,m,o){return k?b.effects.animateClass.apply(this,[{add:l},k,m,o]):this._addClass(l)},_removeClass:b.fn.removeClass,removeClass:function(l,k,m,o){return k?b.effects.animateClass.apply(this,[{remove:l},k,m,o]):this._removeClass(l)},_toggleClass:b.fn.toggleClass,toggleClass:function(l,k,m,o,p){return typeof k=="boolean"||k===c?m?b.effects.animateClass.apply(this,[k?{add:l}:{remove:l}, +m,o,p]):this._toggleClass(l,k):b.effects.animateClass.apply(this,[{toggle:l},k,m,o])},switchClass:function(l,k,m,o,p){return b.effects.animateClass.apply(this,[{add:k,remove:l},m,o,p])}});b.extend(b.effects,{version:"1.8.7",save:function(l,k){for(var m=0;m<k.length;m++)k[m]!==null&&l.data("ec.storage."+k[m],l[0].style[k[m]])},restore:function(l,k){for(var m=0;m<k.length;m++)k[m]!==null&&l.css(k[m],l.data("ec.storage."+k[m]))},setMode:function(l,k){if(k=="toggle")k=l.is(":hidden")?"show":"hide"; +return k},getBaseline:function(l,k){var m;switch(l[0]){case "top":m=0;break;case "middle":m=0.5;break;case "bottom":m=1;break;default:m=l[0]/k.height}switch(l[1]){case "left":l=0;break;case "center":l=0.5;break;case "right":l=1;break;default:l=l[1]/k.width}return{x:l,y:m}},createWrapper:function(l){if(l.parent().is(".ui-effects-wrapper"))return l.parent();var k={width:l.outerWidth(true),height:l.outerHeight(true),"float":l.css("float")},m=b("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%", +background:"transparent",border:"none",margin:0,padding:0});l.wrap(m);m=l.parent();if(l.css("position")=="static"){m.css({position:"relative"});l.css({position:"relative"})}else{b.extend(k,{position:l.css("position"),zIndex:l.css("z-index")});b.each(["top","left","bottom","right"],function(o,p){k[p]=l.css(p);if(isNaN(parseInt(k[p],10)))k[p]="auto"});l.css({position:"relative",top:0,left:0})}return m.css(k).show()},removeWrapper:function(l){if(l.parent().is(".ui-effects-wrapper"))return l.parent().replaceWith(l); +return l},setTransition:function(l,k,m,o){o=o||{};b.each(k,function(p,s){unit=l.cssUnit(s);if(unit[0]>0)o[s]=unit[0]*m+unit[1]});return o}});b.fn.extend({effect:function(l){var k=h.apply(this,arguments),m={options:k[1],duration:k[2],callback:k[3]};k=m.options.mode;var o=b.effects[l];if(b.fx.off||!o)return k?this[k](m.duration,m.callback):this.each(function(){m.callback&&m.callback.call(this)});return o.call(this,m)},_show:b.fn.show,show:function(l){if(i(l))return this._show.apply(this,arguments); +else{var k=h.apply(this,arguments);k[1].mode="show";return this.effect.apply(this,k)}},_hide:b.fn.hide,hide:function(l){if(i(l))return this._hide.apply(this,arguments);else{var k=h.apply(this,arguments);k[1].mode="hide";return this.effect.apply(this,k)}},__toggle:b.fn.toggle,toggle:function(l){if(i(l)||typeof l==="boolean"||b.isFunction(l))return this.__toggle.apply(this,arguments);else{var k=h.apply(this,arguments);k[1].mode="toggle";return this.effect.apply(this,k)}},cssUnit:function(l){var k=this.css(l), +m=[];b.each(["em","px","%","pt"],function(o,p){if(k.indexOf(p)>0)m=[parseFloat(k),p]});return m}});b.easing.jswing=b.easing.swing;b.extend(b.easing,{def:"easeOutQuad",swing:function(l,k,m,o,p){return b.easing[b.easing.def](l,k,m,o,p)},easeInQuad:function(l,k,m,o,p){return o*(k/=p)*k+m},easeOutQuad:function(l,k,m,o,p){return-o*(k/=p)*(k-2)+m},easeInOutQuad:function(l,k,m,o,p){if((k/=p/2)<1)return o/2*k*k+m;return-o/2*(--k*(k-2)-1)+m},easeInCubic:function(l,k,m,o,p){return o*(k/=p)*k*k+m},easeOutCubic:function(l, +k,m,o,p){return o*((k=k/p-1)*k*k+1)+m},easeInOutCubic:function(l,k,m,o,p){if((k/=p/2)<1)return o/2*k*k*k+m;return o/2*((k-=2)*k*k+2)+m},easeInQuart:function(l,k,m,o,p){return o*(k/=p)*k*k*k+m},easeOutQuart:function(l,k,m,o,p){return-o*((k=k/p-1)*k*k*k-1)+m},easeInOutQuart:function(l,k,m,o,p){if((k/=p/2)<1)return o/2*k*k*k*k+m;return-o/2*((k-=2)*k*k*k-2)+m},easeInQuint:function(l,k,m,o,p){return o*(k/=p)*k*k*k*k+m},easeOutQuint:function(l,k,m,o,p){return o*((k=k/p-1)*k*k*k*k+1)+m},easeInOutQuint:function(l, +k,m,o,p){if((k/=p/2)<1)return o/2*k*k*k*k*k+m;return o/2*((k-=2)*k*k*k*k+2)+m},easeInSine:function(l,k,m,o,p){return-o*Math.cos(k/p*(Math.PI/2))+o+m},easeOutSine:function(l,k,m,o,p){return o*Math.sin(k/p*(Math.PI/2))+m},easeInOutSine:function(l,k,m,o,p){return-o/2*(Math.cos(Math.PI*k/p)-1)+m},easeInExpo:function(l,k,m,o,p){return k==0?m:o*Math.pow(2,10*(k/p-1))+m},easeOutExpo:function(l,k,m,o,p){return k==p?m+o:o*(-Math.pow(2,-10*k/p)+1)+m},easeInOutExpo:function(l,k,m,o,p){if(k==0)return m;if(k== +p)return m+o;if((k/=p/2)<1)return o/2*Math.pow(2,10*(k-1))+m;return o/2*(-Math.pow(2,-10*--k)+2)+m},easeInCirc:function(l,k,m,o,p){return-o*(Math.sqrt(1-(k/=p)*k)-1)+m},easeOutCirc:function(l,k,m,o,p){return o*Math.sqrt(1-(k=k/p-1)*k)+m},easeInOutCirc:function(l,k,m,o,p){if((k/=p/2)<1)return-o/2*(Math.sqrt(1-k*k)-1)+m;return o/2*(Math.sqrt(1-(k-=2)*k)+1)+m},easeInElastic:function(l,k,m,o,p){l=1.70158;var s=0,r=o;if(k==0)return m;if((k/=p)==1)return m+o;s||(s=p*0.3);if(r<Math.abs(o)){r=o;l=s/4}else l= +s/(2*Math.PI)*Math.asin(o/r);return-(r*Math.pow(2,10*(k-=1))*Math.sin((k*p-l)*2*Math.PI/s))+m},easeOutElastic:function(l,k,m,o,p){l=1.70158;var s=0,r=o;if(k==0)return m;if((k/=p)==1)return m+o;s||(s=p*0.3);if(r<Math.abs(o)){r=o;l=s/4}else l=s/(2*Math.PI)*Math.asin(o/r);return r*Math.pow(2,-10*k)*Math.sin((k*p-l)*2*Math.PI/s)+o+m},easeInOutElastic:function(l,k,m,o,p){l=1.70158;var s=0,r=o;if(k==0)return m;if((k/=p/2)==2)return m+o;s||(s=p*0.3*1.5);if(r<Math.abs(o)){r=o;l=s/4}else l=s/(2*Math.PI)*Math.asin(o/ +r);if(k<1)return-0.5*r*Math.pow(2,10*(k-=1))*Math.sin((k*p-l)*2*Math.PI/s)+m;return r*Math.pow(2,-10*(k-=1))*Math.sin((k*p-l)*2*Math.PI/s)*0.5+o+m},easeInBack:function(l,k,m,o,p,s){if(s==c)s=1.70158;return o*(k/=p)*k*((s+1)*k-s)+m},easeOutBack:function(l,k,m,o,p,s){if(s==c)s=1.70158;return o*((k=k/p-1)*k*((s+1)*k+s)+1)+m},easeInOutBack:function(l,k,m,o,p,s){if(s==c)s=1.70158;if((k/=p/2)<1)return o/2*k*k*(((s*=1.525)+1)*k-s)+m;return o/2*((k-=2)*k*(((s*=1.525)+1)*k+s)+2)+m},easeInBounce:function(l, +k,m,o,p){return o-b.easing.easeOutBounce(l,p-k,0,o,p)+m},easeOutBounce:function(l,k,m,o,p){return(k/=p)<1/2.75?o*7.5625*k*k+m:k<2/2.75?o*(7.5625*(k-=1.5/2.75)*k+0.75)+m:k<2.5/2.75?o*(7.5625*(k-=2.25/2.75)*k+0.9375)+m:o*(7.5625*(k-=2.625/2.75)*k+0.984375)+m},easeInOutBounce:function(l,k,m,o,p){if(k<p/2)return b.easing.easeInBounce(l,k*2,0,o,p)*0.5+m;return b.easing.easeOutBounce(l,k*2-p,0,o,p)*0.5+o*0.5+m}})}(jQuery); +(function(b){b.effects.blind=function(c){return this.queue(function(){var f=b(this),g=["position","top","left"],e=b.effects.setMode(f,c.options.mode||"hide"),a=c.options.direction||"vertical";b.effects.save(f,g);f.show();var d=b.effects.createWrapper(f).css({overflow:"hidden"}),h=a=="vertical"?"height":"width";a=a=="vertical"?d.height():d.width();e=="show"&&d.css(h,0);var i={};i[h]=e=="show"?a:0;d.animate(i,c.duration,c.options.easing,function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f); +c.callback&&c.callback.apply(f[0],arguments);f.dequeue()})})}})(jQuery); +(function(b){b.effects.bounce=function(c){return this.queue(function(){var f=b(this),g=["position","top","left"],e=b.effects.setMode(f,c.options.mode||"effect"),a=c.options.direction||"up",d=c.options.distance||20,h=c.options.times||5,i=c.duration||250;/show|hide/.test(e)&&g.push("opacity");b.effects.save(f,g);f.show();b.effects.createWrapper(f);var j=a=="up"||a=="down"?"top":"left";a=a=="up"||a=="left"?"pos":"neg";d=c.options.distance||(j=="top"?f.outerHeight({margin:true})/3:f.outerWidth({margin:true})/ +3);if(e=="show")f.css("opacity",0).css(j,a=="pos"?-d:d);if(e=="hide")d/=h*2;e!="hide"&&h--;if(e=="show"){var n={opacity:1};n[j]=(a=="pos"?"+=":"-=")+d;f.animate(n,i/2,c.options.easing);d/=2;h--}for(n=0;n<h;n++){var q={},l={};q[j]=(a=="pos"?"-=":"+=")+d;l[j]=(a=="pos"?"+=":"-=")+d;f.animate(q,i/2,c.options.easing).animate(l,i/2,c.options.easing);d=e=="hide"?d*2:d/2}if(e=="hide"){n={opacity:0};n[j]=(a=="pos"?"-=":"+=")+d;f.animate(n,i/2,c.options.easing,function(){f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f); +c.callback&&c.callback.apply(this,arguments)})}else{q={};l={};q[j]=(a=="pos"?"-=":"+=")+d;l[j]=(a=="pos"?"+=":"-=")+d;f.animate(q,i/2,c.options.easing).animate(l,i/2,c.options.easing,function(){b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(this,arguments)})}f.queue("fx",function(){f.dequeue()});f.dequeue()})}})(jQuery); +(function(b){b.effects.clip=function(c){return this.queue(function(){var f=b(this),g=["position","top","left","height","width"],e=b.effects.setMode(f,c.options.mode||"hide"),a=c.options.direction||"vertical";b.effects.save(f,g);f.show();var d=b.effects.createWrapper(f).css({overflow:"hidden"});d=f[0].tagName=="IMG"?d:f;var h={size:a=="vertical"?"height":"width",position:a=="vertical"?"top":"left"};a=a=="vertical"?d.height():d.width();if(e=="show"){d.css(h.size,0);d.css(h.position,a/2)}var i={};i[h.size]= +e=="show"?a:0;i[h.position]=e=="show"?0:a/2;d.animate(i,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(f[0],arguments);f.dequeue()}})})}})(jQuery); +(function(b){b.effects.drop=function(c){return this.queue(function(){var f=b(this),g=["position","top","left","opacity"],e=b.effects.setMode(f,c.options.mode||"hide"),a=c.options.direction||"left";b.effects.save(f,g);f.show();b.effects.createWrapper(f);var d=a=="up"||a=="down"?"top":"left";a=a=="up"||a=="left"?"pos":"neg";var h=c.options.distance||(d=="top"?f.outerHeight({margin:true})/2:f.outerWidth({margin:true})/2);if(e=="show")f.css("opacity",0).css(d,a=="pos"?-h:h);var i={opacity:e=="show"?1: +0};i[d]=(e=="show"?a=="pos"?"+=":"-=":a=="pos"?"-=":"+=")+h;f.animate(i,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery); +(function(b){b.effects.explode=function(c){return this.queue(function(){var f=c.options.pieces?Math.round(Math.sqrt(c.options.pieces)):3,g=c.options.pieces?Math.round(Math.sqrt(c.options.pieces)):3;c.options.mode=c.options.mode=="toggle"?b(this).is(":visible")?"hide":"show":c.options.mode;var e=b(this).show().css("visibility","hidden"),a=e.offset();a.top-=parseInt(e.css("marginTop"),10)||0;a.left-=parseInt(e.css("marginLeft"),10)||0;for(var d=e.outerWidth(true),h=e.outerHeight(true),i=0;i<f;i++)for(var j= +0;j<g;j++)e.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-j*(d/g),top:-i*(h/f)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:d/g,height:h/f,left:a.left+j*(d/g)+(c.options.mode=="show"?(j-Math.floor(g/2))*(d/g):0),top:a.top+i*(h/f)+(c.options.mode=="show"?(i-Math.floor(f/2))*(h/f):0),opacity:c.options.mode=="show"?0:1}).animate({left:a.left+j*(d/g)+(c.options.mode=="show"?0:(j-Math.floor(g/2))*(d/g)),top:a.top+ +i*(h/f)+(c.options.mode=="show"?0:(i-Math.floor(f/2))*(h/f)),opacity:c.options.mode=="show"?1:0},c.duration||500);setTimeout(function(){c.options.mode=="show"?e.css({visibility:"visible"}):e.css({visibility:"visible"}).hide();c.callback&&c.callback.apply(e[0]);e.dequeue();b("div.ui-effects-explode").remove()},c.duration||500)})}})(jQuery); +(function(b){b.effects.fade=function(c){return this.queue(function(){var f=b(this),g=b.effects.setMode(f,c.options.mode||"hide");f.animate({opacity:g},{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){c.callback&&c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery); +(function(b){b.effects.fold=function(c){return this.queue(function(){var f=b(this),g=["position","top","left"],e=b.effects.setMode(f,c.options.mode||"hide"),a=c.options.size||15,d=!!c.options.horizFirst,h=c.duration?c.duration/2:b.fx.speeds._default/2;b.effects.save(f,g);f.show();var i=b.effects.createWrapper(f).css({overflow:"hidden"}),j=e=="show"!=d,n=j?["width","height"]:["height","width"];j=j?[i.width(),i.height()]:[i.height(),i.width()];var q=/([0-9]+)%/.exec(a);if(q)a=parseInt(q[1],10)/100* +j[e=="hide"?0:1];if(e=="show")i.css(d?{height:0,width:a}:{height:a,width:0});d={};q={};d[n[0]]=e=="show"?j[0]:a;q[n[1]]=e=="show"?j[1]:0;i.animate(d,h,c.options.easing).animate(q,h,c.options.easing,function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(f[0],arguments);f.dequeue()})})}})(jQuery); +(function(b){b.effects.highlight=function(c){return this.queue(function(){var f=b(this),g=["backgroundImage","backgroundColor","opacity"],e=b.effects.setMode(f,c.options.mode||"show"),a={backgroundColor:f.css("backgroundColor")};if(e=="hide")a.opacity=0;b.effects.save(f,g);f.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(a,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){e=="hide"&&f.hide();b.effects.restore(f,g);e=="show"&&!b.support.opacity&& +this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery); +(function(b){b.effects.pulsate=function(c){return this.queue(function(){var f=b(this),g=b.effects.setMode(f,c.options.mode||"show");times=(c.options.times||5)*2-1;duration=c.duration?c.duration/2:b.fx.speeds._default/2;isVisible=f.is(":visible");animateTo=0;if(!isVisible){f.css("opacity",0).show();animateTo=1}if(g=="hide"&&isVisible||g=="show"&&!isVisible)times--;for(g=0;g<times;g++){f.animate({opacity:animateTo},duration,c.options.easing);animateTo=(animateTo+1)%2}f.animate({opacity:animateTo},duration, +c.options.easing,function(){animateTo==0&&f.hide();c.callback&&c.callback.apply(this,arguments)});f.queue("fx",function(){f.dequeue()}).dequeue()})}})(jQuery); +(function(b){b.effects.puff=function(c){return this.queue(function(){var f=b(this),g=b.effects.setMode(f,c.options.mode||"hide"),e=parseInt(c.options.percent,10)||150,a=e/100,d={height:f.height(),width:f.width()};b.extend(c.options,{fade:true,mode:g,percent:g=="hide"?e:100,from:g=="hide"?d:{height:d.height*a,width:d.width*a}});f.effect("scale",c.options,c.duration,c.callback);f.dequeue()})};b.effects.scale=function(c){return this.queue(function(){var f=b(this),g=b.extend(true,{},c.options),e=b.effects.setMode(f, +c.options.mode||"effect"),a=parseInt(c.options.percent,10)||(parseInt(c.options.percent,10)==0?0:e=="hide"?0:100),d=c.options.direction||"both",h=c.options.origin;if(e!="effect"){g.origin=h||["middle","center"];g.restore=true}h={height:f.height(),width:f.width()};f.from=c.options.from||(e=="show"?{height:0,width:0}:h);a={y:d!="horizontal"?a/100:1,x:d!="vertical"?a/100:1};f.to={height:h.height*a.y,width:h.width*a.x};if(c.options.fade){if(e=="show"){f.from.opacity=0;f.to.opacity=1}if(e=="hide"){f.from.opacity= +1;f.to.opacity=0}}g.from=f.from;g.to=f.to;g.mode=e;f.effect("size",g,c.duration,c.callback);f.dequeue()})};b.effects.size=function(c){return this.queue(function(){var f=b(this),g=["position","top","left","width","height","overflow","opacity"],e=["position","top","left","overflow","opacity"],a=["width","height","overflow"],d=["fontSize"],h=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],i=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],j=b.effects.setMode(f, +c.options.mode||"effect"),n=c.options.restore||false,q=c.options.scale||"both",l=c.options.origin,k={height:f.height(),width:f.width()};f.from=c.options.from||k;f.to=c.options.to||k;if(l){l=b.effects.getBaseline(l,k);f.from.top=(k.height-f.from.height)*l.y;f.from.left=(k.width-f.from.width)*l.x;f.to.top=(k.height-f.to.height)*l.y;f.to.left=(k.width-f.to.width)*l.x}var m={from:{y:f.from.height/k.height,x:f.from.width/k.width},to:{y:f.to.height/k.height,x:f.to.width/k.width}};if(q=="box"||q=="both"){if(m.from.y!= +m.to.y){g=g.concat(h);f.from=b.effects.setTransition(f,h,m.from.y,f.from);f.to=b.effects.setTransition(f,h,m.to.y,f.to)}if(m.from.x!=m.to.x){g=g.concat(i);f.from=b.effects.setTransition(f,i,m.from.x,f.from);f.to=b.effects.setTransition(f,i,m.to.x,f.to)}}if(q=="content"||q=="both")if(m.from.y!=m.to.y){g=g.concat(d);f.from=b.effects.setTransition(f,d,m.from.y,f.from);f.to=b.effects.setTransition(f,d,m.to.y,f.to)}b.effects.save(f,n?g:e);f.show();b.effects.createWrapper(f);f.css("overflow","hidden").css(f.from); +if(q=="content"||q=="both"){h=h.concat(["marginTop","marginBottom"]).concat(d);i=i.concat(["marginLeft","marginRight"]);a=g.concat(h).concat(i);f.find("*[width]").each(function(){child=b(this);n&&b.effects.save(child,a);var o={height:child.height(),width:child.width()};child.from={height:o.height*m.from.y,width:o.width*m.from.x};child.to={height:o.height*m.to.y,width:o.width*m.to.x};if(m.from.y!=m.to.y){child.from=b.effects.setTransition(child,h,m.from.y,child.from);child.to=b.effects.setTransition(child, +h,m.to.y,child.to)}if(m.from.x!=m.to.x){child.from=b.effects.setTransition(child,i,m.from.x,child.from);child.to=b.effects.setTransition(child,i,m.to.x,child.to)}child.css(child.from);child.animate(child.to,c.duration,c.options.easing,function(){n&&b.effects.restore(child,a)})})}f.animate(f.to,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){f.to.opacity===0&&f.css("opacity",f.from.opacity);j=="hide"&&f.hide();b.effects.restore(f,n?g:e);b.effects.removeWrapper(f);c.callback&& +c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery); +(function(b){b.effects.shake=function(c){return this.queue(function(){var f=b(this),g=["position","top","left"];b.effects.setMode(f,c.options.mode||"effect");var e=c.options.direction||"left",a=c.options.distance||20,d=c.options.times||3,h=c.duration||c.options.duration||140;b.effects.save(f,g);f.show();b.effects.createWrapper(f);var i=e=="up"||e=="down"?"top":"left",j=e=="up"||e=="left"?"pos":"neg";e={};var n={},q={};e[i]=(j=="pos"?"-=":"+=")+a;n[i]=(j=="pos"?"+=":"-=")+a*2;q[i]=(j=="pos"?"-=":"+=")+ +a*2;f.animate(e,h,c.options.easing);for(a=1;a<d;a++)f.animate(n,h,c.options.easing).animate(q,h,c.options.easing);f.animate(n,h,c.options.easing).animate(e,h/2,c.options.easing,function(){b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(this,arguments)});f.queue("fx",function(){f.dequeue()});f.dequeue()})}})(jQuery); +(function(b){b.effects.slide=function(c){return this.queue(function(){var f=b(this),g=["position","top","left"],e=b.effects.setMode(f,c.options.mode||"show"),a=c.options.direction||"left";b.effects.save(f,g);f.show();b.effects.createWrapper(f).css({overflow:"hidden"});var d=a=="up"||a=="down"?"top":"left";a=a=="up"||a=="left"?"pos":"neg";var h=c.options.distance||(d=="top"?f.outerHeight({margin:true}):f.outerWidth({margin:true}));if(e=="show")f.css(d,a=="pos"?isNaN(h)?"-"+h:-h:h);var i={};i[d]=(e== +"show"?a=="pos"?"+=":"-=":a=="pos"?"-=":"+=")+h;f.animate(i,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery); +(function(b){b.effects.transfer=function(c){return this.queue(function(){var f=b(this),g=b(c.options.to),e=g.offset();g={top:e.top,left:e.left,height:g.innerHeight(),width:g.innerWidth()};e=f.offset();var a=b('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(c.options.className).css({top:e.top,left:e.left,height:f.innerHeight(),width:f.innerWidth(),position:"absolute"}).animate(g,c.duration,c.options.easing,function(){a.remove();c.callback&&c.callback.apply(f[0],arguments); +f.dequeue()})})}})(jQuery); +(function(b){b.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var c=this,f=c.options;c.running=0;c.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");c.headers= +c.element.find(f.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){f.disabled||b(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){f.disabled||b(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){f.disabled||b(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){f.disabled||b(this).removeClass("ui-state-focus")});c.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); +if(f.navigation){var g=c.element.find("a").filter(f.navigationFilter).eq(0);if(g.length){var e=g.closest(".ui-accordion-header");c.active=e.length?e:g.closest(".ui-accordion-content").prev()}}c.active=c._findActive(c.active||f.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");c.active.next().addClass("ui-accordion-content-active");c._createIcons();c.resize();c.element.attr("role","tablist");c.headers.attr("role","tab").bind("keydown.accordion", +function(a){return c._keydown(a)}).next().attr("role","tabpanel");c.headers.not(c.active||"").attr({"aria-expanded":"false",tabIndex:-1}).next().hide();c.active.length?c.active.attr({"aria-expanded":"true",tabIndex:0}):c.headers.eq(0).attr("tabIndex",0);b.browser.safari||c.headers.find("a").attr("tabIndex",-1);f.event&&c.headers.bind(f.event.split(" ").join(".accordion ")+".accordion",function(a){c._clickHandler.call(c,a,this);a.preventDefault()})},_createIcons:function(){var c=this.options;if(c.icons){b("<span></span>").addClass("ui-icon "+ +c.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(c.icons.header).toggleClass(c.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var c=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("tabIndex"); +this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var f=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(c.autoHeight||c.fillHeight)f.css("height","");return b.Widget.prototype.destroy.call(this)},_setOption:function(c,f){b.Widget.prototype._setOption.apply(this,arguments);c=="active"&&this.activate(f);if(c=="icons"){this._destroyIcons(); +f&&this._createIcons()}if(c=="disabled")this.headers.add(this.headers.next())[f?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(c){if(!(this.options.disabled||c.altKey||c.ctrlKey)){var f=b.ui.keyCode,g=this.headers.length,e=this.headers.index(c.target),a=false;switch(c.keyCode){case f.RIGHT:case f.DOWN:a=this.headers[(e+1)%g];break;case f.LEFT:case f.UP:a=this.headers[(e-1+g)%g];break;case f.SPACE:case f.ENTER:this._clickHandler({target:c.target},c.target); +c.preventDefault()}if(a){b(c.target).attr("tabIndex",-1);b(a).attr("tabIndex",0);a.focus();return false}return true}},resize:function(){var c=this.options,f;if(c.fillSpace){if(b.browser.msie){var g=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}f=this.element.parent().height();b.browser.msie&&this.element.parent().css("overflow",g);this.headers.each(function(){f-=b(this).outerHeight(true)});this.headers.next().each(function(){b(this).height(Math.max(0,f-b(this).innerHeight()+ +b(this).height()))}).css("overflow","auto")}else if(c.autoHeight){f=0;this.headers.next().each(function(){f=Math.max(f,b(this).height("").height())}).height(f)}return this},activate:function(c){this.options.active=c;c=this._findActive(c)[0];this._clickHandler({target:c},c);return this},_findActive:function(c){return c?typeof c==="number"?this.headers.filter(":eq("+c+")"):this.headers.not(this.headers.not(c)):c===false?b([]):this.headers.filter(":eq(0)")},_clickHandler:function(c,f){var g=this.options; +if(!g.disabled)if(c.target){c=b(c.currentTarget||f);f=c[0]===this.active[0];g.active=g.collapsible&&f?false:this.headers.index(c);if(!(this.running||!g.collapsible&&f)){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(g.icons.headerSelected).addClass(g.icons.header);if(!f){c.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(g.icons.header).addClass(g.icons.headerSelected); +c.next().addClass("ui-accordion-content-active")}d=c.next();e=this.active.next();a={options:g,newHeader:f&&g.collapsible?b([]):c,oldHeader:this.active,newContent:f&&g.collapsible?b([]):d,oldContent:e};g=this.headers.index(this.active[0])>this.headers.index(c[0]);this.active=f?b([]):c;this._toggle(d,e,a,f,g)}}else if(g.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(g.icons.headerSelected).addClass(g.icons.header); +this.active.next().addClass("ui-accordion-content-active");var e=this.active.next(),a={options:g,newHeader:b([]),oldHeader:g.active,newContent:b([]),oldContent:e},d=this.active=b([]);this._toggle(d,e,a)}},_toggle:function(c,f,g,e,a){var d=this,h=d.options;d.toShow=c;d.toHide=f;d.data=g;var i=function(){if(d)return d._completed.apply(d,arguments)};d._trigger("changestart",null,d.data);d.running=f.size()===0?c.size():f.size();if(h.animated){g={};g=h.collapsible&&e?{toShow:b([]),toHide:f,complete:i, +down:a,autoHeight:h.autoHeight||h.fillSpace}:{toShow:c,toHide:f,complete:i,down:a,autoHeight:h.autoHeight||h.fillSpace};if(!h.proxied)h.proxied=h.animated;if(!h.proxiedDuration)h.proxiedDuration=h.duration;h.animated=b.isFunction(h.proxied)?h.proxied(g):h.proxied;h.duration=b.isFunction(h.proxiedDuration)?h.proxiedDuration(g):h.proxiedDuration;e=b.ui.accordion.animations;var j=h.duration,n=h.animated;if(n&&!e[n]&&!b.easing[n])n="slide";e[n]||(e[n]=function(q){this.slide(q,{easing:n,duration:j||700})}); +e[n](g)}else{if(h.collapsible&&e)c.toggle();else{f.hide();c.show()}i(true)}f.prev().attr({"aria-expanded":"false",tabIndex:-1}).blur();c.prev().attr({"aria-expanded":"true",tabIndex:0}).focus()},_completed:function(c){this.running=c?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");this._trigger("change",null,this.data)}}});b.extend(b.ui.accordion,{version:"1.8.7",animations:{slide:function(c, +f){c=b.extend({easing:"swing",duration:300},c,f);if(c.toHide.size())if(c.toShow.size()){var g=c.toShow.css("overflow"),e=0,a={},d={},h;f=c.toShow;h=f[0].style.width;f.width(parseInt(f.parent().width(),10)-parseInt(f.css("paddingLeft"),10)-parseInt(f.css("paddingRight"),10)-(parseInt(f.css("borderLeftWidth"),10)||0)-(parseInt(f.css("borderRightWidth"),10)||0));b.each(["height","paddingTop","paddingBottom"],function(i,j){d[j]="hide";i=(""+b.css(c.toShow[0],j)).match(/^([\d+-.]+)(.*)$/);a[j]={value:i[1], +unit:i[2]||"px"}});c.toShow.css({height:0,overflow:"hidden"}).show();c.toHide.filter(":hidden").each(c.complete).end().filter(":visible").animate(d,{step:function(i,j){if(j.prop=="height")e=j.end-j.start===0?0:(j.now-j.start)/(j.end-j.start);c.toShow[0].style[j.prop]=e*a[j.prop].value+a[j.prop].unit},duration:c.duration,easing:c.easing,complete:function(){c.autoHeight||c.toShow.css("height","");c.toShow.css({width:h,overflow:g});c.complete()}})}else c.toHide.animate({height:"hide",paddingTop:"hide", +paddingBottom:"hide"},c);else c.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},c)},bounceslide:function(c){this.slide(c,{easing:c.down?"easeOutBounce":"swing",duration:c.down?1E3:200})}}})})(jQuery); +(function(b){b.widget("ui.autocomplete",{options:{appendTo:"body",delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},_create:function(){var c=this,f=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(e){if(!(c.options.disabled||c.element.attr("readonly"))){g=false;var a=b.ui.keyCode;switch(e.keyCode){case a.PAGE_UP:c._move("previousPage", +e);break;case a.PAGE_DOWN:c._move("nextPage",e);break;case a.UP:c._move("previous",e);e.preventDefault();break;case a.DOWN:c._move("next",e);e.preventDefault();break;case a.ENTER:case a.NUMPAD_ENTER:if(c.menu.active){g=true;e.preventDefault()}case a.TAB:if(!c.menu.active)return;c.menu.select(e);break;case a.ESCAPE:c.element.val(c.term);c.close(e);break;default:clearTimeout(c.searching);c.searching=setTimeout(function(){if(c.term!=c.element.val()){c.selectedItem=null;c.search(null,e)}},c.options.delay); +break}}}).bind("keypress.autocomplete",function(e){if(g){g=false;e.preventDefault()}}).bind("focus.autocomplete",function(){if(!c.options.disabled){c.selectedItem=null;c.previous=c.element.val()}}).bind("blur.autocomplete",function(e){if(!c.options.disabled){clearTimeout(c.searching);c.closing=setTimeout(function(){c.close(e);c._change(e)},150)}});this._initSource();this.response=function(){return c._response.apply(c,arguments)};this.menu=b("<ul></ul>").addClass("ui-autocomplete").appendTo(b(this.options.appendTo|| +"body",f)[0]).mousedown(function(e){var a=c.menu.element[0];b(e.target).closest(".ui-menu-item").length||setTimeout(function(){b(document).one("mousedown",function(d){d.target!==c.element[0]&&d.target!==a&&!b.ui.contains(a,d.target)&&c.close()})},1);setTimeout(function(){clearTimeout(c.closing)},13)}).menu({focus:function(e,a){a=a.item.data("item.autocomplete");false!==c._trigger("focus",e,{item:a})&&/^key/.test(e.originalEvent.type)&&c.element.val(a.value)},selected:function(e,a){var d=a.item.data("item.autocomplete"), +h=c.previous;if(c.element[0]!==f.activeElement){c.element.focus();c.previous=h;setTimeout(function(){c.previous=h;c.selectedItem=d},1)}false!==c._trigger("select",e,{item:d})&&c.element.val(d.value);c.term=c.element.val();c.close(e);c.selectedItem=d},blur:function(){c.menu.element.is(":visible")&&c.element.val()!==c.term&&c.element.val(c.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");b.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup"); +this.menu.element.remove();b.Widget.prototype.destroy.call(this)},_setOption:function(c,f){b.Widget.prototype._setOption.apply(this,arguments);c==="source"&&this._initSource();if(c==="appendTo")this.menu.element.appendTo(b(f||"body",this.element[0].ownerDocument)[0])},_initSource:function(){var c=this,f,g;if(b.isArray(this.options.source)){f=this.options.source;this.source=function(e,a){a(b.ui.autocomplete.filter(f,e.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source= +function(e,a){c.xhr&&c.xhr.abort();c.xhr=b.ajax({url:g,data:e,dataType:"json",success:function(d,h,i){i===c.xhr&&a(d);c.xhr=null},error:function(d){d===c.xhr&&a([]);c.xhr=null}})}}else this.source=this.options.source},search:function(c,f){c=c!=null?c:this.element.val();this.term=this.element.val();if(c.length<this.options.minLength)return this.close(f);clearTimeout(this.closing);if(this._trigger("search",f)!==false)return this._search(c)},_search:function(c){this.element.addClass("ui-autocomplete-loading"); +this.source({term:c},this.response)},_response:function(c){if(c&&c.length){c=this._normalize(c);this._suggest(c);this._trigger("open")}else this.close();this.element.removeClass("ui-autocomplete-loading")},close:function(c){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",c)}},_change:function(c){this.previous!==this.element.val()&&this._trigger("change",c,{item:this.selectedItem})},_normalize:function(c){if(c.length&& +c[0].label&&c[0].value)return c;return b.map(c,function(f){if(typeof f==="string")return{label:f,value:f};return b.extend({label:f.label||f.value,value:f.value||f.label},f)})},_suggest:function(c){var f=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(f,c);this.menu.deactivate();this.menu.refresh();f.show();this._resizeMenu();f.position(b.extend({of:this.element},this.options.position))},_resizeMenu:function(){var c=this.menu.element;c.outerWidth(Math.max(c.width("").outerWidth(), +this.element.outerWidth()))},_renderMenu:function(c,f){var g=this;b.each(f,function(e,a){g._renderItem(c,a)})},_renderItem:function(c,f){return b("<li></li>").data("item.autocomplete",f).append(b("<a></a>").text(f.label)).appendTo(c)},_move:function(c,f){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(c)||this.menu.last()&&/^next/.test(c)){this.element.val(this.term);this.menu.deactivate()}else this.menu[c](f);else this.search(null,f)},widget:function(){return this.menu.element}}); +b.extend(b.ui.autocomplete,{escapeRegex:function(c){return c.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(c,f){var g=new RegExp(b.ui.autocomplete.escapeRegex(f),"i");return b.grep(c,function(e){return g.test(e.label||e.value||e)})}})})(jQuery); +(function(b){b.widget("ui.menu",{_create:function(){var c=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(f){if(b(f.target).closest(".ui-menu-item a").length){f.preventDefault();c.select(f)}});this.refresh()},refresh:function(){var c=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", +-1).mouseenter(function(f){c.activate(f,b(this).parent())}).mouseleave(function(){c.deactivate()})},activate:function(c,f){this.deactivate();if(this.hasScroll()){var g=f.offset().top-this.element.offset().top,e=this.element.attr("scrollTop"),a=this.element.height();if(g<0)this.element.attr("scrollTop",e+g);else g>=a&&this.element.attr("scrollTop",e+g-a+f.height())}this.active=f.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",c,{item:f})}, +deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(c){this.move("next",".ui-menu-item:first",c)},previous:function(c){this.move("prev",".ui-menu-item:last",c)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(c,f,g){if(this.active){c=this.active[c+"All"](".ui-menu-item").eq(0); +c.length?this.activate(g,c):this.activate(g,this.element.children(f))}else this.activate(g,this.element.children(f))},nextPage:function(c){if(this.hasScroll())if(!this.active||this.last())this.activate(c,this.element.children(".ui-menu-item:first"));else{var f=this.active.offset().top,g=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var a=b(this).offset().top-f-g+b(this).height();return a<10&&a>-10});e.length||(e=this.element.children(".ui-menu-item:last"));this.activate(c, +e)}else this.activate(c,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(c){if(this.hasScroll())if(!this.active||this.first())this.activate(c,this.element.children(".ui-menu-item:last"));else{var f=this.active.offset().top,g=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var e=b(this).offset().top-f+g-b(this).height();return e<10&&e>-10});result.length||(result=this.element.children(".ui-menu-item:first")); +this.activate(c,result)}else this.activate(c,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(c){this._trigger("selected",c,{item:this.active})}})})(jQuery); +(function(b){var c,f=function(e){b(":ui-button",e.target.form).each(function(){var a=b(this).data("button");setTimeout(function(){a.refresh()},1)})},g=function(e){var a=e.name,d=e.form,h=b([]);if(a)h=d?b(d).find("[name='"+a+"']"):b("[name='"+a+"']",e.ownerDocument).filter(function(){return!this.form});return h};b.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button", +f);if(typeof this.options.disabled!=="boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var e=this,a=this.options,d=this.type==="checkbox"||this.type==="radio",h="ui-state-hover"+(!d?" ui-state-active":"");if(a.label===null)a.label=this.buttonElement.html();if(this.element.is(":disabled"))a.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button", +function(){if(!a.disabled){b(this).addClass("ui-state-hover");this===c&&b(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){a.disabled||b(this).removeClass(h)}).bind("focus.button",function(){b(this).addClass("ui-state-focus")}).bind("blur.button",function(){b(this).removeClass("ui-state-focus")});d&&this.element.bind("change.button",function(){e.refresh()});if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(a.disabled)return false;b(this).toggleClass("ui-state-active"); +e.buttonElement.attr("aria-pressed",e.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(a.disabled)return false;b(this).addClass("ui-state-active");e.buttonElement.attr("aria-pressed",true);var i=e.element[0];g(i).not(i).map(function(){return b(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(a.disabled)return false;b(this).addClass("ui-state-active"); +c=this;b(document).one("mouseup",function(){c=null})}).bind("mouseup.button",function(){if(a.disabled)return false;b(this).removeClass("ui-state-active")}).bind("keydown.button",function(i){if(a.disabled)return false;if(i.keyCode==b.ui.keyCode.SPACE||i.keyCode==b.ui.keyCode.ENTER)b(this).addClass("ui-state-active")}).bind("keyup.button",function(){b(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(i){i.keyCode===b.ui.keyCode.SPACE&&b(this).click()})}this._setOption("disabled", +a.disabled)},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type==="radio"){this.buttonElement=this.element.parents().last().find("label[for="+this.element.attr("id")+"]");this.element.addClass("ui-helper-hidden-accessible");var e=this.element.is(":checked");e&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",e)}else this.buttonElement= +this.element},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());this.hasTitle|| +this.buttonElement.removeAttr("title");b.Widget.prototype.destroy.call(this)},_setOption:function(e,a){b.Widget.prototype._setOption.apply(this,arguments);if(e==="disabled")a?this.element.attr("disabled",true):this.element.removeAttr("disabled");this._resetButton()},refresh:function(){var e=this.element.is(":disabled");e!==this.options.disabled&&this._setOption("disabled",e);if(this.type==="radio")g(this.element[0]).each(function(){b(this).is(":checked")?b(this).button("widget").addClass("ui-state-active").attr("aria-pressed", +true):b(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var e=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"), +a=b("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(e.empty()).text(),d=this.options.icons,h=d.primary&&d.secondary;if(d.primary||d.secondary){e.addClass("ui-button-text-icon"+(h?"s":d.primary?"-primary":"-secondary"));d.primary&&e.prepend("<span class='ui-button-icon-primary ui-icon "+d.primary+"'></span>");d.secondary&&e.append("<span class='ui-button-icon-secondary ui-icon "+d.secondary+"'></span>");if(!this.options.text){e.addClass(h?"ui-button-icons-only":"ui-button-icon-only").removeClass("ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary"); +this.hasTitle||e.attr("title",a)}}else e.addClass("ui-button-text-only")}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(e,a){e==="disabled"&&this.buttons.button("option",e,a);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()}, +destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");b.Widget.prototype.destroy.call(this)}})})(jQuery); +(function(b,c){function f(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass= +"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su", +"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10", +minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};b.extend(this._defaults,this.regional[""]);this.dpDiv=b('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}function g(a,d){b.extend(a,d);for(var h in d)if(d[h]== +null||d[h]==c)a[h]=d[h];return a}b.extend(b.ui,{datepicker:{version:"1.8.7"}});var e=(new Date).getTime();b.extend(f.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){g(this._defaults,a||{});return this},_attachDatepicker:function(a,d){var h=null;for(var i in this._defaults){var j=a.getAttribute("date:"+i);if(j){h=h||{};try{h[i]=eval(j)}catch(n){h[i]=j}}}i=a.nodeName.toLowerCase(); +j=i=="div"||i=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var q=this._newInst(b(a),j);q.settings=b.extend({},d||{},h||{});if(i=="input")this._connectDatepicker(a,q);else j&&this._inlineDatepicker(a,q)},_newInst:function(a,d){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:d,dpDiv:!d?this.dpDiv:b('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}}, +_connectDatepicker:function(a,d){var h=b(a);d.append=b([]);d.trigger=b([]);if(!h.hasClass(this.markerClassName)){this._attachments(h,d);h.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(i,j,n){d.settings[j]=n}).bind("getData.datepicker",function(i,j){return this._get(d,j)});this._autoSize(d);b.data(a,"datepicker",d)}},_attachments:function(a,d){var h=this._get(d,"appendText"),i=this._get(d,"isRTL");d.append&& +d.append.remove();if(h){d.append=b('<span class="'+this._appendClass+'">'+h+"</span>");a[i?"before":"after"](d.append)}a.unbind("focus",this._showDatepicker);d.trigger&&d.trigger.remove();h=this._get(d,"showOn");if(h=="focus"||h=="both")a.focus(this._showDatepicker);if(h=="button"||h=="both"){h=this._get(d,"buttonText");var j=this._get(d,"buttonImage");d.trigger=b(this._get(d,"buttonImageOnly")?b("<img/>").addClass(this._triggerClass).attr({src:j,alt:h,title:h}):b('<button type="button"></button>').addClass(this._triggerClass).html(j== +""?h:b("<img/>").attr({src:j,alt:h,title:h})));a[i?"before":"after"](d.trigger);d.trigger.click(function(){b.datepicker._datepickerShowing&&b.datepicker._lastInput==a[0]?b.datepicker._hideDatepicker():b.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var d=new Date(2009,11,20),h=this._get(a,"dateFormat");if(h.match(/[DM]/)){var i=function(j){for(var n=0,q=0,l=0;l<j.length;l++)if(j[l].length>n){n=j[l].length;q=l}return q};d.setMonth(i(this._get(a, +h.match(/MM/)?"monthNames":"monthNamesShort")));d.setDate(i(this._get(a,h.match(/DD/)?"dayNames":"dayNamesShort"))+20-d.getDay())}a.input.attr("size",this._formatDate(a,d).length)}},_inlineDatepicker:function(a,d){var h=b(a);if(!h.hasClass(this.markerClassName)){h.addClass(this.markerClassName).append(d.dpDiv).bind("setData.datepicker",function(i,j,n){d.settings[j]=n}).bind("getData.datepicker",function(i,j){return this._get(d,j)});b.data(a,"datepicker",d);this._setDate(d,this._getDefaultDate(d), +true);this._updateDatepicker(d);this._updateAlternate(d);d.dpDiv.show()}},_dialogDatepicker:function(a,d,h,i,j){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=b('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);b("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};b.data(this._dialogInput[0],"datepicker",a)}g(a.settings,i||{}); +d=d&&d.constructor==Date?this._formatDate(a,d):d;this._dialogInput.val(d);this._pos=j?j.length?j:[j.pageX,j.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=h;this._inDialog=true;this.dpDiv.addClass(this._dialogClass); +this._showDatepicker(this._dialogInput[0]);b.blockUI&&b.blockUI(this.dpDiv);b.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var d=b(a),h=b.data(a,"datepicker");if(d.hasClass(this.markerClassName)){var i=a.nodeName.toLowerCase();b.removeData(a,"datepicker");if(i=="input"){h.append.remove();h.trigger.remove();d.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup", +this._doKeyUp)}else if(i=="div"||i=="span")d.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var d=b(a),h=b.data(a,"datepicker");if(d.hasClass(this.markerClassName)){var i=a.nodeName.toLowerCase();if(i=="input"){a.disabled=false;h.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(i=="div"||i=="span")d.children("."+this._inlineClass).children().removeClass("ui-state-disabled");this._disabledInputs=b.map(this._disabledInputs, +function(j){return j==a?null:j})}},_disableDatepicker:function(a){var d=b(a),h=b.data(a,"datepicker");if(d.hasClass(this.markerClassName)){var i=a.nodeName.toLowerCase();if(i=="input"){a.disabled=true;h.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(i=="div"||i=="span")d.children("."+this._inlineClass).children().addClass("ui-state-disabled");this._disabledInputs=b.map(this._disabledInputs,function(j){return j==a?null: +j});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var d=0;d<this._disabledInputs.length;d++)if(this._disabledInputs[d]==a)return true;return false},_getInst:function(a){try{return b.data(a,"datepicker")}catch(d){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,d,h){var i=this._getInst(a);if(arguments.length==2&&typeof d=="string")return d=="defaults"?b.extend({},b.datepicker._defaults):i?d=="all"?b.extend({}, +i.settings):this._get(i,d):null;var j=d||{};if(typeof d=="string"){j={};j[d]=h}if(i){this._curInst==i&&this._hideDatepicker();var n=this._getDateDatepicker(a,true);g(i.settings,j);this._attachments(b(a),i);this._autoSize(i);this._setDateDatepicker(a,n);this._updateDatepicker(i)}},_changeDatepicker:function(a,d,h){this._optionDatepicker(a,d,h)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,d){if(a=this._getInst(a)){this._setDate(a,d); +this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,d){(a=this._getInst(a))&&!a.inline&&this._setDateFromField(a,d);return a?this._getDate(a):null},_doKeyDown:function(a){var d=b.datepicker._getInst(a.target),h=true,i=d.dpDiv.is(".ui-datepicker-rtl");d._keyEvent=true;if(b.datepicker._datepickerShowing)switch(a.keyCode){case 9:b.datepicker._hideDatepicker();h=false;break;case 13:h=b("td."+b.datepicker._dayOverClass+":not(."+b.datepicker._currentClass+")",d.dpDiv);h[0]? +b.datepicker._selectDay(a.target,d.selectedMonth,d.selectedYear,h[0]):b.datepicker._hideDatepicker();return false;case 27:b.datepicker._hideDatepicker();break;case 33:b.datepicker._adjustDate(a.target,a.ctrlKey?-b.datepicker._get(d,"stepBigMonths"):-b.datepicker._get(d,"stepMonths"),"M");break;case 34:b.datepicker._adjustDate(a.target,a.ctrlKey?+b.datepicker._get(d,"stepBigMonths"):+b.datepicker._get(d,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)b.datepicker._clearDate(a.target);h=a.ctrlKey|| +a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)b.datepicker._gotoToday(a.target);h=a.ctrlKey||a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)b.datepicker._adjustDate(a.target,i?+1:-1,"D");h=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)b.datepicker._adjustDate(a.target,a.ctrlKey?-b.datepicker._get(d,"stepBigMonths"):-b.datepicker._get(d,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)b.datepicker._adjustDate(a.target,-7,"D");h=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey||a.metaKey)b.datepicker._adjustDate(a.target, +i?-1:+1,"D");h=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)b.datepicker._adjustDate(a.target,a.ctrlKey?+b.datepicker._get(d,"stepBigMonths"):+b.datepicker._get(d,"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)b.datepicker._adjustDate(a.target,+7,"D");h=a.ctrlKey||a.metaKey;break;default:h=false}else if(a.keyCode==36&&a.ctrlKey)b.datepicker._showDatepicker(this);else h=false;if(h){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var d=b.datepicker._getInst(a.target);if(b.datepicker._get(d, +"constrainInput")){d=b.datepicker._possibleChars(b.datepicker._get(d,"dateFormat"));var h=String.fromCharCode(a.charCode==c?a.keyCode:a.charCode);return a.ctrlKey||a.metaKey||h<" "||!d||d.indexOf(h)>-1}},_doKeyUp:function(a){a=b.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(b.datepicker.parseDate(b.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,b.datepicker._getFormatConfig(a))){b.datepicker._setDateFromField(a);b.datepicker._updateAlternate(a);b.datepicker._updateDatepicker(a)}}catch(d){b.datepicker.log(d)}return true}, +_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=b("input",a.parentNode)[0];if(!(b.datepicker._isDisabledDatepicker(a)||b.datepicker._lastInput==a)){var d=b.datepicker._getInst(a);b.datepicker._curInst&&b.datepicker._curInst!=d&&b.datepicker._curInst.dpDiv.stop(true,true);var h=b.datepicker._get(d,"beforeShow");g(d.settings,h?h.apply(a,[a,d]):{});d.lastVal=null;b.datepicker._lastInput=a;b.datepicker._setDateFromField(d);if(b.datepicker._inDialog)a.value="";if(!b.datepicker._pos){b.datepicker._pos= +b.datepicker._findPos(a);b.datepicker._pos[1]+=a.offsetHeight}var i=false;b(a).parents().each(function(){i|=b(this).css("position")=="fixed";return!i});if(i&&b.browser.opera){b.datepicker._pos[0]-=document.documentElement.scrollLeft;b.datepicker._pos[1]-=document.documentElement.scrollTop}h={left:b.datepicker._pos[0],top:b.datepicker._pos[1]};b.datepicker._pos=null;d.dpDiv.empty();d.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});b.datepicker._updateDatepicker(d);h=b.datepicker._checkOffset(d, +h,i);d.dpDiv.css({position:b.datepicker._inDialog&&b.blockUI?"static":i?"fixed":"absolute",display:"none",left:h.left+"px",top:h.top+"px"});if(!d.inline){h=b.datepicker._get(d,"showAnim");var j=b.datepicker._get(d,"duration"),n=function(){b.datepicker._datepickerShowing=true;var q=d.dpDiv.find("iframe.ui-datepicker-cover");if(q.length){var l=b.datepicker._getBorders(d.dpDiv);q.css({left:-l[0],top:-l[1],width:d.dpDiv.outerWidth(),height:d.dpDiv.outerHeight()})}};d.dpDiv.zIndex(b(a).zIndex()+1);b.effects&& +b.effects[h]?d.dpDiv.show(h,b.datepicker._get(d,"showOptions"),j,n):d.dpDiv[h||"show"](h?j:null,n);if(!h||!j)n();d.input.is(":visible")&&!d.input.is(":disabled")&&d.input.focus();b.datepicker._curInst=d}}},_updateDatepicker:function(a){var d=this,h=b.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a));var i=a.dpDiv.find("iframe.ui-datepicker-cover");i.length&&i.css({left:-h[0],top:-h[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout", +function(){b(this).removeClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&b(this).removeClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&b(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!d._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){b(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");b(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!= +-1&&b(this).addClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&b(this).addClass("ui-datepicker-next-hover")}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();h=this._getNumberOfMonths(a);i=h[1];i>1?a.dpDiv.addClass("ui-datepicker-multi-"+i).css("width",17*i+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(h[0]!=1||h[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a, +"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==b.datepicker._curInst&&b.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input.focus();if(a.yearshtml){var j=a.yearshtml;setTimeout(function(){j===a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);j=a.yearshtml=null},0)}},_getBorders:function(a){var d=function(h){return{thin:1,medium:2,thick:3}[h]||h};return[parseFloat(d(a.css("border-left-width"))),parseFloat(d(a.css("border-top-width")))]}, +_checkOffset:function(a,d,h){var i=a.dpDiv.outerWidth(),j=a.dpDiv.outerHeight(),n=a.input?a.input.outerWidth():0,q=a.input?a.input.outerHeight():0,l=document.documentElement.clientWidth+b(document).scrollLeft(),k=document.documentElement.clientHeight+b(document).scrollTop();d.left-=this._get(a,"isRTL")?i-n:0;d.left-=h&&d.left==a.input.offset().left?b(document).scrollLeft():0;d.top-=h&&d.top==a.input.offset().top+q?b(document).scrollTop():0;d.left-=Math.min(d.left,d.left+i>l&&l>i?Math.abs(d.left+i- +l):0);d.top-=Math.min(d.top,d.top+j>k&&k>j?Math.abs(j+q):0);return d},_findPos:function(a){for(var d=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1);)a=a[d?"previousSibling":"nextSibling"];a=b(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var d=this._curInst;if(!(!d||a&&d!=b.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(d,"showAnim");var h=this._get(d,"duration"),i=function(){b.datepicker._tidyDialog(d);this._curInst=null};b.effects&&b.effects[a]? +d.dpDiv.hide(a,b.datepicker._get(d,"showOptions"),h,i):d.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?h:null,i);a||i();if(a=this._get(d,"onClose"))a.apply(d.input?d.input[0]:null,[d.input?d.input.val():"",d]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(b.blockUI){b.unblockUI();b("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")}, +_checkExternalClick:function(a){if(b.datepicker._curInst){a=b(a.target);a[0].id!=b.datepicker._mainDivId&&a.parents("#"+b.datepicker._mainDivId).length==0&&!a.hasClass(b.datepicker.markerClassName)&&!a.hasClass(b.datepicker._triggerClass)&&b.datepicker._datepickerShowing&&!(b.datepicker._inDialog&&b.blockUI)&&b.datepicker._hideDatepicker()}},_adjustDate:function(a,d,h){a=b(a);var i=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(i,d+(h=="M"?this._get(i,"showCurrentAtPos"): +0),h);this._updateDatepicker(i)}},_gotoToday:function(a){a=b(a);var d=this._getInst(a[0]);if(this._get(d,"gotoCurrent")&&d.currentDay){d.selectedDay=d.currentDay;d.drawMonth=d.selectedMonth=d.currentMonth;d.drawYear=d.selectedYear=d.currentYear}else{var h=new Date;d.selectedDay=h.getDate();d.drawMonth=d.selectedMonth=h.getMonth();d.drawYear=d.selectedYear=h.getFullYear()}this._notifyChange(d);this._adjustDate(a)},_selectMonthYear:function(a,d,h){a=b(a);var i=this._getInst(a[0]);i._selectingMonthYear= +false;i["selected"+(h=="M"?"Month":"Year")]=i["draw"+(h=="M"?"Month":"Year")]=parseInt(d.options[d.selectedIndex].value,10);this._notifyChange(i);this._adjustDate(a)},_clickMonthYear:function(a){var d=this._getInst(b(a)[0]);d.input&&d._selectingMonthYear&&setTimeout(function(){d.input.focus()},0);d._selectingMonthYear=!d._selectingMonthYear},_selectDay:function(a,d,h,i){var j=b(a);if(!(b(i).hasClass(this._unselectableClass)||this._isDisabledDatepicker(j[0]))){j=this._getInst(j[0]);j.selectedDay=j.currentDay= +b("a",i).html();j.selectedMonth=j.currentMonth=d;j.selectedYear=j.currentYear=h;this._selectDate(a,this._formatDate(j,j.currentDay,j.currentMonth,j.currentYear))}},_clearDate:function(a){a=b(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,d){a=this._getInst(b(a)[0]);d=d!=null?d:this._formatDate(a);a.input&&a.input.val(d);this._updateAlternate(a);var h=this._get(a,"onSelect");if(h)h.apply(a.input?a.input[0]:null,[d,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a); +else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var d=this._get(a,"altField");if(d){var h=this._get(a,"altFormat")||this._get(a,"dateFormat"),i=this._getDate(a),j=this.formatDate(h,i,this._getFormatConfig(a));b(d).each(function(){b(this).val(j)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var d= +a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((d-a)/864E5)/7)+1},parseDate:function(a,d,h){if(a==null||d==null)throw"Invalid arguments";d=typeof d=="object"?d.toString():d+"";if(d=="")return null;for(var i=(h?h.shortYearCutoff:null)||this._defaults.shortYearCutoff,j=(h?h.dayNamesShort:null)||this._defaults.dayNamesShort,n=(h?h.dayNames:null)||this._defaults.dayNames,q=(h?h.monthNamesShort:null)||this._defaults.monthNamesShort,l=(h?h.monthNames:null)||this._defaults.monthNames, +k=h=-1,m=-1,o=-1,p=false,s=function(x){(x=y+1<a.length&&a.charAt(y+1)==x)&&y++;return x},r=function(x){var C=s(x);x=new RegExp("^\\d{1,"+(x=="@"?14:x=="!"?20:x=="y"&&C?4:x=="o"?3:2)+"}");x=d.substring(w).match(x);if(!x)throw"Missing number at position "+w;w+=x[0].length;return parseInt(x[0],10)},u=function(x,C,J){x=s(x)?J:C;for(C=0;C<x.length;C++)if(d.substr(w,x[C].length).toLowerCase()==x[C].toLowerCase()){w+=x[C].length;return C+1}throw"Unknown name at position "+w;},v=function(){if(d.charAt(w)!= +a.charAt(y))throw"Unexpected literal at position "+w;w++},w=0,y=0;y<a.length;y++)if(p)if(a.charAt(y)=="'"&&!s("'"))p=false;else v();else switch(a.charAt(y)){case "d":m=r("d");break;case "D":u("D",j,n);break;case "o":o=r("o");break;case "m":k=r("m");break;case "M":k=u("M",q,l);break;case "y":h=r("y");break;case "@":var B=new Date(r("@"));h=B.getFullYear();k=B.getMonth()+1;m=B.getDate();break;case "!":B=new Date((r("!")-this._ticksTo1970)/1E4);h=B.getFullYear();k=B.getMonth()+1;m=B.getDate();break; +case "'":if(s("'"))v();else p=true;break;default:v()}if(h==-1)h=(new Date).getFullYear();else if(h<100)h+=(new Date).getFullYear()-(new Date).getFullYear()%100+(h<=i?0:-100);if(o>-1){k=1;m=o;do{i=this._getDaysInMonth(h,k-1);if(m<=i)break;k++;m-=i}while(1)}B=this._daylightSavingAdjust(new Date(h,k-1,m));if(B.getFullYear()!=h||B.getMonth()+1!=k||B.getDate()!=m)throw"Invalid date";return B},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y", +RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,d,h){if(!d)return"";var i=(h?h.dayNamesShort:null)||this._defaults.dayNamesShort,j=(h?h.dayNames:null)||this._defaults.dayNames,n=(h?h.monthNamesShort:null)||this._defaults.monthNamesShort;h=(h?h.monthNames:null)||this._defaults.monthNames;var q=function(s){(s=p+1<a.length&&a.charAt(p+1)==s)&&p++; +return s},l=function(s,r,u){r=""+r;if(q(s))for(;r.length<u;)r="0"+r;return r},k=function(s,r,u,v){return q(s)?v[r]:u[r]},m="",o=false;if(d)for(var p=0;p<a.length;p++)if(o)if(a.charAt(p)=="'"&&!q("'"))o=false;else m+=a.charAt(p);else switch(a.charAt(p)){case "d":m+=l("d",d.getDate(),2);break;case "D":m+=k("D",d.getDay(),i,j);break;case "o":m+=l("o",(d.getTime()-(new Date(d.getFullYear(),0,0)).getTime())/864E5,3);break;case "m":m+=l("m",d.getMonth()+1,2);break;case "M":m+=k("M",d.getMonth(),n,h);break; +case "y":m+=q("y")?d.getFullYear():(d.getYear()%100<10?"0":"")+d.getYear()%100;break;case "@":m+=d.getTime();break;case "!":m+=d.getTime()*1E4+this._ticksTo1970;break;case "'":if(q("'"))m+="'";else o=true;break;default:m+=a.charAt(p)}return m},_possibleChars:function(a){for(var d="",h=false,i=function(n){(n=j+1<a.length&&a.charAt(j+1)==n)&&j++;return n},j=0;j<a.length;j++)if(h)if(a.charAt(j)=="'"&&!i("'"))h=false;else d+=a.charAt(j);else switch(a.charAt(j)){case "d":case "m":case "y":case "@":d+= +"0123456789";break;case "D":case "M":return null;case "'":if(i("'"))d+="'";else h=true;break;default:d+=a.charAt(j)}return d},_get:function(a,d){return a.settings[d]!==c?a.settings[d]:this._defaults[d]},_setDateFromField:function(a,d){if(a.input.val()!=a.lastVal){var h=this._get(a,"dateFormat"),i=a.lastVal=a.input?a.input.val():null,j,n;j=n=this._getDefaultDate(a);var q=this._getFormatConfig(a);try{j=this.parseDate(h,i,q)||n}catch(l){this.log(l);i=d?"":i}a.selectedDay=j.getDate();a.drawMonth=a.selectedMonth= +j.getMonth();a.drawYear=a.selectedYear=j.getFullYear();a.currentDay=i?j.getDate():0;a.currentMonth=i?j.getMonth():0;a.currentYear=i?j.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,d,h){var i=function(n){var q=new Date;q.setDate(q.getDate()+n);return q},j=function(n){try{return b.datepicker.parseDate(b.datepicker._get(a,"dateFormat"),n,b.datepicker._getFormatConfig(a))}catch(q){}var l= +(n.toLowerCase().match(/^c/)?b.datepicker._getDate(a):null)||new Date,k=l.getFullYear(),m=l.getMonth();l=l.getDate();for(var o=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,p=o.exec(n);p;){switch(p[2]||"d"){case "d":case "D":l+=parseInt(p[1],10);break;case "w":case "W":l+=parseInt(p[1],10)*7;break;case "m":case "M":m+=parseInt(p[1],10);l=Math.min(l,b.datepicker._getDaysInMonth(k,m));break;case "y":case "Y":k+=parseInt(p[1],10);l=Math.min(l,b.datepicker._getDaysInMonth(k,m));break}p=o.exec(n)}return new Date(k, +m,l)};if(d=(d=d==null||d===""?h:typeof d=="string"?j(d):typeof d=="number"?isNaN(d)?h:i(d):new Date(d.getTime()))&&d.toString()=="Invalid Date"?h:d){d.setHours(0);d.setMinutes(0);d.setSeconds(0);d.setMilliseconds(0)}return this._daylightSavingAdjust(d)},_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,d,h){var i=!d,j=a.selectedMonth,n=a.selectedYear;d=this._restrictMinMax(a,this._determineDate(a,d,new Date));a.selectedDay= +a.currentDay=d.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=d.getMonth();a.drawYear=a.selectedYear=a.currentYear=d.getFullYear();if((j!=a.selectedMonth||n!=a.selectedYear)&&!h)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(i?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var d=new Date;d=this._daylightSavingAdjust(new Date(d.getFullYear(), +d.getMonth(),d.getDate()));var h=this._get(a,"isRTL"),i=this._get(a,"showButtonPanel"),j=this._get(a,"hideIfNoPrevNext"),n=this._get(a,"navigationAsDateFormat"),q=this._getNumberOfMonths(a),l=this._get(a,"showCurrentAtPos"),k=this._get(a,"stepMonths"),m=q[0]!=1||q[1]!=1,o=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),p=this._getMinMaxDate(a,"min"),s=this._getMinMaxDate(a,"max");l=a.drawMonth-l;var r=a.drawYear;if(l<0){l+=12;r--}if(s){var u= +this._daylightSavingAdjust(new Date(s.getFullYear(),s.getMonth()-q[0]*q[1]+1,s.getDate()));for(u=p&&u<p?p:u;this._daylightSavingAdjust(new Date(r,l,1))>u;){l--;if(l<0){l=11;r--}}}a.drawMonth=l;a.drawYear=r;u=this._get(a,"prevText");u=!n?u:this.formatDate(u,this._daylightSavingAdjust(new Date(r,l-k,1)),this._getFormatConfig(a));u=this._canAdjustMonth(a,-1,r,l)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+e+".datepicker._adjustDate('#"+a.id+"', -"+k+", 'M');\" title=\""+u+'"><span class="ui-icon ui-icon-circle-triangle-'+ +(h?"e":"w")+'">'+u+"</span></a>":j?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+u+'"><span class="ui-icon ui-icon-circle-triangle-'+(h?"e":"w")+'">'+u+"</span></a>";var v=this._get(a,"nextText");v=!n?v:this.formatDate(v,this._daylightSavingAdjust(new Date(r,l+k,1)),this._getFormatConfig(a));j=this._canAdjustMonth(a,+1,r,l)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+e+".datepicker._adjustDate('#"+a.id+"', +"+k+", 'M');\" title=\""+v+'"><span class="ui-icon ui-icon-circle-triangle-'+ +(h?"w":"e")+'">'+v+"</span></a>":j?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+v+'"><span class="ui-icon ui-icon-circle-triangle-'+(h?"w":"e")+'">'+v+"</span></a>";k=this._get(a,"currentText");v=this._get(a,"gotoCurrent")&&a.currentDay?o:d;k=!n?k:this.formatDate(k,v,this._getFormatConfig(a));n=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+e+'.datepicker._hideDatepicker();">'+this._get(a, +"closeText")+"</button>":"";i=i?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(h?n:"")+(this._isInRange(a,v)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+e+".datepicker._gotoToday('#"+a.id+"');\">"+k+"</button>":"")+(h?"":n)+"</div>":"";n=parseInt(this._get(a,"firstDay"),10);n=isNaN(n)?0:n;k=this._get(a,"showWeek");v=this._get(a,"dayNames");this._get(a,"dayNamesShort");var w=this._get(a,"dayNamesMin"),y= +this._get(a,"monthNames"),B=this._get(a,"monthNamesShort"),x=this._get(a,"beforeShowDay"),C=this._get(a,"showOtherMonths"),J=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var M=this._getDefaultDate(a),K="",G=0;G<q[0];G++){for(var N="",H=0;H<q[1];H++){var O=this._daylightSavingAdjust(new Date(r,l,a.selectedDay)),A=" ui-corner-all",D="";if(m){D+='<div class="ui-datepicker-group';if(q[1]>1)switch(H){case 0:D+=" ui-datepicker-group-first";A=" ui-corner-"+(h?"right":"left");break;case q[1]- +1:D+=" ui-datepicker-group-last";A=" ui-corner-"+(h?"left":"right");break;default:D+=" ui-datepicker-group-middle";A="";break}D+='">'}D+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+A+'">'+(/all|left/.test(A)&&G==0?h?j:u:"")+(/all|right/.test(A)&&G==0?h?u:j:"")+this._generateMonthYearHeader(a,l,r,p,s,G>0||H>0,y,B)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var E=k?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(A=0;A<7;A++){var z= +(A+n)%7;E+="<th"+((A+n+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+v[z]+'">'+w[z]+"</span></th>"}D+=E+"</tr></thead><tbody>";E=this._getDaysInMonth(r,l);if(r==a.selectedYear&&l==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,E);A=(this._getFirstDayOfMonth(r,l)-n+7)%7;E=m?6:Math.ceil((A+E)/7);z=this._daylightSavingAdjust(new Date(r,l,1-A));for(var P=0;P<E;P++){D+="<tr>";var Q=!k?"":'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(z)+"</td>";for(A=0;A<7;A++){var I= +x?x.apply(a.input?a.input[0]:null,[z]):[true,""],F=z.getMonth()!=l,L=F&&!J||!I[0]||p&&z<p||s&&z>s;Q+='<td class="'+((A+n+6)%7>=5?" ui-datepicker-week-end":"")+(F?" ui-datepicker-other-month":"")+(z.getTime()==O.getTime()&&l==a.selectedMonth&&a._keyEvent||M.getTime()==z.getTime()&&M.getTime()==O.getTime()?" "+this._dayOverClass:"")+(L?" "+this._unselectableClass+" ui-state-disabled":"")+(F&&!C?"":" "+I[1]+(z.getTime()==o.getTime()?" "+this._currentClass:"")+(z.getTime()==d.getTime()?" ui-datepicker-today": +""))+'"'+((!F||C)&&I[2]?' title="'+I[2]+'"':"")+(L?"":' onclick="DP_jQuery_'+e+".datepicker._selectDay('#"+a.id+"',"+z.getMonth()+","+z.getFullYear()+', this);return false;"')+">"+(F&&!C?" ":L?'<span class="ui-state-default">'+z.getDate()+"</span>":'<a class="ui-state-default'+(z.getTime()==d.getTime()?" ui-state-highlight":"")+(z.getTime()==o.getTime()?" ui-state-active":"")+(F?" ui-priority-secondary":"")+'" href="#">'+z.getDate()+"</a>")+"</td>";z.setDate(z.getDate()+1);z=this._daylightSavingAdjust(z)}D+= +Q+"</tr>"}l++;if(l>11){l=0;r++}D+="</tbody></table>"+(m?"</div>"+(q[0]>0&&H==q[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");N+=D}K+=N}K+=i+(b.browser.msie&&parseInt(b.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");a._keyEvent=false;return K},_generateMonthYearHeader:function(a,d,h,i,j,n,q,l){var k=this._get(a,"changeMonth"),m=this._get(a,"changeYear"),o=this._get(a,"showMonthAfterYear"),p='<div class="ui-datepicker-title">', +s="";if(n||!k)s+='<span class="ui-datepicker-month">'+q[d]+"</span>";else{q=i&&i.getFullYear()==h;var r=j&&j.getFullYear()==h;s+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+e+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+e+".datepicker._clickMonthYear('#"+a.id+"');\">";for(var u=0;u<12;u++)if((!q||u>=i.getMonth())&&(!r||u<=j.getMonth()))s+='<option value="'+u+'"'+(u==d?' selected="selected"':"")+">"+l[u]+"</option>";s+="</select>"}o||(p+=s+(n||!(k&& +m)?" ":""));a.yearshtml="";if(n||!m)p+='<span class="ui-datepicker-year">'+h+"</span>";else{l=this._get(a,"yearRange").split(":");var v=(new Date).getFullYear();q=function(w){w=w.match(/c[+-].*/)?h+parseInt(w.substring(1),10):w.match(/[+-].*/)?v+parseInt(w,10):parseInt(w,10);return isNaN(w)?v:w};d=q(l[0]);l=Math.max(d,q(l[1]||""));d=i?Math.max(d,i.getFullYear()):d;l=j?Math.min(l,j.getFullYear()):l;for(a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+e+".datepicker._selectMonthYear('#"+ +a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+e+".datepicker._clickMonthYear('#"+a.id+"');\">";d<=l;d++)a.yearshtml+='<option value="'+d+'"'+(d==h?' selected="selected"':"")+">"+d+"</option>";a.yearshtml+="</select>";if(b.browser.mozilla)p+='<select class="ui-datepicker-year"><option value="'+h+'" selected="selected">'+h+"</option></select>";else{p+=a.yearshtml;a.yearshtml=null}}p+=this._get(a,"yearSuffix");if(o)p+=(n||!(k&&m)?" ":"")+s;p+="</div>";return p},_adjustInstDate:function(a,d,h){var i= +a.drawYear+(h=="Y"?d:0),j=a.drawMonth+(h=="M"?d:0);d=Math.min(a.selectedDay,this._getDaysInMonth(i,j))+(h=="D"?d:0);i=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(i,j,d)));a.selectedDay=i.getDate();a.drawMonth=a.selectedMonth=i.getMonth();a.drawYear=a.selectedYear=i.getFullYear();if(h=="M"||h=="Y")this._notifyChange(a)},_restrictMinMax:function(a,d){var h=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");d=h&&d<h?h:d;return d=a&&d>a?a:d},_notifyChange:function(a){var d=this._get(a, +"onChangeMonthYear");if(d)d.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,d){return this._determineDate(a,this._get(a,d+"Date"),null)},_getDaysInMonth:function(a,d){return 32-(new Date(a,d,32)).getDate()},_getFirstDayOfMonth:function(a,d){return(new Date(a,d,1)).getDay()},_canAdjustMonth:function(a,d,h,i){var j=this._getNumberOfMonths(a); +h=this._daylightSavingAdjust(new Date(h,i+(d<0?d:j[0]*j[1]),1));d<0&&h.setDate(this._getDaysInMonth(h.getFullYear(),h.getMonth()));return this._isInRange(a,h)},_isInRange:function(a,d){var h=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!h||d.getTime()>=h.getTime())&&(!a||d.getTime()<=a.getTime())},_getFormatConfig:function(a){var d=this._get(a,"shortYearCutoff");d=typeof d!="string"?d:(new Date).getFullYear()%100+parseInt(d,10);return{shortYearCutoff:d,dayNamesShort:this._get(a, +"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,d,h,i){if(!d){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}d=d?typeof d=="object"?d:this._daylightSavingAdjust(new Date(i,h,d)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),d,this._getFormatConfig(a))}});b.fn.datepicker= +function(a){if(!b.datepicker.initialized){b(document).mousedown(b.datepicker._checkExternalClick).find("body").append(b.datepicker.dpDiv);b.datepicker.initialized=true}var d=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return b.datepicker["_"+a+"Datepicker"].apply(b.datepicker,[this[0]].concat(d));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return b.datepicker["_"+a+"Datepicker"].apply(b.datepicker,[this[0]].concat(d)); +return this.each(function(){typeof a=="string"?b.datepicker["_"+a+"Datepicker"].apply(b.datepicker,[this].concat(d)):b.datepicker._attachDatepicker(this,a)})};b.datepicker=new f;b.datepicker.initialized=false;b.datepicker.uuid=(new Date).getTime();b.datepicker.version="1.8.7";window["DP_jQuery_"+e]=b})(jQuery); +(function(b,c){var f={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},g={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true};b.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:{my:"center",at:"center",collision:"fit",using:function(e){var a=b(this).css(e).offset().top;a<0&& +b(this).css("top",e.top-a)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var e=this,a=e.options,d=a.title||" ",h=b.ui.dialog.getTitleId(e.element),i=(e.uiDialog=b("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+a.dialogClass).css({zIndex:a.zIndex}).attr("tabIndex", +-1).css("outline",0).keydown(function(q){if(a.closeOnEscape&&q.keyCode&&q.keyCode===b.ui.keyCode.ESCAPE){e.close(q);q.preventDefault()}}).attr({role:"dialog","aria-labelledby":h}).mousedown(function(q){e.moveToTop(false,q)});e.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(i);var j=(e.uiDialogTitlebar=b("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(i),n=b('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role", +"button").hover(function(){n.addClass("ui-state-hover")},function(){n.removeClass("ui-state-hover")}).focus(function(){n.addClass("ui-state-focus")}).blur(function(){n.removeClass("ui-state-focus")}).click(function(q){e.close(q);return false}).appendTo(j);(e.uiDialogTitlebarCloseText=b("<span></span>")).addClass("ui-icon ui-icon-closethick").text(a.closeText).appendTo(n);b("<span></span>").addClass("ui-dialog-title").attr("id",h).html(d).prependTo(j);if(b.isFunction(a.beforeclose)&&!b.isFunction(a.beforeClose))a.beforeClose= +a.beforeclose;j.find("*").add(j).disableSelection();a.draggable&&b.fn.draggable&&e._makeDraggable();a.resizable&&b.fn.resizable&&e._makeResizable();e._createButtons(a.buttons);e._isOpen=false;b.fn.bgiframe&&i.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var e=this;e.overlay&&e.overlay.destroy();e.uiDialog.hide();e.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");e.uiDialog.remove();e.originalTitle&& +e.element.attr("title",e.originalTitle);return e},widget:function(){return this.uiDialog},close:function(e){var a=this,d,h;if(false!==a._trigger("beforeClose",e)){a.overlay&&a.overlay.destroy();a.uiDialog.unbind("keypress.ui-dialog");a._isOpen=false;if(a.options.hide)a.uiDialog.hide(a.options.hide,function(){a._trigger("close",e)});else{a.uiDialog.hide();a._trigger("close",e)}b.ui.dialog.overlay.resize();if(a.options.modal){d=0;b(".ui-dialog").each(function(){if(this!==a.uiDialog[0]){h=b(this).css("z-index"); +isNaN(h)||(d=Math.max(d,h))}});b.ui.dialog.maxZ=d}return a}},isOpen:function(){return this._isOpen},moveToTop:function(e,a){var d=this,h=d.options;if(h.modal&&!e||!h.stack&&!h.modal)return d._trigger("focus",a);if(h.zIndex>b.ui.dialog.maxZ)b.ui.dialog.maxZ=h.zIndex;if(d.overlay){b.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",b.ui.dialog.overlay.maxZ=b.ui.dialog.maxZ)}e={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};b.ui.dialog.maxZ+=1;d.uiDialog.css("z-index",b.ui.dialog.maxZ); +d.element.attr(e);d._trigger("focus",a);return d},open:function(){if(!this._isOpen){var e=this,a=e.options,d=e.uiDialog;e.overlay=a.modal?new b.ui.dialog.overlay(e):null;e._size();e._position(a.position);d.show(a.show);e.moveToTop(true);a.modal&&d.bind("keypress.ui-dialog",function(h){if(h.keyCode===b.ui.keyCode.TAB){var i=b(":tabbable",this),j=i.filter(":first");i=i.filter(":last");if(h.target===i[0]&&!h.shiftKey){j.focus(1);return false}else if(h.target===j[0]&&h.shiftKey){i.focus(1);return false}}}); +b(e.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();e._isOpen=true;e._trigger("open");return e}},_createButtons:function(e){var a=this,d=false,h=b("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),i=b("<div></div>").addClass("ui-dialog-buttonset").appendTo(h);a.uiDialog.find(".ui-dialog-buttonpane").remove();typeof e==="object"&&e!==null&&b.each(e,function(){return!(d=true)});if(d){b.each(e,function(j, +n){n=b.isFunction(n)?{click:n,text:j}:n;j=b('<button type="button"></button>').attr(n,true).unbind("click").click(function(){n.click.apply(a.element[0],arguments)}).appendTo(i);b.fn.button&&j.button()});h.appendTo(a.uiDialog)}},_makeDraggable:function(){function e(j){return{position:j.position,offset:j.offset}}var a=this,d=a.options,h=b(document),i;a.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(j,n){i= +d.height==="auto"?"auto":b(this).height();b(this).height(b(this).height()).addClass("ui-dialog-dragging");a._trigger("dragStart",j,e(n))},drag:function(j,n){a._trigger("drag",j,e(n))},stop:function(j,n){d.position=[n.position.left-h.scrollLeft(),n.position.top-h.scrollTop()];b(this).removeClass("ui-dialog-dragging").height(i);a._trigger("dragStop",j,e(n));b.ui.dialog.overlay.resize()}})},_makeResizable:function(e){function a(j){return{originalPosition:j.originalPosition,originalSize:j.originalSize, +position:j.position,size:j.size}}e=e===c?this.options.resizable:e;var d=this,h=d.options,i=d.uiDialog.css("position");e=typeof e==="string"?e:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:h.maxWidth,maxHeight:h.maxHeight,minWidth:h.minWidth,minHeight:d._minHeight(),handles:e,start:function(j,n){b(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",j,a(n))},resize:function(j,n){d._trigger("resize",j,a(n))},stop:function(j, +n){b(this).removeClass("ui-dialog-resizing");h.height=b(this).height();h.width=b(this).width();d._trigger("resizeStop",j,a(n));b.ui.dialog.overlay.resize()}}).css("position",i).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var e=this.options;return e.height==="auto"?e.minHeight:Math.min(e.minHeight,e.height)},_position:function(e){var a=[],d=[0,0],h;if(e){if(typeof e==="string"||typeof e==="object"&&"0"in e){a=e.split?e.split(" "):[e[0],e[1]];if(a.length=== +1)a[1]=a[0];b.each(["left","top"],function(i,j){if(+a[i]===a[i]){d[i]=a[i];a[i]=j}});e={my:a.join(" "),at:a.join(" "),offset:d.join(" ")}}e=b.extend({},b.ui.dialog.prototype.options.position,e)}else e=b.ui.dialog.prototype.options.position;(h=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(b.extend({of:window},e));h||this.uiDialog.hide()},_setOptions:function(e){var a=this,d={},h=false;b.each(e,function(i,j){a._setOption(i,j);if(i in f)h=true;if(i in +g)d[i]=j});h&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(e,a){var d=this,h=d.uiDialog;switch(e){case "beforeclose":e="beforeClose";break;case "buttons":d._createButtons(a);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+a);break;case "dialogClass":h.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+a);break;case "disabled":a?h.addClass("ui-dialog-disabled"):h.removeClass("ui-dialog-disabled"); +break;case "draggable":var i=h.is(":data(draggable)");i&&!a&&h.draggable("destroy");!i&&a&&d._makeDraggable();break;case "position":d._position(a);break;case "resizable":(i=h.is(":data(resizable)"))&&!a&&h.resizable("destroy");i&&typeof a==="string"&&h.resizable("option","handles",a);!i&&a!==false&&d._makeResizable(a);break;case "title":b(".ui-dialog-title",d.uiDialogTitlebar).html(""+(a||" "));break}b.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var e=this.options,a,d,h= +this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(e.minWidth>e.width)e.width=e.minWidth;a=this.uiDialog.css({height:"auto",width:e.width}).height();d=Math.max(0,e.minHeight-a);if(e.height==="auto")if(b.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();e=this.element.css("height","auto").height();h||this.uiDialog.hide();this.element.height(Math.max(e,d))}else this.element.height(Math.max(e.height-a,0));this.uiDialog.is(":data(resizable)")&& +this.uiDialog.resizable("option","minHeight",this._minHeight())}});b.extend(b.ui.dialog,{version:"1.8.7",uuid:0,maxZ:0,getTitleId:function(e){e=e.attr("id");if(!e){this.uuid+=1;e=this.uuid}return"ui-dialog-title-"+e},overlay:function(e){this.$el=b.ui.dialog.overlay.create(e)}});b.extend(b.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:b.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(e){return e+".dialog-overlay"}).join(" "),create:function(e){if(this.instances.length=== +0){setTimeout(function(){b.ui.dialog.overlay.instances.length&&b(document).bind(b.ui.dialog.overlay.events,function(d){if(b(d.target).zIndex()<b.ui.dialog.overlay.maxZ)return false})},1);b(document).bind("keydown.dialog-overlay",function(d){if(e.options.closeOnEscape&&d.keyCode&&d.keyCode===b.ui.keyCode.ESCAPE){e.close(d);d.preventDefault()}});b(window).bind("resize.dialog-overlay",b.ui.dialog.overlay.resize)}var a=(this.oldInstances.pop()||b("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), +height:this.height()});b.fn.bgiframe&&a.bgiframe();this.instances.push(a);return a},destroy:function(e){var a=b.inArray(e,this.instances);a!=-1&&this.oldInstances.push(this.instances.splice(a,1)[0]);this.instances.length===0&&b([document,window]).unbind(".dialog-overlay");e.remove();var d=0;b.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var e,a;if(b.browser.msie&&b.browser.version<7){e=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); +a=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return e<a?b(window).height()+"px":e+"px"}else return b(document).height()+"px"},width:function(){var e,a;if(b.browser.msie&&b.browser.version<7){e=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);a=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return e<a?b(window).width()+"px":e+"px"}else return b(document).width()+"px"},resize:function(){var e=b([]);b.each(b.ui.dialog.overlay.instances, +function(){e=e.add(this)});e.css({width:0,height:0}).css({width:b.ui.dialog.overlay.width(),height:b.ui.dialog.overlay.height()})}});b.extend(b.ui.dialog.overlay.prototype,{destroy:function(){b.ui.dialog.overlay.destroy(this.$el)}})})(jQuery); +(function(b){b.ui=b.ui||{};var c=/left|center|right/,f=/top|center|bottom/,g=b.fn.position,e=b.fn.offset;b.fn.position=function(a){if(!a||!a.of)return g.apply(this,arguments);a=b.extend({},a);var d=b(a.of),h=d[0],i=(a.collision||"flip").split(" "),j=a.offset?a.offset.split(" "):[0,0],n,q,l;if(h.nodeType===9){n=d.width();q=d.height();l={top:0,left:0}}else if(h.setTimeout){n=d.width();q=d.height();l={top:d.scrollTop(),left:d.scrollLeft()}}else if(h.preventDefault){a.at="left top";n=q=0;l={top:a.of.pageY, +left:a.of.pageX}}else{n=d.outerWidth();q=d.outerHeight();l=d.offset()}b.each(["my","at"],function(){var k=(a[this]||"").split(" ");if(k.length===1)k=c.test(k[0])?k.concat(["center"]):f.test(k[0])?["center"].concat(k):["center","center"];k[0]=c.test(k[0])?k[0]:"center";k[1]=f.test(k[1])?k[1]:"center";a[this]=k});if(i.length===1)i[1]=i[0];j[0]=parseInt(j[0],10)||0;if(j.length===1)j[1]=j[0];j[1]=parseInt(j[1],10)||0;if(a.at[0]==="right")l.left+=n;else if(a.at[0]==="center")l.left+=n/2;if(a.at[1]==="bottom")l.top+= +q;else if(a.at[1]==="center")l.top+=q/2;l.left+=j[0];l.top+=j[1];return this.each(function(){var k=b(this),m=k.outerWidth(),o=k.outerHeight(),p=parseInt(b.curCSS(this,"marginLeft",true))||0,s=parseInt(b.curCSS(this,"marginTop",true))||0,r=m+p+parseInt(b.curCSS(this,"marginRight",true))||0,u=o+s+parseInt(b.curCSS(this,"marginBottom",true))||0,v=b.extend({},l),w;if(a.my[0]==="right")v.left-=m;else if(a.my[0]==="center")v.left-=m/2;if(a.my[1]==="bottom")v.top-=o;else if(a.my[1]==="center")v.top-=o/2; +v.left=Math.round(v.left);v.top=Math.round(v.top);w={left:v.left-p,top:v.top-s};b.each(["left","top"],function(y,B){b.ui.position[i[y]]&&b.ui.position[i[y]][B](v,{targetWidth:n,targetHeight:q,elemWidth:m,elemHeight:o,collisionPosition:w,collisionWidth:r,collisionHeight:u,offset:j,my:a.my,at:a.at})});b.fn.bgiframe&&k.bgiframe();k.offset(b.extend(v,{using:a.using}))})};b.ui.position={fit:{left:function(a,d){var h=b(window);h=d.collisionPosition.left+d.collisionWidth-h.width()-h.scrollLeft();a.left= +h>0?a.left-h:Math.max(a.left-d.collisionPosition.left,a.left)},top:function(a,d){var h=b(window);h=d.collisionPosition.top+d.collisionHeight-h.height()-h.scrollTop();a.top=h>0?a.top-h:Math.max(a.top-d.collisionPosition.top,a.top)}},flip:{left:function(a,d){if(d.at[0]!=="center"){var h=b(window);h=d.collisionPosition.left+d.collisionWidth-h.width()-h.scrollLeft();var i=d.my[0]==="left"?-d.elemWidth:d.my[0]==="right"?d.elemWidth:0,j=d.at[0]==="left"?d.targetWidth:-d.targetWidth,n=-2*d.offset[0];a.left+= +d.collisionPosition.left<0?i+j+n:h>0?i+j+n:0}},top:function(a,d){if(d.at[1]!=="center"){var h=b(window);h=d.collisionPosition.top+d.collisionHeight-h.height()-h.scrollTop();var i=d.my[1]==="top"?-d.elemHeight:d.my[1]==="bottom"?d.elemHeight:0,j=d.at[1]==="top"?d.targetHeight:-d.targetHeight,n=-2*d.offset[1];a.top+=d.collisionPosition.top<0?i+j+n:h>0?i+j+n:0}}}};if(!b.offset.setOffset){b.offset.setOffset=function(a,d){if(/static/.test(b.curCSS(a,"position")))a.style.position="relative";var h=b(a), +i=h.offset(),j=parseInt(b.curCSS(a,"top",true),10)||0,n=parseInt(b.curCSS(a,"left",true),10)||0;i={top:d.top-i.top+j,left:d.left-i.left+n};"using"in d?d.using.call(a,i):h.css(i)};b.fn.offset=function(a){var d=this[0];if(!d||!d.ownerDocument)return null;if(a)return this.each(function(){b.offset.setOffset(this,a)});return e.call(this)}}})(jQuery); +(function(b,c){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); +this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(f){if(f===c)return this._value();this._setOption("value",f);return this},_setOption:function(f,g){if(f==="value"){this.options.value=g;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var f=this.options.value;if(typeof f!=="number")f=0;return Math.min(this.options.max,Math.max(this.min,f))},_percentage:function(){return 100* +this._value()/this.options.max},_refreshValue:function(){var f=this.value(),g=this._percentage();if(this.oldValue!==f){this.oldValue=f;this._trigger("change")}this.valueDiv.toggleClass("ui-corner-right",f===this.options.max).width(g.toFixed(0)+"%");this.element.attr("aria-valuenow",f)}});b.extend(b.ui.progressbar,{version:"1.8.7"})})(jQuery); +(function(b){b.widget("ui.slider",b.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var c=this,f=this.options;this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");f.disabled&&this.element.addClass("ui-slider-disabled ui-disabled"); +this.range=b([]);if(f.range){if(f.range===true){this.range=b("<div></div>");if(!f.values)f.values=[this._valueMin(),this._valueMin()];if(f.values.length&&f.values.length!==2)f.values=[f.values[0],f.values[0]]}else this.range=b("<div></div>");this.range.appendTo(this.element).addClass("ui-slider-range");if(f.range==="min"||f.range==="max")this.range.addClass("ui-slider-range-"+f.range);this.range.addClass("ui-widget-header")}b(".ui-slider-handle",this.element).length===0&&b("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle"); +if(f.values&&f.values.length)for(;b(".ui-slider-handle",this.element).length<f.values.length;)b("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");this.handles=b(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){f.disabled||b(this).addClass("ui-state-hover")},function(){b(this).removeClass("ui-state-hover")}).focus(function(){if(f.disabled)b(this).blur(); +else{b(".ui-slider .ui-state-focus").removeClass("ui-state-focus");b(this).addClass("ui-state-focus")}}).blur(function(){b(this).removeClass("ui-state-focus")});this.handles.each(function(g){b(this).data("index.ui-slider-handle",g)});this.handles.keydown(function(g){var e=true,a=b(this).data("index.ui-slider-handle"),d,h,i;if(!c.options.disabled){switch(g.keyCode){case b.ui.keyCode.HOME:case b.ui.keyCode.END:case b.ui.keyCode.PAGE_UP:case b.ui.keyCode.PAGE_DOWN:case b.ui.keyCode.UP:case b.ui.keyCode.RIGHT:case b.ui.keyCode.DOWN:case b.ui.keyCode.LEFT:e= +false;if(!c._keySliding){c._keySliding=true;b(this).addClass("ui-state-active");d=c._start(g,a);if(d===false)return}break}i=c.options.step;d=c.options.values&&c.options.values.length?(h=c.values(a)):(h=c.value());switch(g.keyCode){case b.ui.keyCode.HOME:h=c._valueMin();break;case b.ui.keyCode.END:h=c._valueMax();break;case b.ui.keyCode.PAGE_UP:h=c._trimAlignValue(d+(c._valueMax()-c._valueMin())/5);break;case b.ui.keyCode.PAGE_DOWN:h=c._trimAlignValue(d-(c._valueMax()-c._valueMin())/5);break;case b.ui.keyCode.UP:case b.ui.keyCode.RIGHT:if(d=== +c._valueMax())return;h=c._trimAlignValue(d+i);break;case b.ui.keyCode.DOWN:case b.ui.keyCode.LEFT:if(d===c._valueMin())return;h=c._trimAlignValue(d-i);break}c._slide(g,a,h);return e}}).keyup(function(g){var e=b(this).data("index.ui-slider-handle");if(c._keySliding){c._keySliding=false;c._stop(g,e);c._change(g,e);b(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider"); +this._mouseDestroy();return this},_mouseCapture:function(c){var f=this.options,g,e,a,d,h;if(f.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();g=this._normValueFromMouse({x:c.pageX,y:c.pageY});e=this._valueMax()-this._valueMin()+1;d=this;this.handles.each(function(i){var j=Math.abs(g-d.values(i));if(e>j){e=j;a=b(this);h=i}});if(f.range===true&&this.values(1)===f.min){h+=1;a=b(this.handles[h])}if(this._start(c, +h)===false)return false;this._mouseSliding=true;d._handleIndex=h;a.addClass("ui-state-active").focus();f=a.offset();this._clickOffset=!b(c.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:c.pageX-f.left-a.width()/2,top:c.pageY-f.top-a.height()/2-(parseInt(a.css("borderTopWidth"),10)||0)-(parseInt(a.css("borderBottomWidth"),10)||0)+(parseInt(a.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(c,h,g);return this._animateOff=true},_mouseStart:function(){return true}, +_mouseDrag:function(c){var f=this._normValueFromMouse({x:c.pageX,y:c.pageY});this._slide(c,this._handleIndex,f);return false},_mouseStop:function(c){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(c,this._handleIndex);this._change(c,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(c){var f; +if(this.orientation==="horizontal"){f=this.elementSize.width;c=c.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{f=this.elementSize.height;c=c.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}f=c/f;if(f>1)f=1;if(f<0)f=0;if(this.orientation==="vertical")f=1-f;c=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+f*c)},_start:function(c,f){var g={handle:this.handles[f],value:this.value()};if(this.options.values&&this.options.values.length){g.value= +this.values(f);g.values=this.values()}return this._trigger("start",c,g)},_slide:function(c,f,g){var e;if(this.options.values&&this.options.values.length){e=this.values(f?0:1);if(this.options.values.length===2&&this.options.range===true&&(f===0&&g>e||f===1&&g<e))g=e;if(g!==this.values(f)){e=this.values();e[f]=g;c=this._trigger("slide",c,{handle:this.handles[f],value:g,values:e});this.values(f?0:1);c!==false&&this.values(f,g,true)}}else if(g!==this.value()){c=this._trigger("slide",c,{handle:this.handles[f], +value:g});c!==false&&this.value(g)}},_stop:function(c,f){var g={handle:this.handles[f],value:this.value()};if(this.options.values&&this.options.values.length){g.value=this.values(f);g.values=this.values()}this._trigger("stop",c,g)},_change:function(c,f){if(!this._keySliding&&!this._mouseSliding){var g={handle:this.handles[f],value:this.value()};if(this.options.values&&this.options.values.length){g.value=this.values(f);g.values=this.values()}this._trigger("change",c,g)}},value:function(c){if(arguments.length){this.options.value= +this._trimAlignValue(c);this._refreshValue();this._change(null,0)}return this._value()},values:function(c,f){var g,e,a;if(arguments.length>1){this.options.values[c]=this._trimAlignValue(f);this._refreshValue();this._change(null,c)}if(arguments.length)if(b.isArray(arguments[0])){g=this.options.values;e=arguments[0];for(a=0;a<g.length;a+=1){g[a]=this._trimAlignValue(e[a]);this._change(null,a)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(c):this.value(); +else return this._values()},_setOption:function(c,f){var g,e=0;if(b.isArray(this.options.values))e=this.options.values.length;b.Widget.prototype._setOption.apply(this,arguments);switch(c){case "disabled":if(f){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation(); +this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(g=0;g<e;g+=1)this._change(null,g);this._animateOff=false;break}},_value:function(){var c=this.options.value;return c=this._trimAlignValue(c)},_values:function(c){var f,g;if(arguments.length){f=this.options.values[c]; +return f=this._trimAlignValue(f)}else{f=this.options.values.slice();for(g=0;g<f.length;g+=1)f[g]=this._trimAlignValue(f[g]);return f}},_trimAlignValue:function(c){if(c<=this._valueMin())return this._valueMin();if(c>=this._valueMax())return this._valueMax();var f=this.options.step>0?this.options.step:1,g=(c-this._valueMin())%f;alignValue=c-g;if(Math.abs(g)*2>=f)alignValue+=g>0?f:-f;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max}, +_refreshValue:function(){var c=this.options.range,f=this.options,g=this,e=!this._animateOff?f.animate:false,a,d={},h,i,j,n;if(this.options.values&&this.options.values.length)this.handles.each(function(q){a=(g.values(q)-g._valueMin())/(g._valueMax()-g._valueMin())*100;d[g.orientation==="horizontal"?"left":"bottom"]=a+"%";b(this).stop(1,1)[e?"animate":"css"](d,f.animate);if(g.options.range===true)if(g.orientation==="horizontal"){if(q===0)g.range.stop(1,1)[e?"animate":"css"]({left:a+"%"},f.animate); +if(q===1)g.range[e?"animate":"css"]({width:a-h+"%"},{queue:false,duration:f.animate})}else{if(q===0)g.range.stop(1,1)[e?"animate":"css"]({bottom:a+"%"},f.animate);if(q===1)g.range[e?"animate":"css"]({height:a-h+"%"},{queue:false,duration:f.animate})}h=a});else{i=this.value();j=this._valueMin();n=this._valueMax();a=n!==j?(i-j)/(n-j)*100:0;d[g.orientation==="horizontal"?"left":"bottom"]=a+"%";this.handle.stop(1,1)[e?"animate":"css"](d,f.animate);if(c==="min"&&this.orientation==="horizontal")this.range.stop(1, +1)[e?"animate":"css"]({width:a+"%"},f.animate);if(c==="max"&&this.orientation==="horizontal")this.range[e?"animate":"css"]({width:100-a+"%"},{queue:false,duration:f.animate});if(c==="min"&&this.orientation==="vertical")this.range.stop(1,1)[e?"animate":"css"]({height:a+"%"},f.animate);if(c==="max"&&this.orientation==="vertical")this.range[e?"animate":"css"]({height:100-a+"%"},{queue:false,duration:f.animate})}}});b.extend(b.ui.slider,{version:"1.8.7"})})(jQuery); +(function(b,c){function f(){return++e}function g(){return++a}var e=0,a=0;b.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(d,h){if(d=="selected")this.options.collapsible&& +h==this.options.selected||this.select(h);else{this.options[d]=h;this._tabify()}},_tabId:function(d){return d.title&&d.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+f()},_sanitizeSelector:function(d){return d.replace(/:/g,"\\:")},_cookie:function(){var d=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+g());return b.cookie.apply(null,[d].concat(b.makeArray(arguments)))},_ui:function(d,h){return{tab:d,panel:h,index:this.anchors.index(d)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var d= +b(this);d.html(d.data("label.tabs")).removeData("label.tabs")})},_tabify:function(d){function h(r,u){r.css("display","");!b.support.opacity&&u.opacity&&r[0].style.removeAttribute("filter")}var i=this,j=this.options,n=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=b(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return b("a",this)[0]});this.panels=b([]);this.anchors.each(function(r,u){var v=b(u).attr("href"),w=v.split("#")[0],y;if(w&&(w===location.toString().split("#")[0]|| +(y=b("base")[0])&&w===y.href)){v=u.hash;u.href=v}if(n.test(v))i.panels=i.panels.add(i.element.find(i._sanitizeSelector(v)));else if(v&&v!=="#"){b.data(u,"href.tabs",v);b.data(u,"load.tabs",v.replace(/#.*$/,""));v=i._tabId(u);u.href="#"+v;u=i.element.find("#"+v);if(!u.length){u=b(j.panelTemplate).attr("id",v).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(i.panels[r-1]||i.list);u.data("destroy.tabs",true)}i.panels=i.panels.add(u)}else j.disabled.push(r)});if(d){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); +this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(j.selected===c){location.hash&&this.anchors.each(function(r,u){if(u.hash==location.hash){j.selected=r;return false}});if(typeof j.selected!=="number"&&j.cookie)j.selected=parseInt(i._cookie(),10);if(typeof j.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)j.selected= +this.lis.index(this.lis.filter(".ui-tabs-selected"));j.selected=j.selected||(this.lis.length?0:-1)}else if(j.selected===null)j.selected=-1;j.selected=j.selected>=0&&this.anchors[j.selected]||j.selected<0?j.selected:0;j.disabled=b.unique(j.disabled.concat(b.map(this.lis.filter(".ui-state-disabled"),function(r){return i.lis.index(r)}))).sort();b.inArray(j.selected,j.disabled)!=-1&&j.disabled.splice(b.inArray(j.selected,j.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); +if(j.selected>=0&&this.anchors.length){i.element.find(i._sanitizeSelector(i.anchors[j.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(j.selected).addClass("ui-tabs-selected ui-state-active");i.element.queue("tabs",function(){i._trigger("show",null,i._ui(i.anchors[j.selected],i.element.find(i._sanitizeSelector(i.anchors[j.selected].hash))))});this.load(j.selected)}b(window).bind("unload",function(){i.lis.add(i.anchors).unbind(".tabs");i.lis=i.anchors=i.panels=null})}else j.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); +this.element[j.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");j.cookie&&this._cookie(j.selected,j.cookie);d=0;for(var q;q=this.lis[d];d++)b(q)[b.inArray(d,j.disabled)!=-1&&!b(q).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");j.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(j.event!=="mouseover"){var l=function(r,u){u.is(":not(.ui-state-disabled)")&&u.addClass("ui-state-"+r)},k=function(r,u){u.removeClass("ui-state-"+ +r)};this.lis.bind("mouseover.tabs",function(){l("hover",b(this))});this.lis.bind("mouseout.tabs",function(){k("hover",b(this))});this.anchors.bind("focus.tabs",function(){l("focus",b(this).closest("li"))});this.anchors.bind("blur.tabs",function(){k("focus",b(this).closest("li"))})}var m,o;if(j.fx)if(b.isArray(j.fx)){m=j.fx[0];o=j.fx[1]}else m=o=j.fx;var p=o?function(r,u){b(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", +function(){h(u,o);i._trigger("show",null,i._ui(r,u[0]))})}:function(r,u){b(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.removeClass("ui-tabs-hide");i._trigger("show",null,i._ui(r,u[0]))},s=m?function(r,u){u.animate(m,m.duration||"normal",function(){i.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");h(u,m);i.element.dequeue("tabs")})}:function(r,u){i.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");i.element.dequeue("tabs")}; +this.anchors.bind(j.event+".tabs",function(){var r=this,u=b(r).closest("li"),v=i.panels.filter(":not(.ui-tabs-hide)"),w=i.element.find(i._sanitizeSelector(r.hash));if(u.hasClass("ui-tabs-selected")&&!j.collapsible||u.hasClass("ui-state-disabled")||u.hasClass("ui-state-processing")||i.panels.filter(":animated").length||i._trigger("select",null,i._ui(this,w[0]))===false){this.blur();return false}j.selected=i.anchors.index(this);i.abort();if(j.collapsible)if(u.hasClass("ui-tabs-selected")){j.selected= +-1;j.cookie&&i._cookie(j.selected,j.cookie);i.element.queue("tabs",function(){s(r,v)}).dequeue("tabs");this.blur();return false}else if(!v.length){j.cookie&&i._cookie(j.selected,j.cookie);i.element.queue("tabs",function(){p(r,w)});i.load(i.anchors.index(this));this.blur();return false}j.cookie&&i._cookie(j.selected,j.cookie);if(w.length){v.length&&i.element.queue("tabs",function(){s(r,v)});i.element.queue("tabs",function(){p(r,w)});i.load(i.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; +b.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(d){if(typeof d=="string")d=this.anchors.index(this.anchors.filter("[href$="+d+"]"));return d},destroy:function(){var d=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var h= +b.data(this,"href.tabs");if(h)this.href=h;var i=b(this).unbind(".tabs");b.each(["href","load","cache"],function(j,n){i.removeData(n+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){b.data(this,"destroy.tabs")?b(this).remove():b(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});d.cookie&&this._cookie(null,d.cookie);return this},add:function(d, +h,i){if(i===c)i=this.anchors.length;var j=this,n=this.options;h=b(n.tabTemplate.replace(/#\{href\}/g,d).replace(/#\{label\}/g,h));d=!d.indexOf("#")?d.replace("#",""):this._tabId(b("a",h)[0]);h.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var q=j.element.find("#"+d);q.length||(q=b(n.panelTemplate).attr("id",d).data("destroy.tabs",true));q.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(i>=this.lis.length){h.appendTo(this.list);q.appendTo(this.list[0].parentNode)}else{h.insertBefore(this.lis[i]); +q.insertBefore(this.panels[i])}n.disabled=b.map(n.disabled,function(l){return l>=i?++l:l});this._tabify();if(this.anchors.length==1){n.selected=0;h.addClass("ui-tabs-selected ui-state-active");q.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){j._trigger("show",null,j._ui(j.anchors[0],j.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[i],this.panels[i]));return this},remove:function(d){d=this._getIndex(d);var h=this.options,i=this.lis.eq(d).remove(),j=this.panels.eq(d).remove(); +if(i.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(d+(d+1<this.anchors.length?1:-1));h.disabled=b.map(b.grep(h.disabled,function(n){return n!=d}),function(n){return n>=d?--n:n});this._tabify();this._trigger("remove",null,this._ui(i.find("a")[0],j[0]));return this},enable:function(d){d=this._getIndex(d);var h=this.options;if(b.inArray(d,h.disabled)!=-1){this.lis.eq(d).removeClass("ui-state-disabled");h.disabled=b.grep(h.disabled,function(i){return i!=d});this._trigger("enable",null, +this._ui(this.anchors[d],this.panels[d]));return this}},disable:function(d){d=this._getIndex(d);var h=this.options;if(d!=h.selected){this.lis.eq(d).addClass("ui-state-disabled");h.disabled.push(d);h.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[d],this.panels[d]))}return this},select:function(d){d=this._getIndex(d);if(d==-1)if(this.options.collapsible&&this.options.selected!=-1)d=this.options.selected;else return this;this.anchors.eq(d).trigger(this.options.event+".tabs");return this}, +load:function(d){d=this._getIndex(d);var h=this,i=this.options,j=this.anchors.eq(d)[0],n=b.data(j,"load.tabs");this.abort();if(!n||this.element.queue("tabs").length!==0&&b.data(j,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(d).addClass("ui-state-processing");if(i.spinner){var q=b("span",j);q.data("label.tabs",q.html()).html(i.spinner)}this.xhr=b.ajax(b.extend({},i.ajaxOptions,{url:n,success:function(l,k){h.element.find(h._sanitizeSelector(j.hash)).html(l);h._cleanup();i.cache&&b.data(j, +"cache.tabs",true);h._trigger("load",null,h._ui(h.anchors[d],h.panels[d]));try{i.ajaxOptions.success(l,k)}catch(m){}},error:function(l,k){h._cleanup();h._trigger("load",null,h._ui(h.anchors[d],h.panels[d]));try{i.ajaxOptions.error(l,k,d,j)}catch(m){}}}));h.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, +url:function(d,h){this.anchors.eq(d).removeData("cache.tabs").data("load.tabs",h);return this},length:function(){return this.anchors.length}});b.extend(b.ui.tabs,{version:"1.8.7"});b.extend(b.ui.tabs.prototype,{rotation:null,rotate:function(d,h){var i=this,j=this.options,n=i._rotate||(i._rotate=function(q){clearTimeout(i.rotation);i.rotation=setTimeout(function(){var l=j.selected;i.select(++l<i.anchors.length?l:0)},d);q&&q.stopPropagation()});h=i._unrotate||(i._unrotate=!h?function(q){q.clientX&& +i.rotate(null)}:function(){t=j.selected;n()});if(d){this.element.bind("tabsshow",n);this.anchors.bind(j.event+".tabs",h);n()}else{clearTimeout(i.rotation);this.element.unbind("tabsshow",n);this.anchors.unbind(j.event+".tabs",h);delete this._rotate;delete this._unrotate}return this}})})(jQuery); diff --git a/NzbDrone.Web/Scripts/jquery.unobtrusive-ajax.js b/NzbDrone.Web/Scripts/jquery.unobtrusive-ajax.js new file mode 100644 index 000000000..73df9a493 --- /dev/null +++ b/NzbDrone.Web/Scripts/jquery.unobtrusive-ajax.js @@ -0,0 +1,165 @@ +/// <reference path="jquery-1.4.4.js" /> + +/*! +** Unobtrusive Ajax support library for jQuery +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ + +/*jslint white: true, browser: true, onevar: true, undef: true, nomen: true, eqeqeq: true, plusplus: true, bitwise: true, regexp: true, newcap: true, immed: true, strict: false */ +/*global window: false, jQuery: false */ + +(function ($) { + var data_click = "unobtrusiveAjaxClick", + data_validation = "unobtrusiveValidation"; + + function getFunction(code, argNames) { + var fn = window, parts = (code || "").split("."); + while (fn && parts.length) { + fn = fn[parts.shift()]; + } + if (typeof (fn) === "function") { + return fn; + } + argNames.push(code); + return Function.constructor.apply(null, argNames); + } + + function isMethodProxySafe(method) { + return method === "GET" || method === "POST"; + } + + function asyncOnBeforeSend(xhr, method) { + if (!isMethodProxySafe(method)) { + xhr.setRequestHeader("X-HTTP-Method-Override", method); + } + } + + function asyncOnSuccess(element, data, contentType) { + var mode; + + if (contentType.indexOf("application/x-javascript") !== -1) { // jQuery already executes JavaScript for us + return; + } + + mode = (element.getAttribute("data-ajax-mode") || "").toUpperCase(); + $(element.getAttribute("data-ajax-update")).each(function (i, update) { + var top; + + switch (mode) { + case "BEFORE": + top = update.firstChild; + $("<div />").html(data).contents().each(function () { + update.insertBefore(this, top); + }); + break; + case "AFTER": + $("<div />").html(data).contents().each(function () { + update.appendChild(this); + }); + break; + default: + $(update).html(data); + break; + } + }); + } + + function asyncRequest(element, options) { + var confirm, loading, method, duration; + + confirm = element.getAttribute("data-ajax-confirm"); + if (confirm && !window.confirm(confirm)) { + return; + } + + loading = $(element.getAttribute("data-ajax-loading")); + duration = element.getAttribute("data-ajax-loading-duration") || 0; + + $.extend(options, { + type: element.getAttribute("data-ajax-method") || undefined, + url: element.getAttribute("data-ajax-url") || undefined, + beforeSend: function (xhr) { + var result; + asyncOnBeforeSend(xhr, method); + result = getFunction(element.getAttribute("data-ajax-begin"), ["xhr"]).apply(this, arguments); + if (result !== false) { + loading.show(duration); + } + return result; + }, + complete: function () { + loading.hide(duration); + getFunction(element.getAttribute("data-ajax-complete"), ["xhr", "status"]).apply(this, arguments); + }, + success: function (data, status, xhr) { + asyncOnSuccess(element, data, xhr.getResponseHeader("Content-Type") || "text/html"); + getFunction(element.getAttribute("data-ajax-success"), ["data", "status", "xhr"]).apply(this, arguments); + }, + error: getFunction(element.getAttribute("data-ajax-failure"), ["xhr", "status", "error"]) + }); + + options.data.push({ name: "X-Requested-With", value: "XMLHttpRequest" }); + + method = options.type.toUpperCase(); + if (!isMethodProxySafe(method)) { + options.type = "POST"; + options.data.push({ name: "X-HTTP-Method-Override", value: method }); + } + + $.ajax(options); + } + + function validate(form) { + var validationInfo = $(form).data(data_validation); + return !validationInfo || !validationInfo.validate || validationInfo.validate(); + } + + $("a[data-ajax=true]").live("click", function (evt) { + evt.preventDefault(); + asyncRequest(this, { + url: this.href, + type: "GET", + data: [] + }); + }); + + $("form[data-ajax=true] input[type=image]").live("click", function (evt) { + var name = evt.target.name, + $target = $(evt.target), + form = $target.parents("form")[0], + offset = $target.offset(); + + $(form).data(data_click, [ + { name: name + ".x", value: Math.round(evt.pageX - offset.left) }, + { name: name + ".y", value: Math.round(evt.pageY - offset.top) } + ]); + + setTimeout(function () { + $(form).removeData(data_click); + }, 0); + }); + + $("form[data-ajax=true] :submit").live("click", function (evt) { + var name = evt.target.name, + form = $(evt.target).parents("form")[0]; + + $(form).data(data_click, name ? [{ name: name, value: evt.target.value }] : []); + + setTimeout(function () { + $(form).removeData(data_click); + }, 0); + }); + + $("form[data-ajax=true]").live("submit", function (evt) { + var clickInfo = $(this).data(data_click) || []; + evt.preventDefault(); + if (!validate(this)) { + return; + } + asyncRequest(this, { + url: this.action, + type: this.method || "GET", + data: clickInfo.concat($(this).serializeArray()) + }); + }); +}(jQuery)); \ No newline at end of file diff --git a/NzbDrone.Web/Scripts/jquery.unobtrusive-ajax.min.js b/NzbDrone.Web/Scripts/jquery.unobtrusive-ajax.min.js new file mode 100644 index 000000000..3542991c1 --- /dev/null +++ b/NzbDrone.Web/Scripts/jquery.unobtrusive-ajax.min.js @@ -0,0 +1,5 @@ +/* +** Unobtrusive Ajax support library for jQuery +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ +(function(a){var b="unobtrusiveAjaxClick",g="unobtrusiveValidation";function c(d,b){var a=window,c=(d||"").split(".");while(a&&c.length)a=a[c.shift()];if(typeof a==="function")return a;b.push(d);return Function.constructor.apply(null,b)}function d(a){return a==="GET"||a==="POST"}function f(b,a){!d(a)&&b.setRequestHeader("X-HTTP-Method-Override",a)}function h(c,b,e){var d;if(e.indexOf("application/x-javascript")!==-1)return;d=(c.getAttribute("data-ajax-mode")||"").toUpperCase();a(c.getAttribute("data-ajax-update")).each(function(f,c){var e;switch(d){case"BEFORE":e=c.firstChild;a("<div />").html(b).contents().each(function(){c.insertBefore(this,e)});break;case"AFTER":a("<div />").html(b).contents().each(function(){c.appendChild(this)});break;default:a(c).html(b)}})}function e(b,e){var j,k,g,i;j=b.getAttribute("data-ajax-confirm");if(j&&!window.confirm(j))return;k=a(b.getAttribute("data-ajax-loading"));i=b.getAttribute("data-ajax-loading-duration")||0;a.extend(e,{type:b.getAttribute("data-ajax-method")||undefined,url:b.getAttribute("data-ajax-url")||undefined,beforeSend:function(d){var a;f(d,g);a=c(b.getAttribute("data-ajax-begin"),["xhr"]).apply(this,arguments);a!==false&&k.show(i);return a},complete:function(){k.hide(i);c(b.getAttribute("data-ajax-complete"),["xhr","status"]).apply(this,arguments)},success:function(a,e,d){h(b,a,d.getResponseHeader("Content-Type")||"text/html");c(b.getAttribute("data-ajax-success"),["data","status","xhr"]).apply(this,arguments)},error:c(b.getAttribute("data-ajax-failure"),["xhr","status","error"])});e.data.push({name:"X-Requested-With",value:"XMLHttpRequest"});g=e.type.toUpperCase();if(!d(g)){e.type="POST";e.data.push({name:"X-HTTP-Method-Override",value:g})}a.ajax(e)}function i(c){var b=a(c).data(g);return!b||!b.validate||b.validate()}a("a[data-ajax=true]").live("click",function(a){a.preventDefault();e(this,{url:this.href,type:"GET",data:[]})});a("form[data-ajax=true] input[type=image]").live("click",function(c){var g=c.target.name,d=a(c.target),f=d.parents("form")[0],e=d.offset();a(f).data(b,[{name:g+".x",value:Math.round(c.pageX-e.left)},{name:g+".y",value:Math.round(c.pageY-e.top)}]);setTimeout(function(){a(f).removeData(b)},0)});a("form[data-ajax=true] :submit").live("click",function(c){var e=c.target.name,d=a(c.target).parents("form")[0];a(d).data(b,e?[{name:e,value:c.target.value}]:[]);setTimeout(function(){a(d).removeData(b)},0)});a("form[data-ajax=true]").live("submit",function(d){var c=a(this).data(b)||[];d.preventDefault();if(!i(this))return;e(this,{url:this.action,type:this.method||"GET",data:c.concat(a(this).serializeArray())})})})(jQuery); \ No newline at end of file diff --git a/NzbDrone.Web/Scripts/jquery.validate.min.js b/NzbDrone.Web/Scripts/jquery.validate.min.js new file mode 100644 index 000000000..f55991702 --- /dev/null +++ b/NzbDrone.Web/Scripts/jquery.validate.min.js @@ -0,0 +1,20 @@ +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery validation plug-in 1.7 + * + * http://bassistance.de/jquery-plugins/jquery-plugin-validation/ + * http://docs.jquery.com/Plugins/Validation + * + * Copyright (c) 2006 - 2008 Jörn Zaefferer + * + * $Id: jquery.validate.js 6403 2009-06-17 14:27:16Z joern.zaefferer $ + * + */ +(function($){$.extend($.fn,{validate:function(options){if(!this.length){options&&options.debug&&window.console&&console.warn("nothing selected, can't validate, returning nothing");return;}var validator=$.data(this[0],'validator');if(validator){return validator;}validator=new $.validator(options,this[0]);$.data(this[0],'validator',validator);if(validator.settings.onsubmit){this.find("input, button").filter(".cancel").click(function(){validator.cancelSubmit=true;});if(validator.settings.submitHandler){this.find("input, button").filter(":submit").click(function(){validator.submitButton=this;});}this.submit(function(event){if(validator.settings.debug)event.preventDefault();function handle(){if(validator.settings.submitHandler){if(validator.submitButton){var hidden=$("<input type='hidden'/>").attr("name",validator.submitButton.name).val(validator.submitButton.value).appendTo(validator.currentForm);}validator.settings.submitHandler.call(validator,validator.currentForm);if(validator.submitButton){hidden.remove();}return false;}return true;}if(validator.cancelSubmit){validator.cancelSubmit=false;return handle();}if(validator.form()){if(validator.pendingRequest){validator.formSubmitted=true;return false;}return handle();}else{validator.focusInvalid();return false;}});}return validator;},valid:function(){if($(this[0]).is('form')){return this.validate().form();}else{var valid=true;var validator=$(this[0].form).validate();this.each(function(){valid&=validator.element(this);});return valid;}},removeAttrs:function(attributes){var result={},$element=this;$.each(attributes.split(/\s/),function(index,value){result[value]=$element.attr(value);$element.removeAttr(value);});return result;},rules:function(command,argument){var element=this[0];if(command){var settings=$.data(element.form,'validator').settings;var staticRules=settings.rules;var existingRules=$.validator.staticRules(element);switch(command){case"add":$.extend(existingRules,$.validator.normalizeRule(argument));staticRules[element.name]=existingRules;if(argument.messages)settings.messages[element.name]=$.extend(settings.messages[element.name],argument.messages);break;case"remove":if(!argument){delete staticRules[element.name];return existingRules;}var filtered={};$.each(argument.split(/\s/),function(index,method){filtered[method]=existingRules[method];delete existingRules[method];});return filtered;}}var data=$.validator.normalizeRules($.extend({},$.validator.metadataRules(element),$.validator.classRules(element),$.validator.attributeRules(element),$.validator.staticRules(element)),element);if(data.required){var param=data.required;delete data.required;data=$.extend({required:param},data);}return data;}});$.extend($.expr[":"],{blank:function(a){return!$.trim(""+a.value);},filled:function(a){return!!$.trim(""+a.value);},unchecked:function(a){return!a.checked;}});$.validator=function(options,form){this.settings=$.extend(true,{},$.validator.defaults,options);this.currentForm=form;this.init();};$.validator.format=function(source,params){if(arguments.length==1)return function(){var args=$.makeArray(arguments);args.unshift(source);return $.validator.format.apply(this,args);};if(arguments.length>2&¶ms.constructor!=Array){params=$.makeArray(arguments).slice(1);}if(params.constructor!=Array){params=[params];}$.each(params,function(i,n){source=source.replace(new RegExp("\\{"+i+"\\}","g"),n);});return source;};$.extend($.validator,{defaults:{messages:{},groups:{},rules:{},errorClass:"error",validClass:"valid",errorElement:"label",focusInvalid:true,errorContainer:$([]),errorLabelContainer:$([]),onsubmit:true,ignore:[],ignoreTitle:false,onfocusin:function(element){this.lastActive=element;if(this.settings.focusCleanup&&!this.blockFocusCleanup){this.settings.unhighlight&&this.settings.unhighlight.call(this,element,this.settings.errorClass,this.settings.validClass);this.errorsFor(element).hide();}},onfocusout:function(element){if(!this.checkable(element)&&(element.name in this.submitted||!this.optional(element))){this.element(element);}},onkeyup:function(element){if(element.name in this.submitted||element==this.lastElement){this.element(element);}},onclick:function(element){if(element.name in this.submitted)this.element(element);else if(element.parentNode.name in this.submitted)this.element(element.parentNode);},highlight:function(element,errorClass,validClass){$(element).addClass(errorClass).removeClass(validClass);},unhighlight:function(element,errorClass,validClass){$(element).removeClass(errorClass).addClass(validClass);}},setDefaults:function(settings){$.extend($.validator.defaults,settings);},messages:{required:"This field is required.",remote:"Please fix this field.",email:"Please enter a valid email address.",url:"Please enter a valid URL.",date:"Please enter a valid date.",dateISO:"Please enter a valid date (ISO).",number:"Please enter a valid number.",digits:"Please enter only digits.",creditcard:"Please enter a valid credit card number.",equalTo:"Please enter the same value again.",accept:"Please enter a value with a valid extension.",maxlength:$.validator.format("Please enter no more than {0} characters."),minlength:$.validator.format("Please enter at least {0} characters."),rangelength:$.validator.format("Please enter a value between {0} and {1} characters long."),range:$.validator.format("Please enter a value between {0} and {1}."),max:$.validator.format("Please enter a value less than or equal to {0}."),min:$.validator.format("Please enter a value greater than or equal to {0}.")},autoCreateRanges:false,prototype:{init:function(){this.labelContainer=$(this.settings.errorLabelContainer);this.errorContext=this.labelContainer.length&&this.labelContainer||$(this.currentForm);this.containers=$(this.settings.errorContainer).add(this.settings.errorLabelContainer);this.submitted={};this.valueCache={};this.pendingRequest=0;this.pending={};this.invalid={};this.reset();var groups=(this.groups={});$.each(this.settings.groups,function(key,value){$.each(value.split(/\s/),function(index,name){groups[name]=key;});});var rules=this.settings.rules;$.each(rules,function(key,value){rules[key]=$.validator.normalizeRule(value);});function delegate(event){var validator=$.data(this[0].form,"validator"),eventType="on"+event.type.replace(/^validate/,"");validator.settings[eventType]&&validator.settings[eventType].call(validator,this[0]);}$(this.currentForm).validateDelegate(":text, :password, :file, select, textarea","focusin focusout keyup",delegate).validateDelegate(":radio, :checkbox, select, option","click",delegate);if(this.settings.invalidHandler)$(this.currentForm).bind("invalid-form.validate",this.settings.invalidHandler);},form:function(){this.checkForm();$.extend(this.submitted,this.errorMap);this.invalid=$.extend({},this.errorMap);if(!this.valid())$(this.currentForm).triggerHandler("invalid-form",[this]);this.showErrors();return this.valid();},checkForm:function(){this.prepareForm();for(var i=0,elements=(this.currentElements=this.elements());elements[i];i++){this.check(elements[i]);}return this.valid();},element:function(element){element=this.clean(element);this.lastElement=element;this.prepareElement(element);this.currentElements=$(element);var result=this.check(element);if(result){delete this.invalid[element.name];}else{this.invalid[element.name]=true;}if(!this.numberOfInvalids()){this.toHide=this.toHide.add(this.containers);}this.showErrors();return result;},showErrors:function(errors){if(errors){$.extend(this.errorMap,errors);this.errorList=[];for(var name in errors){this.errorList.push({message:errors[name],element:this.findByName(name)[0]});}this.successList=$.grep(this.successList,function(element){return!(element.name in errors);});}this.settings.showErrors?this.settings.showErrors.call(this,this.errorMap,this.errorList):this.defaultShowErrors();},resetForm:function(){if($.fn.resetForm)$(this.currentForm).resetForm();this.submitted={};this.prepareForm();this.hideErrors();this.elements().removeClass(this.settings.errorClass);},numberOfInvalids:function(){return this.objectLength(this.invalid);},objectLength:function(obj){var count=0;for(var i in obj)count++;return count;},hideErrors:function(){this.addWrapper(this.toHide).hide();},valid:function(){return this.size()==0;},size:function(){return this.errorList.length;},focusInvalid:function(){if(this.settings.focusInvalid){try{$(this.findLastActive()||this.errorList.length&&this.errorList[0].element||[]).filter(":visible").focus().trigger("focusin");}catch(e){}}},findLastActive:function(){var lastActive=this.lastActive;return lastActive&&$.grep(this.errorList,function(n){return n.element.name==lastActive.name;}).length==1&&lastActive;},elements:function(){var validator=this,rulesCache={};return $([]).add(this.currentForm.elements).filter(":input").not(":submit, :reset, :image, [disabled]").not(this.settings.ignore).filter(function(){!this.name&&validator.settings.debug&&window.console&&console.error("%o has no name assigned",this);if(this.name in rulesCache||!validator.objectLength($(this).rules()))return false;rulesCache[this.name]=true;return true;});},clean:function(selector){return $(selector)[0];},errors:function(){return $(this.settings.errorElement+"."+this.settings.errorClass,this.errorContext);},reset:function(){this.successList=[];this.errorList=[];this.errorMap={};this.toShow=$([]);this.toHide=$([]);this.currentElements=$([]);},prepareForm:function(){this.reset();this.toHide=this.errors().add(this.containers);},prepareElement:function(element){this.reset();this.toHide=this.errorsFor(element);},check:function(element){element=this.clean(element);if(this.checkable(element)){element=this.findByName(element.name)[0];}var rules=$(element).rules();var dependencyMismatch=false;for(method in rules){var rule={method:method,parameters:rules[method]};try{var result=$.validator.methods[method].call(this,element.value.replace(/\r/g,""),element,rule.parameters);if(result=="dependency-mismatch"){dependencyMismatch=true;continue;}dependencyMismatch=false;if(result=="pending"){this.toHide=this.toHide.not(this.errorsFor(element));return;}if(!result){this.formatAndAdd(element,rule);return false;}}catch(e){this.settings.debug&&window.console&&console.log("exception occured when checking element "+element.id ++", check the '"+rule.method+"' method",e);throw e;}}if(dependencyMismatch)return;if(this.objectLength(rules))this.successList.push(element);return true;},customMetaMessage:function(element,method){if(!$.metadata)return;var meta=this.settings.meta?$(element).metadata()[this.settings.meta]:$(element).metadata();return meta&&meta.messages&&meta.messages[method];},customMessage:function(name,method){var m=this.settings.messages[name];return m&&(m.constructor==String?m:m[method]);},findDefined:function(){for(var i=0;i<arguments.length;i++){if(arguments[i]!==undefined)return arguments[i];}return undefined;},defaultMessage:function(element,method){return this.findDefined(this.customMessage(element.name,method),this.customMetaMessage(element,method),!this.settings.ignoreTitle&&element.title||undefined,$.validator.messages[method],"<strong>Warning: No message defined for "+element.name+"</strong>");},formatAndAdd:function(element,rule){var message=this.defaultMessage(element,rule.method),theregex=/\$?\{(\d+)\}/g;if(typeof message=="function"){message=message.call(this,rule.parameters,element);}else if(theregex.test(message)){message=jQuery.format(message.replace(theregex,'{$1}'),rule.parameters);}this.errorList.push({message:message,element:element});this.errorMap[element.name]=message;this.submitted[element.name]=message;},addWrapper:function(toToggle){if(this.settings.wrapper)toToggle=toToggle.add(toToggle.parent(this.settings.wrapper));return toToggle;},defaultShowErrors:function(){for(var i=0;this.errorList[i];i++){var error=this.errorList[i];this.settings.highlight&&this.settings.highlight.call(this,error.element,this.settings.errorClass,this.settings.validClass);this.showLabel(error.element,error.message);}if(this.errorList.length){this.toShow=this.toShow.add(this.containers);}if(this.settings.success){for(var i=0;this.successList[i];i++){this.showLabel(this.successList[i]);}}if(this.settings.unhighlight){for(var i=0,elements=this.validElements();elements[i];i++){this.settings.unhighlight.call(this,elements[i],this.settings.errorClass,this.settings.validClass);}}this.toHide=this.toHide.not(this.toShow);this.hideErrors();this.addWrapper(this.toShow).show();},validElements:function(){return this.currentElements.not(this.invalidElements());},invalidElements:function(){return $(this.errorList).map(function(){return this.element;});},showLabel:function(element,message){var label=this.errorsFor(element);if(label.length){label.removeClass().addClass(this.settings.errorClass);label.attr("generated")&&label.html(message);}else{label=$("<"+this.settings.errorElement+"/>").attr({"for":this.idOrName(element),generated:true}).addClass(this.settings.errorClass).html(message||"");if(this.settings.wrapper){label=label.hide().show().wrap("<"+this.settings.wrapper+"/>").parent();}if(!this.labelContainer.append(label).length)this.settings.errorPlacement?this.settings.errorPlacement(label,$(element)):label.insertAfter(element);}if(!message&&this.settings.success){label.text("");typeof this.settings.success=="string"?label.addClass(this.settings.success):this.settings.success(label);}this.toShow=this.toShow.add(label);},errorsFor:function(element){var name=this.idOrName(element);return this.errors().filter(function(){return $(this).attr('for')==name;});},idOrName:function(element){return this.groups[element.name]||(this.checkable(element)?element.name:element.id||element.name);},checkable:function(element){return/radio|checkbox/i.test(element.type);},findByName:function(name){var form=this.currentForm;return $(document.getElementsByName(name)).map(function(index,element){return element.form==form&&element.name==name&&element||null;});},getLength:function(value,element){switch(element.nodeName.toLowerCase()){case'select':return $("option:selected",element).length;case'input':if(this.checkable(element))return this.findByName(element.name).filter(':checked').length;}return value.length;},depend:function(param,element){return this.dependTypes[typeof param]?this.dependTypes[typeof param](param,element):true;},dependTypes:{"boolean":function(param,element){return param;},"string":function(param,element){return!!$(param,element.form).length;},"function":function(param,element){return param(element);}},optional:function(element){return!$.validator.methods.required.call(this,$.trim(element.value),element)&&"dependency-mismatch";},startRequest:function(element){if(!this.pending[element.name]){this.pendingRequest++;this.pending[element.name]=true;}},stopRequest:function(element,valid){this.pendingRequest--;if(this.pendingRequest<0)this.pendingRequest=0;delete this.pending[element.name];if(valid&&this.pendingRequest==0&&this.formSubmitted&&this.form()){$(this.currentForm).submit();this.formSubmitted=false;}else if(!valid&&this.pendingRequest==0&&this.formSubmitted){$(this.currentForm).triggerHandler("invalid-form",[this]);this.formSubmitted=false;}},previousValue:function(element){return $.data(element,"previousValue")||$.data(element,"previousValue",{old:null,valid:true,message:this.defaultMessage(element,"remote")});}},classRuleSettings:{required:{required:true},email:{email:true},url:{url:true},date:{date:true},dateISO:{dateISO:true},dateDE:{dateDE:true},number:{number:true},numberDE:{numberDE:true},digits:{digits:true},creditcard:{creditcard:true}},addClassRules:function(className,rules){className.constructor==String?this.classRuleSettings[className]=rules:$.extend(this.classRuleSettings,className);},classRules:function(element){var rules={};var classes=$(element).attr('class');classes&&$.each(classes.split(' '),function(){if(this in $.validator.classRuleSettings){$.extend(rules,$.validator.classRuleSettings[this]);}});return rules;},attributeRules:function(element){var rules={};var $element=$(element);for(method in $.validator.methods){var value=$element.attr(method);if(value){rules[method]=value;}}if(rules.maxlength&&/-1|2147483647|524288/.test(rules.maxlength)){delete rules.maxlength;}return rules;},metadataRules:function(element){if(!$.metadata)return{};var meta=$.data(element.form,'validator').settings.meta;return meta?$(element).metadata()[meta]:$(element).metadata();},staticRules:function(element){var rules={};var validator=$.data(element.form,'validator');if(validator.settings.rules){rules=$.validator.normalizeRule(validator.settings.rules[element.name])||{};}return rules;},normalizeRules:function(rules,element){$.each(rules,function(prop,val){if(val===false){delete rules[prop];return;}if(val.param||val.depends){var keepRule=true;switch(typeof val.depends){case"string":keepRule=!!$(val.depends,element.form).length;break;case"function":keepRule=val.depends.call(element,element);break;}if(keepRule){rules[prop]=val.param!==undefined?val.param:true;}else{delete rules[prop];}}});$.each(rules,function(rule,parameter){rules[rule]=$.isFunction(parameter)?parameter(element):parameter;});$.each(['minlength','maxlength','min','max'],function(){if(rules[this]){rules[this]=Number(rules[this]);}});$.each(['rangelength','range'],function(){if(rules[this]){rules[this]=[Number(rules[this][0]),Number(rules[this][1])];}});if($.validator.autoCreateRanges){if(rules.min&&rules.max){rules.range=[rules.min,rules.max];delete rules.min;delete rules.max;}if(rules.minlength&&rules.maxlength){rules.rangelength=[rules.minlength,rules.maxlength];delete rules.minlength;delete rules.maxlength;}}if(rules.messages){delete rules.messages;}return rules;},normalizeRule:function(data){if(typeof data=="string"){var transformed={};$.each(data.split(/\s/),function(){transformed[this]=true;});data=transformed;}return data;},addMethod:function(name,method,message){$.validator.methods[name]=method;$.validator.messages[name]=message!=undefined?message:$.validator.messages[name];if(method.length<3){$.validator.addClassRules(name,$.validator.normalizeRule(name));}},methods:{required:function(value,element,param){if(!this.depend(param,element))return"dependency-mismatch";switch(element.nodeName.toLowerCase()){case'select':var val=$(element).val();return val&&val.length>0;case'input':if(this.checkable(element))return this.getLength(value,element)>0;default:return $.trim(value).length>0;}},remote:function(value,element,param){if(this.optional(element))return"dependency-mismatch";var previous=this.previousValue(element);if(!this.settings.messages[element.name])this.settings.messages[element.name]={};previous.originalMessage=this.settings.messages[element.name].remote;this.settings.messages[element.name].remote=previous.message;param=typeof param=="string"&&{url:param}||param;if(previous.old!==value){previous.old=value;var validator=this;this.startRequest(element);var data={};data[element.name]=value;$.ajax($.extend(true,{url:param,mode:"abort",port:"validate"+element.name,dataType:"json",data:data,success:function(response){validator.settings.messages[element.name].remote=previous.originalMessage;var valid=response===true;if(valid){var submitted=validator.formSubmitted;validator.prepareElement(element);validator.formSubmitted=submitted;validator.successList.push(element);validator.showErrors();}else{var errors={};var message=(previous.message=response||validator.defaultMessage(element,"remote"));errors[element.name]=$.isFunction(message)?message(value):message;validator.showErrors(errors);}previous.valid=valid;validator.stopRequest(element,valid);}},param));return"pending";}else if(this.pending[element.name]){return"pending";}return previous.valid;},minlength:function(value,element,param){return this.optional(element)||this.getLength($.trim(value),element)>=param;},maxlength:function(value,element,param){return this.optional(element)||this.getLength($.trim(value),element)<=param;},rangelength:function(value,element,param){var length=this.getLength($.trim(value),element);return this.optional(element)||(length>=param[0]&&length<=param[1]);},min:function(value,element,param){return this.optional(element)||value>=param;},max:function(value,element,param){return this.optional(element)||value<=param;},range:function(value,element,param){return this.optional(element)||(value>=param[0]&&value<=param[1]);},email:function(value,element){return this.optional(element)||/^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?$/i.test(value);},url:function(value,element){return this.optional(element)||/^(https?|ftp):\/\/(((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?$/i.test(value);},date:function(value,element){return this.optional(element)||!/Invalid|NaN/.test(new Date(value));},dateISO:function(value,element){return this.optional(element)||/^\d{4}[\/-]\d{1,2}[\/-]\d{1,2}$/.test(value);},number:function(value,element){return this.optional(element)||/^-?(?:\d+|\d{1,3}(?:,\d{3})+)(?:\.\d+)?$/.test(value);},digits:function(value,element){return this.optional(element)||/^\d+$/.test(value);},creditcard:function(value,element){if(this.optional(element))return"dependency-mismatch";if(/[^0-9-]+/.test(value))return false;var nCheck=0,nDigit=0,bEven=false;value=value.replace(/\D/g,"");for(var n=value.length-1;n>=0;n--){var cDigit=value.charAt(n);var nDigit=parseInt(cDigit,10);if(bEven){if((nDigit*=2)>9)nDigit-=9;}nCheck+=nDigit;bEven=!bEven;}return(nCheck%10)==0;},accept:function(value,element,param){param=typeof param=="string"?param.replace(/,/g,'|'):"png|jpe?g|gif";return this.optional(element)||value.match(new RegExp(".("+param+")$","i"));},equalTo:function(value,element,param){var target=$(param).unbind(".validate-equalTo").bind("blur.validate-equalTo",function(){$(element).valid();});return value==target.val();}}});$.format=$.validator.format;})(jQuery);;(function($){var ajax=$.ajax;var pendingRequests={};$.ajax=function(settings){settings=$.extend(settings,$.extend({},$.ajaxSettings,settings));var port=settings.port;if(settings.mode=="abort"){if(pendingRequests[port]){pendingRequests[port].abort();}return(pendingRequests[port]=ajax.apply(this,arguments));}return ajax.apply(this,arguments);};})(jQuery);;(function($){if(!jQuery.event.special.focusin&&!jQuery.event.special.focusout&&document.addEventListener){$.each({focus:'focusin',blur:'focusout'},function(original,fix){$.event.special[fix]={setup:function(){this.addEventListener(original,handler,true);},teardown:function(){this.removeEventListener(original,handler,true);},handler:function(e){arguments[0]=$.event.fix(e);arguments[0].type=fix;return $.event.handle.apply(this,arguments);}};function handler(e){e=$.event.fix(e);e.type=fix;return $.event.handle.call(this,e);}});};$.extend($.fn,{validateDelegate:function(delegate,type,handler){return this.bind(type,function(event){var target=$(event.target);if(target.is(delegate)){return handler.apply(target,arguments);}});}});})(jQuery); \ No newline at end of file diff --git a/NzbDrone.Web/Scripts/jquery.validate.unobtrusive.js b/NzbDrone.Web/Scripts/jquery.validate.unobtrusive.js new file mode 100644 index 000000000..1c33e59d6 --- /dev/null +++ b/NzbDrone.Web/Scripts/jquery.validate.unobtrusive.js @@ -0,0 +1,319 @@ +/// <reference path="jquery-1.4.4.js" /> +/// <reference path="jquery.validate.js" /> + +/*! +** Unobtrusive validation support library for jQuery and jQuery Validate +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ + +/*jslint white: true, browser: true, onevar: true, undef: true, nomen: true, eqeqeq: true, plusplus: true, bitwise: true, regexp: true, newcap: true, immed: true, strict: false */ +/*global document: false, jQuery: false */ + +(function ($) { + var $jQval = $.validator, + adapters, + data_validation = "unobtrusiveValidation"; + + function setValidationValues(options, ruleName, value) { + options.rules[ruleName] = value; + if (options.message) { + options.messages[ruleName] = options.message; + } + } + + function splitAndTrim(value) { + return value.replace(/^\s+|\s+$/g, "").split(/\s*,\s*/g); + } + + function getModelPrefix(fieldName) { + return fieldName.substr(0, fieldName.lastIndexOf(".") + 1); + } + + function appendModelPrefix(value, prefix) { + if (value.indexOf("*.") === 0) { + value = value.replace("*.", prefix); + } + return value; + } + + function onError(error, inputElement) { // 'this' is the form element + var container = $(this).find("[data-valmsg-for='" + inputElement[0].name + "']"), + replace = $.parseJSON(container.attr("data-valmsg-replace")) !== false; + + container.removeClass("field-validation-valid").addClass("field-validation-error"); + error.data("unobtrusiveContainer", container); + + if (replace) { + container.empty(); + error.removeClass("input-validation-error").appendTo(container); + } + else { + error.hide(); + } + } + + function onErrors(form, validator) { // 'this' is the form element + var container = $(this).find("[data-valmsg-summary=true]"), + list = container.find("ul"); + + if (list && list.length && validator.errorList.length) { + list.empty(); + container.addClass("validation-summary-errors").removeClass("validation-summary-valid"); + + $.each(validator.errorList, function () { + $("<li />").html(this.message).appendTo(list); + }); + } + } + + function onSuccess(error) { // 'this' is the form element + var container = error.data("unobtrusiveContainer"), + replace = $.parseJSON(container.attr("data-valmsg-replace")); + + if (container) { + container.addClass("field-validation-valid").removeClass("field-validation-error"); + error.removeData("unobtrusiveContainer"); + + if (replace) { + container.empty(); + } + } + } + + function validationInfo(form) { + var $form = $(form), + result = $form.data(data_validation); + + if (!result) { + result = { + options: { // options structure passed to jQuery Validate's validate() method + errorClass: "input-validation-error", + errorElement: "span", + errorPlacement: $.proxy(onError, form), + invalidHandler: $.proxy(onErrors, form), + messages: {}, + rules: {}, + success: $.proxy(onSuccess, form) + }, + attachValidation: function () { + $form.validate(this.options); + }, + validate: function () { // a validation function that is called by unobtrusive Ajax + $form.validate(); + return $form.valid(); + } + }; + $form.data(data_validation, result); + } + + return result; + } + + $jQval.unobtrusive = { + adapters: [], + + parseElement: function (element, skipAttach) { + /// <summary> + /// Parses a single HTML element for unobtrusive validation attributes. + /// </summary> + /// <param name="element" domElement="true">The HTML element to be parsed.</param> + /// <param name="skipAttach" type="Boolean">[Optional] true to skip attaching the + /// validation to the form. If parsing just this single element, you should specify true. + /// If parsing several elements, you should specify false, and manually attach the validation + /// to the form when you are finished. The default is false.</param> + var $element = $(element), + form = $element.parents("form")[0], + valInfo, rules, messages; + + if (!form) { // Cannot do client-side validation without a form + return; + } + + valInfo = validationInfo(form); + valInfo.options.rules[element.name] = rules = {}; + valInfo.options.messages[element.name] = messages = {}; + + $.each(this.adapters, function () { + var prefix = "data-val-" + this.name, + message = $element.attr(prefix), + paramValues = {}; + + if (message !== undefined) { // Compare against undefined, because an empty message is legal (and falsy) + prefix += "-"; + + $.each(this.params, function () { + paramValues[this] = $element.attr(prefix + this); + }); + + this.adapt({ + element: element, + form: form, + message: message, + params: paramValues, + rules: rules, + messages: messages + }); + } + }); + + jQuery.extend(rules, { "__dummy__": true }); + + if (!skipAttach) { + valInfo.attachValidation(); + } + }, + + parse: function (selector) { + /// <summary> + /// Parses all the HTML elements in the specified selector. It looks for input elements decorated + /// with the [data-val=true] attribute value and enables validation according to the data-val-* + /// attribute values. + /// </summary> + /// <param name="selector" type="String">Any valid jQuery selector.</param> + $(selector).find(":input[data-val=true]").each(function () { + $jQval.unobtrusive.parseElement(this, true); + }); + + $("form").each(function () { + var info = validationInfo(this); + if (info) { + info.attachValidation(); + } + }); + } + }; + + adapters = $jQval.unobtrusive.adapters; + + adapters.add = function (adapterName, params, fn) { + /// <summary>Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation.</summary> + /// <param name="adapterName" type="String">The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute (where nnnn is the adapter name).</param> + /// <param name="params" type="Array" optional="true">[Optional] An array of parameter names (strings) that will + /// be extracted from the data-val-nnnn-mmmm HTML attributes (where nnnn is the adapter name, and + /// mmmm is the parameter name).</param> + /// <param name="fn" type="Function">The function to call, which adapts the values from the HTML + /// attributes into jQuery Validate rules and/or messages.</param> + /// <returns type="jQuery.validator.unobtrusive.adapters" /> + if (!fn) { // Called with no params, just a function + fn = params; + params = []; + } + this.push({ name: adapterName, params: params, adapt: fn }); + return this; + }; + + adapters.addBool = function (adapterName, ruleName) { + /// <summary>Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation, where + /// the jQuery Validate validation rule has no parameter values.</summary> + /// <param name="adapterName" type="String">The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute (where nnnn is the adapter name).</param> + /// <param name="ruleName" type="String" optional="true">[Optional] The name of the jQuery Validate rule. If not provided, the value + /// of adapterName will be used instead.</param> + /// <returns type="jQuery.validator.unobtrusive.adapters" /> + return this.add(adapterName, function (options) { + setValidationValues(options, ruleName || adapterName, true); + }); + }; + + adapters.addMinMax = function (adapterName, minRuleName, maxRuleName, minMaxRuleName, minAttribute, maxAttribute) { + /// <summary>Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation, where + /// the jQuery Validate validation has three potential rules (one for min-only, one for max-only, and + /// one for min-and-max). The HTML parameters are expected to be named -min and -max.</summary> + /// <param name="adapterName" type="String">The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute (where nnnn is the adapter name).</param> + /// <param name="minRuleName" type="String">The name of the jQuery Validate rule to be used when you only + /// have a minimum value.</param> + /// <param name="maxRuleName" type="String">The name of the jQuery Validate rule to be used when you only + /// have a maximum value.</param> + /// <param name="minMaxRuleName" type="String">The name of the jQuery Validate rule to be used when you + /// have both a minimum and maximum value.</param> + /// <param name="minAttribute" type="String" optional="true">[Optional] The name of the HTML attribute that + /// contains the minimum value. The default is "min".</param> + /// <param name="maxAttribute" type="String" optional="true">[Optional] The name of the HTML attribute that + /// contains the maximum value. The default is "max".</param> + /// <returns type="jQuery.validator.unobtrusive.adapters" /> + return this.add(adapterName, [minAttribute || "min", maxAttribute || "max"], function (options) { + var min = options.params.min, + max = options.params.max; + + if (min && max) { + setValidationValues(options, minMaxRuleName, [min, max]); + } + else if (min) { + setValidationValues(options, minRuleName, min); + } + else if (max) { + setValidationValues(options, maxRuleName, max); + } + }); + }; + + adapters.addSingleVal = function (adapterName, attribute, ruleName) { + /// <summary>Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation, where + /// the jQuery Validate validation rule has a single value.</summary> + /// <param name="adapterName" type="String">The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute(where nnnn is the adapter name).</param> + /// <param name="attribute" type="String">[Optional] The name of the HTML attribute that contains the value. + /// The default is "val".</param> + /// <param name="ruleName" type="String" optional="true">[Optional] The name of the jQuery Validate rule. If not provided, the value + /// of adapterName will be used instead.</param> + /// <returns type="jQuery.validator.unobtrusive.adapters" /> + return this.add(adapterName, [attribute || "val"], function (options) { + setValidationValues(options, ruleName || adapterName, options.params[attribute]); + }); + }; + + $jQval.addMethod("__dummy__", function (value, element, params) { + return true; + }); + + $jQval.addMethod("regex", function (value, element, params) { + var match; + if (this.optional(element)) { + return true; + } + + match = new RegExp(params).exec(value); + return (match && (match.index === 0) && (match[0].length === value.length)); + }); + + adapters.addSingleVal("accept", "exts").addSingleVal("regex", "pattern"); + adapters.addBool("creditcard").addBool("date").addBool("digits").addBool("email").addBool("number").addBool("url"); + adapters.addMinMax("length", "minlength", "maxlength", "rangelength").addMinMax("range", "min", "max", "range"); + adapters.add("equalto", ["other"], function (options) { + var prefix = getModelPrefix(options.element.name), + other = options.params.other, + fullOtherName = appendModelPrefix(other, prefix), + element = $(options.form).find(":input[name=" + fullOtherName + "]")[0]; + + setValidationValues(options, "equalTo", element); + }); + adapters.add("required", function (options) { + // jQuery Validate equates "required" with "mandatory" for checkbox elements + if (options.element.tagName.toUpperCase() !== "INPUT" || options.element.type.toUpperCase() !== "CHECKBOX") { + setValidationValues(options, "required", true); + } + }); + adapters.add("remote", ["url", "type", "additionalfields"], function (options) { + var value = { + url: options.params.url, + type: options.params.type || "GET", + data: {} + }, + prefix = getModelPrefix(options.element.name); + + $.each(splitAndTrim(options.params.additionalfields || options.element.name), function (i, fieldName) { + var paramName = appendModelPrefix(fieldName, prefix); + value.data[paramName] = function () { + return $(options.form).find(":input[name='" + paramName + "']").val(); + }; + }); + + setValidationValues(options, "remote", value); + }); + + $(function () { + $jQval.unobtrusive.parse(document); + }); +}(jQuery)); \ No newline at end of file diff --git a/NzbDrone.Web/Scripts/jquery.validate.unobtrusive.min.js b/NzbDrone.Web/Scripts/jquery.validate.unobtrusive.min.js new file mode 100644 index 000000000..e0d8fd5c1 --- /dev/null +++ b/NzbDrone.Web/Scripts/jquery.validate.unobtrusive.min.js @@ -0,0 +1,5 @@ +/* +** Unobtrusive validation support library for jQuery and jQuery Validate +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ +(function(a){var d=a.validator,b,f="unobtrusiveValidation";function c(a,b,c){a.rules[b]=c;if(a.message)a.messages[b]=a.message}function i(a){return a.replace(/^\s+|\s+$/g,"").split(/\s*,\s*/g)}function g(a){return a.substr(0,a.lastIndexOf(".")+1)}function e(a,b){if(a.indexOf("*.")===0)a=a.replace("*.",b);return a}function l(c,d){var b=a(this).find("[data-valmsg-for='"+d[0].name+"']"),e=a.parseJSON(b.attr("data-valmsg-replace"))!==false;b.removeClass("field-validation-valid").addClass("field-validation-error");c.data("unobtrusiveContainer",b);if(e){b.empty();c.removeClass("input-validation-error").appendTo(b)}else c.hide()}function k(e,d){var c=a(this).find("[data-valmsg-summary=true]"),b=c.find("ul");if(b&&b.length&&d.errorList.length){b.empty();c.addClass("validation-summary-errors").removeClass("validation-summary-valid");a.each(d.errorList,function(){a("<li />").html(this.message).appendTo(b)})}}function j(c){var b=c.data("unobtrusiveContainer"),d=a.parseJSON(b.attr("data-valmsg-replace"));if(b){b.addClass("field-validation-valid").removeClass("field-validation-error");c.removeData("unobtrusiveContainer");d&&b.empty()}}function h(d){var b=a(d),c=b.data(f);if(!c){c={options:{errorClass:"input-validation-error",errorElement:"span",errorPlacement:a.proxy(l,d),invalidHandler:a.proxy(k,d),messages:{},rules:{},success:a.proxy(j,d)},attachValidation:function(){b.validate(this.options)},validate:function(){b.validate();return b.valid()}};b.data(f,c)}return c}d.unobtrusive={adapters:[],parseElement:function(b,i){var d=a(b),f=d.parents("form")[0],c,e,g;if(!f)return;c=h(f);c.options.rules[b.name]=e={};c.options.messages[b.name]=g={};a.each(this.adapters,function(){var c="data-val-"+this.name,i=d.attr(c),h={};if(i!==undefined){c+="-";a.each(this.params,function(){h[this]=d.attr(c+this)});this.adapt({element:b,form:f,message:i,params:h,rules:e,messages:g})}});jQuery.extend(e,{__dummy__:true});!i&&c.attachValidation()},parse:function(b){a(b).find(":input[data-val=true]").each(function(){d.unobtrusive.parseElement(this,true)});a("form").each(function(){var a=h(this);a&&a.attachValidation()})}};b=d.unobtrusive.adapters;b.add=function(c,a,b){if(!b){b=a;a=[]}this.push({name:c,params:a,adapt:b});return this};b.addBool=function(a,b){return this.add(a,function(d){c(d,b||a,true)})};b.addMinMax=function(e,g,f,a,d,b){return this.add(e,[d||"min",b||"max"],function(b){var e=b.params.min,d=b.params.max;if(e&&d)c(b,a,[e,d]);else if(e)c(b,g,e);else d&&c(b,f,d)})};b.addSingleVal=function(a,b,d){return this.add(a,[b||"val"],function(e){c(e,d||a,e.params[b])})};d.addMethod("__dummy__",function(){return true});d.addMethod("regex",function(b,c,d){var a;if(this.optional(c))return true;a=(new RegExp(d)).exec(b);return a&&a.index===0&&a[0].length===b.length});b.addSingleVal("accept","exts").addSingleVal("regex","pattern");b.addBool("creditcard").addBool("date").addBool("digits").addBool("email").addBool("number").addBool("url");b.addMinMax("length","minlength","maxlength","rangelength").addMinMax("range","min","max","range");b.add("equalto",["other"],function(b){var h=g(b.element.name),i=b.params.other,d=e(i,h),f=a(b.form).find(":input[name="+d+"]")[0];c(b,"equalTo",f)});b.add("required",function(a){(a.element.tagName.toUpperCase()!=="INPUT"||a.element.type.toUpperCase()!=="CHECKBOX")&&c(a,"required",true)});b.add("remote",["url","type","additionalfields"],function(b){var d={url:b.params.url,type:b.params.type||"GET",data:{}},f=g(b.element.name);a.each(i(b.params.additionalfields||b.element.name),function(h,g){var c=e(g,f);d.data[c]=function(){return a(b.form).find(":input[name='"+c+"']").val()}});c(b,"remote",d)});a(function(){d.unobtrusive.parse(document)})})(jQuery); \ No newline at end of file diff --git a/NzbDrone.Web/Views/AddSeries/AddSeriesItem.ascx b/NzbDrone.Web/Views/AddSeries/AddSeriesItem.cshtml similarity index 70% rename from NzbDrone.Web/Views/AddSeries/AddSeriesItem.ascx rename to NzbDrone.Web/Views/AddSeries/AddSeriesItem.cshtml index 3d59069f7..37f2b0845 100644 --- a/NzbDrone.Web/Views/AddSeries/AddSeriesItem.ascx +++ b/NzbDrone.Web/Views/AddSeries/AddSeriesItem.cshtml @@ -1,12 +1,11 @@ -<%@ Control Language="C#" Inherits="System.Web.Mvc.ViewUserControl<SelectList>" %> -<div style="position: relative; padding: 10px" id="div_<%:ViewData["guid"] %>"> +@model SelectList +<div style="position: relative; padding: 10px" id="div_ @ViewData["guid"]"> <div style="position: relative; left: 0; width: 50%;"> - <%=ViewData["path"].ToString() %> + @ViewData["path"].ToString() </div> <div style="position: relative; right: 0; width: 50%;"> - <% - Html.Telerik().ComboBox() - .Name(ViewData["guid"].ToString()) + @(Html.Telerik().ComboBox() + .Name(ViewData["guid"].ToString()) // .AutoFill(true) .BindTo(Model) // .DataBinding(b => b.Ajax().Select("TvDbLookup", "AddSeries")) @@ -15,17 +14,15 @@ .Filterable(f => f.FilterMode(AutoCompleteFilterMode.Contains)) .HighlightFirstMatch(true) .HtmlAttributes(new { style = "width:70%; align:right" }) - .SelectedIndex(0) - .Render(); - %> - <button class="listButton" onclick="addSeries('<%:ViewData["guid"] %>','<%= ViewData["javaPath"].ToString()%>' )"> + .SelectedIndex(0)) + <button class="listButton" onclick="addSeries('@ViewData["guid"]','@ViewData["javaPath"].ToString()' )"> Add</button> </div> </div> <script type="text/javascript" language="javascript"> - var addSeriesUrl = '<%= Url.Action("AddSeries", "AddSeries") %>'; + var addSeriesUrl = '@Url.Action("AddSeries", "AddSeries")'; function addSeries(guid, path) { diff --git a/NzbDrone.Web/Views/Web.config b/NzbDrone.Web/Views/Web.config new file mode 100644 index 000000000..24337f62b --- /dev/null +++ b/NzbDrone.Web/Views/Web.config @@ -0,0 +1,21 @@ +<?xml version="1.0"?> +<configuration> + <configSections> + <sectionGroup name="system.web.webPages.razor" type="System.Web.WebPages.Razor.Configuration.RazorWebSectionGroup, System.Web.WebPages.Razor, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"> + <section name="host" type="System.Web.WebPages.Razor.Configuration.HostSection, System.Web.WebPages.Razor, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" requirePermission="false" /> + <section name="pages" type="System.Web.WebPages.Razor.Configuration.RazorPagesSection, System.Web.WebPages.Razor, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" requirePermission="false" /> + </sectionGroup> + </configSections> + <system.web.webPages.razor> + <host factoryType="System.Web.Mvc.MvcWebRazorHostFactory, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + <pages pageBaseType="System.Web.Mvc.WebViewPage"> + <namespaces> + <add namespace="System.Web.Mvc" /> + <add namespace="System.Web.Mvc.Ajax" /> + <add namespace="System.Web.Mvc.Html" /> + <add namespace="System.Web.Routing" /> + <add namespace="Telerik.Web.Mvc.UI" /> + </namespaces> + </pages> + </system.web.webPages.razor> +</configuration> diff --git a/NzbDrone.Web/Web.config b/NzbDrone.Web/Web.config index 48e0f25bb..7a6e98f0d 100644 --- a/NzbDrone.Web/Web.config +++ b/NzbDrone.Web/Web.config @@ -3,7 +3,10 @@ <startup useLegacyV2RuntimeActivationPolicy="true"> <supportedRuntime version="v4.0" /> </startup> - <appSettings /> + <appSettings> + <add key="ClientValidationEnabled" value="false" /> + <add key="UnobtrusiveJavaScriptEnabled" value="false" /> + </appSettings> <system.web> <compilation debug="true" targetFramework="4.0"> <assemblies> @@ -11,31 +14,28 @@ <add assembly="System.Web.Abstractions, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> <add assembly="System.Web.Routing, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> <add assembly="System.Data.Linq, Version=4.0.0.0, Culture=neutral, PublicKeyToken=B77A5C561934E089" /> - <!-- <add assembly="NzbDrone.Core"/>--> + <add assembly="System.Web.Helpers, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + <add assembly="System.Web.WebPages, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> </assemblies> </compilation> - - - <pages - validateRequest="false" - pageParserFilterType="System.Web.Mvc.ViewTypeParserFilter, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" - pageBaseType="System.Web.Mvc.ViewPage, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" - userControlBaseType="System.Web.Mvc.ViewUserControl, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"> + <pages validateRequest="false" + pageParserFilterType="System.Web.Mvc.ViewTypeParserFilter, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35" + pageBaseType="System.Web.Mvc.ViewPage, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35" + userControlBaseType="System.Web.Mvc.ViewUserControl, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35"> <controls> <add assembly="System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" namespace="System.Web.Mvc" tagPrefix="mvc" /> </controls> - <!-- rest of your pages section --> <namespaces> <add namespace="System.Web.Mvc" /> <add namespace="System.Web.Mvc.Ajax" /> <add namespace="System.Web.Mvc.Html" /> <add namespace="System.Web.Routing" /> <add namespace="Telerik.Web.Mvc" /> - <!--<add namespace="NzbDrone.Core.Repository"/>--> <add namespace="Telerik.Web.Mvc.UI" /> + <add namespace="System.Web.Helpers" /> + <add namespace="System.Web.WebPages" /> </namespaces> </pages> - <customErrors mode="Off" /> <httpHandlers> <add verb="GET,HEAD" path="asset.axd" validate="false" type="Telerik.Web.Mvc.WebAssetHttpHandler, Telerik.Web.Mvc" /> @@ -56,7 +56,7 @@ <assemblyBinding xmlns="urn:schemas-microsoft-com:asm.v1"> <dependentAssembly> <assemblyIdentity name="System.Web.Mvc" publicKeyToken="31bf3856ad364e35" /> - <bindingRedirect oldVersion="3.0.0.0" newVersion="3.0.0.0" /> + <bindingRedirect oldVersion="1.0.0.0-2.0.0.0" newVersion="3.0.0.0" /> </dependentAssembly> </assemblyBinding> </runtime>